The boiling point of ammonia (NH3) and phosphine (PH3) are 240K and 185K respectively. Account for this difference. Explain why Hydrogen gas exist as a diatomic molecule whereas Helium gas is monoatomic? Explain why Kerosene readily dissolves in petrol but not in water

Q: For pairs of molecules in the gas phase, average H-bond dissociation energies are 17 kJ/mol for NH3,…

A: Bond dissociation energy is directly proportional to the bond strength. The average H-bond…

Q: How many grams of Pb(NO3)2 (331.2 g/mol )are needed to prepare 300 ppm (w/v) of Pb (207.2 g/mol) in…

A:

Q: The concentration of glucose in an aqueous solution can be determined by oxidation with ferricyanide…

A: Given Glucose mg/ml Absorbance 5 0.132 10 0.290 20 0.498 30 0.642 40 0.750

Q: how can you use the physical properties of melting solubility and conductivity to classify ionic and…

A: Ionic compounds have high melting point due to strong intermolecular force of attraction between the…

Q: Is amoxicillian sodium stable at 55 degrees celsius?

A: The carboxylic acid functional group is represented as -COOH and its reaction with the strong base…

Q: Hydrogen peroxide (H2O2) has a higher boiling point and a lower vapor pressure than water. Justify…

A: Since you have asked multiple questions, we will solve the first question for you. If you want any…

Q: solution       conductivity (MS) NaCl              6594 CaCl2             13188 AlCl3…

A: Molecules which dissociate into ions results in higher conductivity of the solution.

Q: The amount of saturation not only has an effect on the chemical but also the physical properties of…

A: Given: The amount of saturation not only has an effect on the chemical but also the physical…

Q: Boiling Point (deg Celcius) 150 100 50 -50 -100 H20 H2S H2Se H2TE + Boiling Point (deg Celcius) 100…

A: For the hydrides of group-16 elements are expected to be increase in the boiling point on goint from…

Q: What are the importances of allotropic forms in product formulation?

A: Allotropy, the existence of a chemical element in two or more forms, which may differ in the…

Q: hich of the following statements is false regarding hydrogen peroxide? Reaction of H2O2 with Fe2+…

A: Reaction of H2O2 with Fe2+ ions will generate OH radicals. See the written solution

Q: Explain why thallium(I) fluoride is very soluble in water but other thallium(I) halides are much…

A:

Q: Explain, using intermolecular forces, why at room temperature, petrol (mainly octane, C8H18) is a…

A:

Q: Describe any visual differences between the hydrated sample and the dried, anhydrous form of a…

A: The given sample is a potassium (K) alum. Alum is a hydrated double sulfate salt of aluminium (Al).…

Q: How many grams of Pb(NO3)2 (331.2 gimol )are needed to prepare 200 ppm (w/v) of Pb*2 (207.2 g/mol)…

A: The concentration of Pb2+ ions is = 200 ppm The volume of the solution is =? The molar mass of lead…

Q: the binding energy of a KCI molecule was estimated to be 5.15 eV by assuming each of the K+ and Cl…

A: In an ionic compound, the binding energy can be thought of as the energy required to separate the…

Q: In terms of intermolecular forces explain why the boiling point of Br2 (59C) is lower than that of…

A: Boiling point depends on the intermolecular forces. Boiling point will be higher for compounds…

Q: The boiling points of group 16 binary hydrides are as follows: H2O 100 oC; H2S -60 oC; H2Se -41 oC.

A: Boiling points is directly affected by the intermolecular forces. Stronger the intermolecular…

Q: What is the point of silicon dioxide? 8. Why are careful stoichiometric calculations important for…

A: 7)  The importance of airbag safety is that during an accident if airbags work properly, they can…

Q: What properties of carbon dioxide allow it to be used as a fire extinguisher

A: Carbon dioxide effectively replaces the oxygen content in the air around the fuel to below that…

Q: Solution:              conductivity(MS) H2O distelled      95 H2O tap               1236 NH3…

A: The given molecules are, H2O distilled, H2O tap water, NH3

Q: An example of macroscopic property is the: a) angle of collision between molecules. O b) shape of…

A: We have to identify which of the following is an example of a macroscopic property : a) angle of…

Q: Using appropriate chemical reactions for illustration, show how calcium present as the dissolved…

A: Bicarbonate, chloride salts of calcium causes hardness of water. Out of both, bicarbonate causes…

Q: Write the balanced chemical equation for the reaction between iodate and bisulfite. Does the order…

A: The reaction between iodate and bisulfite in acid medium produces iodine. Solutions A (iodate) and B…

Q: With the aid of a diagram, describe the covalent bonds that an oxygen atom with atomic number 8 can…

A: When two or more elements have incomplete octet ,then if they share their valence electrons in such…

Q: How are the shapes of PBr3 and BBr3 different?  What is the reason for the difference?

A: Given Molecules PBr3 BBr3 Shapes of Molecules = To be determined

Q: briefly explain why the oleic acid molecules organize themselves into a monolayer?

A: Oleic acid is a fatty acid with the molecular formula CH3(CH2)7CH=CH(CH2)7COOH.

Q: Cyanamide, NH2CN, has a melting point of 45 °C. (a) Draw a dot-and-cross diagram to illustrate the…

A: As per our guidelines we can only solve first question. Please resubmit the other questions as next…

Q: Colligative properties of a solution are mostly determined by—     degree of polarity of the…

A: Colligative properties are the properties of the solution . And the solution will be ideal in…

Q: 19 C9H7NO4 MW = 193

A:

Q: Based on the conductivity, identify the type of bonding that occurs in each solution. 1. Silver…

A: Given : Different type of compounds.  To find :based on conductivity, type of bonding.  Solution :…

Q: 0.84 g of a metallic element reacts completely with 5000 cm3 of oxygen at 441 K and 22 kPa pressure…

A:

Q: What is meant by the term ‘pyrometallurgy’?

A: A process that is used for the extraction of metals in their pure form is known as metallurgy.…

Q: how does the excess citrate ion (C6H5O73‐) affect nanoparticle synthesis?

A: Given information,Synthesis of nanoparticles using citrate ion.

Q: Write down the processes and related reactions to qualitatively determine the element N in the…

A: Explanation- Process- We can detect cyanide ion and hence, nitrogen ion in the sample by the…

Q: Why does NH3 forms intermolecular hydrogen bonds whereas PH3 doesnot?

A: Hydrogen bonding is a kind of intermolecular force where the H attached to an electronegative…

Q: Explain the Jahn-Teller effect and provide an example. (Inorganic Chemistry)

A: John- Teller effect :- The Jahn-Teller (J-T) theorem states that in molecules/ ions that have a…

Q: After a dye diffuses uniformly throughout a glass of water, the dye molecules are no longer moving…

A: The given statement is  After a dye diffuses uniformly throughout a glass of water, the dye…

Q: How many valence electrons do you have to account for when drawing the Lewis dot structure of PCl5?

A: Valence electron of phosphorus is five and valence electrons of chlorine is seven.

Q: 1. If she wrote that the mass of nitrogen gas as 114.6 g and the mass of fluorine gas as 354.8 g…

A: Reaction involved : N2(g) + 3F2(g)------> 2NF3(g) Given : Mass of nitrogen (N2)=114.6g Mass of…

Q: How do calcium ions in water affect the textural properties of products during cooking in water?…

A: Hardness in water is due to the presence of dissolved salts of calcium and magnesium. It is unfit…

Q: Suppose you had  300.g  of ordinary table sugar, which chemists call sucrose, and which has the…

A: Reaction of sucrose and H2SO4 extract water in the following way C12H22O11 + [H2SO4 ] →12C +11H2O +…

Q: order of elution of the three halocarbons with respect to: a) Molecular size alone b) Boiling point…

A: Molecular size order :  Carbon tetrachloride (CCl4) > Chloroform (CCl3) > Dichloromethane…

Solutions

Solutions can be considered as homogeneous mixtures which contain two or more than two chemical substances. The chemical substance which is the greater part is defined as solvent. And the chemical substance that is dissolved in a solvent is referred to as solute. Solution chemistry plays an important role in chemistry since it supports many commercial applications of solutions.