The equilibrium constant, K, for the following reaction is 0.440 at 341 K.NH₂HS(s)NH₂(g) + H₂S(a)An equilibrium mixture in a 18.8 L container at 341 K contains 0.323 mol NH,HS(s), 0.882 M NH, and 0.499 M H,S. What will be the concentrations of the two gases onceequilibrium has been reestablished, if the equilibrium mixture is compressed at constant temperature to a volume of 11.1 L7(NH₂-[H₂S] -MM

Recall the given reaction, NH4HS s ↔ NH3 g + H2S gThe equilibrium…

The equilibrium constant, K, for the following reaction is 0.440 at 341 K. NH₂HS(s)NH₂(g) + H₂S(g) An equilibrium mixture in a 18.8L container at 341 K contains 0.323 mol NH₂HS(s), 0.882 M NH, and 0.499 M H₂5. What will be the concentrations of the two gases once equilibrium has been reestablished, of the equilibrium moxture is compressed at constant temperature to a volume of 11.1 L7 (NH₂)- [H₂S] - M

The equilibrium constant, K, for the following reaction is 0.440 at 341 K. NH₂HS(s)NH₂(g) + H₂S(g) An equilibrium mixture in a 18.8L container at 341 K contains 0.323 mol NH₂HS(s), 0.882 M NH, and 0.499 M H₂5. What will be the concentrations of the two gases once equilibrium has been reestablished, of the equilibrium moxture is compressed at constant temperature to a volume of 11.1 L7 (NH₂)- [H₂S] - M

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 60QRT

See similar textbooks

Similar questions

The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
A sample of gaseous nitrosyl bromide (NOBr) was placed in a container tiued with a frictionless, massless piston, where it decomposed at 25C according to the following equation: 2NOBr(g)2NO(g)+Br2(g) The initial density of the system was recorded as 4.495 g/L. After equilibrium was reached, the density was noted to be 4.086 g/L. a. Determine the value of the equilibrium constant K for the reaction. b. If Ar(g) is added to the system at equilibrium at constant temperature, what will happen to the equilibrium position? What happens to the value of K? Explain each answer
At 500C, k for the for the formation of ammonia from nitrogen and hydrogen gases is 1.5105. N2(g)+3H2(g)2NH3(g)Calculate the equilibrium partial pressure of hydrogen if the equilibrium partial pressures of ammonia and nitrogen are 0.015 atm and 1.2 atm, respectively.
Methanol, a common laboratory solvent, poses a threat of blindness or death if consumed in sufficient amounts. Once in the body, the substance is oxidized to produce formaldehyde (embalming fluid) and eventually formic acid. Both of these substances are also toxic in varying levels. The equilibrium between methanol and formaldehyde can be described as follows: CH3OH(aq)H2CO(aq)+H2(aq) Assuming the value of K for this reaction is 3.7 1010, what are the equilibrium concentrations of each species if you start with a 1.24 M solution of methanol? What will happen to the concentration of methanol as the formaldehyde is further converted to formic acid?
5.16. In atmospheric chemistry, the following chemical reaction converts , the predominant oxide of sulfur that comes from combustion of S-containing materials, to , which can combine with to make sulfuric acid (and thus contribute to acid rain): (a) Write the expression for K for this equilibrium. (b) Calculate the value of for this equilibrium using the values in Appendix 2. (c) Calculate the value of K for this equilibrium. (d) If of and of are enclosed in a system in the presence of some liquid, in which direction would the reaction move?
Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Describe a nonchemical system that is in equilibrium, and explain how the principles of equilibrium apply to the system.
A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
12.101 An engineer working on a design to extract petroleum from a deep thermal reservoir wishes to capture toxic hydrogen sulfide gases present by reaction with aqueous iron(II) nitrate to form solid iron(II) sulfide. (a) Write the chemical equation for this process, assuming that it reaches equilibrium. (b) What is the equilibrium constant expression for this system? (c) How can the process be manipulated so that it does not reach equilibrium, allowing the continuous removal of hydrogen sulfide?
Nitric oxide and bromine at initial partial pressures of 98.4 and 41.3 torr, respectively, were allowed to react at 300. K. At equilibrium the total pressure was 110.5 torr. The reaction is 2NO(g)+Br2(g)2NOBr(g) a. Calculate the value of Kp. b. What would be the partial pressures of all species if NO and Br2, both at an initial partial pressure of 0.30 atm, were allowed to come to equilibrium at this temperature?