Q: CH30
A:
Q: What is the enantiomeric excess (ee) of a sample of mendalic acid with a specific rotation of +50, w...
A:
Q: The volume of water upon freezing. Therefore, liquid water has, density than solid ice. O expands, l...
A: Option B is correct answer. Expand, higher
Q: Calculate the ÄE°yn for the decomposition of calcium carbonate to calcium oxide and carbon dioxide. ...
A:
Q: raw step 2 of the mechanism. + H,C TV Ź + I +t + +1
A:
Q: When the concentrations of reactant molecules are increased, the rate of reaction increases. The bes...
A:
Q: Part D Calculate the standard-state entropy for the following reaction: 1 CH4(g) + 2 O2(g) → 1 CO2(g...
A: Given, Sm° (H2O) = 189 J/K.mol Sm°(O2) = 205 J/K.mol Sm°(CH4) = 186 J/K.mol Sm° (CO2) = 214 J/K...
Q: What is the equilibrium constant (K) at 25°C for the following cell reaction? Co(s) +Ni2+→Ni(s)+ Co...
A:
Q: Hl HO OH hexal p ortitafs of 13.5
A:
Q: Percentage Composition: Aluminum Phosphate
A:
Q: Whea the conceatratioas of reactaat molecules are iacreased, the ate of reaction increases. The best...
A:
Q: The change (delta) E of a system that absorbs 12.4 J of heat and does 4.2 J of work on the surroundi...
A: Given that, ∆H = 12.4 J w=4.2 J ∆E = ?
Q: Enough silver sulfite (Ag2SO3 , Ksp = 1.5 × 10-14 ) is dissolved in 2.00 L to produce a saturated so...
A: Given: pH = 2.00 And volume of solution = 2.00 L Concentration of H+ = 10-pH = 10-2.00 = 1.0 × 10-2 ...
Q: if the H3O+ ion concentration in an aqueous solution at 25 °c measured 4.61 * 10^-8 M, what is the p...
A: Given : [H+] = 4.61 * 10^-8 M
Q: → products) (Don't forget • If there is reaction, write a complete chemical equation (reactants to i...
A:
Q: how do you find the mmol and mass (in grams) of something if you are only given the formula weight
A:
Q: NaOCH3 CH3OH HCI CH3OH
A: Epoxide ring can open by nucleophile either in acidic medium or in absence of acidic medium.
Q: Below is a simple set of weights obtained while immersing potato slices in various sugar solutions o...
A: The data given is,
Q: N2 + 3H2 = 2NH3 s 0.159 at 450°C. Calculate the equilibrium composition when 1.50 N2 is mixed with 4...
A:
Q: of F. Hydrazine, N,H, reacts with oxygen to form nitrogen gas and water. If 3.75 g of N,H, reacts wi...
A:
Q: 3. water occurs in three steps. The sour taste of lemons is attributed to citric acid. The dissociat...
A: Given: Citric acid dissociates in water as per the below three steps.
Q: Item 1 I Review | Constants | Periodic Table Elemental carbon usually exists in one of two forms: gr...
A:
Q: Balance the equation in basic conditions. N2H4 + Cu(OH)2 -> N2 + Cu
A: Balance chemical reaction: 2 Cu(OH)2 + N2H4 ---> 2 Cu + N2 + 4H2O
Q: A 24.7 mL of HCI solution nis completely neutralized by 35.8 mL of 0.25 M of NaOH. What is the conce...
A:
Q: or Ex. What does this mark mean? What are the major differences between the two and what are their a...
A:
Q: FelOH,) be low Calkulut e in all iron CUmplexes K OH O.1355 M with Sowtion sa tusated FCOH)2 F COH)2...
A: Fe(OH)2 dissociates as:Fe(OH)2(s)→Fe2++2OH-Ksp=[Fe2+][OH-]2 7.9×10-15=[Fe2+](0.1355)2 [Fe2+]=4.3×1...
Q: Determine whether the following reaction is likely to proceed by an E1 or E2 mechanism. CH;CH;OH Br ...
A: E1 _elimination unimolecular Reaction E2 - elimination bimolecular Reaction
Q: What mass of phosphoric acid, H 3PO 4 Would actually react with 7.17 grams of LIOH? 3LIOH + H3PO4 → ...
A:
Q: Select the equilibrium constant expression for the reaction in the diagram. In the diagram, X atoms ...
A: Write equilibrium expression of the given reaction---
Q: How many grams of NaCl would you need to make 100 ml of a 9.7%(m/v) solution of NaCl?
A: Given, a NaCl solution with concentration 9.7 % ( w/v)we are asked to calculate the amount of NaCl r...
Q: 1. Calculate the mass (in grams) of magnesium chloride (MgCl 2 ) that would be needed to prepare 150...
A:
Q: If 0. 274 moles of a substance weighs 62.5 g, what is the molar mass of the substance, in units of g...
A: Given- Moles of substance =0.274 moles Weight of substance= 62.5 g
Q: f. a B+ BO+ O. + 3
A: Solution is given below in next step
Q: Write the formula and balance the following. Barium hydroxide (aq) + Acetic acid (aq)→ Barium aceta...
A: Balanced equation can be defined as the equation in which atoms of each element are present on both...
Q: Calculate the standard enthalpy of formation of phenol, C 6H5OH, at 298.15 K given that, at this tem...
A:
Q: AgCl has a solubility of 2.2E0 mg/L at room temperature. Based on this information, what is the K fo...
A:
Q: The registered pharmacy technician receives a prescription for 100 of 17% w/ v salicylic acid ointme...
A: Given: prescription required = 17 % w/v salicylic acid ointment. Amount of ointment required = 100 g...
Q: For the chemical reaction system described by the diagram below, which statement is true? Energy Rea...
A: Activation energy is energy difference between reactant (or) product and energy barrier.
Q: Part 4: Answer the following question. 12. Using the vocabulary terms atom and element appropriate...
A: Atom and element: If we look very precisely then an atom is the part of an element. A particular ele...
Q: Two (2) grams of vinegar solution was given to you to analyze for the percent acetic acid present in...
A:
Q: Starting with the following equation, Fe,O3(s) + Al(s) → Fe(1) + Al,O3(s) calculate the moles of Fe,...
A: Given : Mass of Fe = 645g
Q: T'E'N'A Questions: 1. What point where ethanol begins to melt? 2. What is ethanol's melting point? ,...
A:
Q: Identify the type of reaction for the following: H2 Rearrangement reaction Substitution Elimination ...
A:
Q: Calculate the molar solubility of ZnC2O4 in a solution that has a fixed H3O+ concentration of: 1.0x1...
A: Given: Concentration of H3O+ or H+ = 1.0 × 10-6 M
Q: A buffer that is 0.671 M in acridine (C13H9N) and 0.671 M in acridinium chloride (C13H10NCl) has a p...
A: Given- Molarity of C13H9N = 0.671 M Molarity of C13H10NCl = 0.671 M Volume of buffer = 100.0 ml Volu...
Q: Five grams of vinegar solution was given to you to analyze for the pe 0.0036 moles of NHOH was used ...
A:
Q: What should be the coefficient of BiO3- in order to balance the reaction: Mn2+ + BiO3- ---H+----> ...
A: Balance the redox reaction under acidic medium... Answer:- coefficient of BiO3- is = 5
Q: (i) H3C- -CH3 + H2N-CH3 (i) H;C-c-CH3 + H3C- H2N-CH3
A: In this question, we have to predict the product in both the reactions:
Q: Calculate the molality of a solution that is 20.0% by weight acetic acid. Atomic weights: C = 12.01...
A:
Q: Use the thermodynamic quantities given below to calculate the theoretical ΔH for this reaction: ...
A:
What kind of crystals would have more surface contamination after cooling the acetanilide in the recrystallization experiment?
Step by step
Solved in 2 steps with 2 images
- Why should you use a minimum amount of water to rinse the conical vial while transferring the purified acetaminophen to the Hirsch funnel?Why should the boiling point of the solvent be lower than the melting point of the compound being recrystallized?To purify benzil crystals and get rid of any leftover traces of benzoin, what would be the best solvent to use for recrystallization?
- Why is methanol chosen as the solvent for recrystallization? What would happen if the student uses dichloromethane instead?Why can't a mixture of water and diethyl ether be used for recrystallization?Diethyl ether and methylene chloride are generally not suitable for use in recrystallization, but are frequently used as extraction solvents. Explain
- Why should you use cold water to rinse the acetaminophen in the Buchner funnel?How to tell if recrystallization successfully purified the sample? Why?The weight of the purified caffeine is often much lower than the weight of the crude caffeine. Explain why the percent recovery is frequently low? How the experiment might be changed to improve it?
- Discuss the purity of Acetanilide before and after crystallization based on melting points. Discuss the percent recovery after crystallization. Is water a good solvent for recrystallization ?Based on the readings and lecture on emulsions, and the procedures for this lab answer the following question. What is the dispersed phase in the simple vinaigrette? Air Oil Water EggAssume that charcoal and sugar are the two main impurities in the sample of benzoic acid. Explain how you could perform recrystallization using water toremove each impurity.