The equilibrium constant, K, for the following reaction is 10.5 at 350 K.2CH,Cl,(g) CH4(g)+ CC14(g)An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.16x10-² M CH,Cl,, 0.167 M CH, and0.167 M CCI4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 3.75x10-2mol of CH,Cl,(g) is added to the flask?(CH,Cl,] =M[CH4)M%3D[CC4]MThe equilibrium constant, K, for the following reaction is 7.00×10-5 at 673 K.NH,I(s) NH3(g) + HI(g)An equilibrium mixture of the solid and the two gases in a 1.00 L flask at 673 K contains 0.222 mol NH,I, 8.37×103M NH3 and 8.37×10-³ M HI. If the concentration of NH3(g) is suddenly increased to 1.34×10-² M, what will be theconcentrations of the two gases once equilibrium has been reestablished?[NH3] =M[HI]M

Given, 2CH2Cl2g↔CH4g+CCl4g Volume = 1L CH2Cl2eq=5.16 X 10-2MCH4eq = 0.167 MCCl4eq=0.167 Mmoles of…

The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH,Cl½(g)#CH4(g) + CC14(g) An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.16×10-² M CH,Cl,, 0.167 M CH4 and 0.167 M CCI4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 3.75×10² mol of CH,Cl½(g) is added to the flask? (CH,Cl,] = M [CH4) M (CC!] M The equilibrium constant, K, for the following reaction is 7.00×10*5 at 673 K. NH,I(s) NH3(g) + HI(g) An equilibrium mixture of the solid and the two gases in a 1.00 L flask at 673 K contains 0.222 mol NH¼I, 8.37×103 M NH3 and 8.37×10-³ M HI. If the concentration of NH3(g) is suddenly increased to 1.34×10² M, what will be the concentrations of the two gases once equilibrium has been reestablished? [NH3] = M (HI] = M

The equilibrium constant, K, for the following reaction is 10.5 at 350 K. 2CH,Cl½(g)#CH4(g) + CC14(g) An equilibrium mixture of the three gases in a 1.00 L flask at 350 K contains 5.16×10-² M CH,Cl,, 0.167 M CH4 and 0.167 M CCI4. What will be the concentrations of the three gases once equilibrium has been reestablished, if 3.75×10² mol of CH,Cl½(g) is added to the flask? (CH,Cl,] = M [CH4) M (CC!] M The equilibrium constant, K, for the following reaction is 7.00×10*5 at 673 K. NH,I(s) NH3(g) + HI(g) An equilibrium mixture of the solid and the two gases in a 1.00 L flask at 673 K contains 0.222 mol NH¼I, 8.37×103 M NH3 and 8.37×10-³ M HI. If the concentration of NH3(g) is suddenly increased to 1.34×10² M, what will be the concentrations of the two gases once equilibrium has been reestablished? [NH3] = M (HI] = M

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 57QRT

See similar textbooks

Similar questions

A solution is prepared by dissolving 0.050 mol of diiodocyclohexane, C5H10I2, in the solvent CCl4.The total solution volume is 1.00 L When the reaction C6H10I2 C6H10 + I2 has come to equilibrium at 35 C, the concentration of I2 is 0.035 mol/L. (a) What are the concentrations of C6H10I2 and C6H10 at equilibrium? (b) Calculate Kc, the equilibrium constant.
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?
The equilibrium constant Kc, for the reaction 2 NOCI(g) 2 NO(g) + Cl2(g) is 3.9 103 at 300 C. A mixture contains the gases at the following concentrations: [NOCl] = 5.0 103 mol/L, [NO] = 2.5 103 mol/L, and [Cl2] = 2.0 103 mol/L. Is the reaction at equilibrium at 300 C? If not, in which direction does the reaction proceed to come to equilibrium?
Kc for the decomposition of ammonium hydrogen sulfide is 1.8 104 at 25 C. NH4HS(s) NH3(g) + H2S(g) (a) When the pure salt decomposes in a flask, what are the equilibrium concentrations of NH3 and H2S? (b) If NH4HS is placed in a flask already containing 0.020 mol/L of NH3 and then the system is allowed to come to equilibrium, what are the equilibrium concentrations of NH3 and H2S?
Nitrosyl chloride, NOC1, decomposes to NO and Cl2 at high temperatures. 2 NOCl(g) ⇌ 2 NO(g) + Cl2(g) Suppose you place 2.00 mol NOC1 in a 1.00–L flask, seal it, and raise the temperature to 462 °C. When equilibrium has been established, 0.66 mol NO is present. Calculate the equilibrium constant Kc for the decomposition reaction from these data.
At room temperature, the equilibrium constant Kc for the reaction 2 NO(g) ⇌ N2(g) + O2(g) is 1.4 × 1030. Is this reaction product-favored or reactant-favored? Explain your answer. In the atmosphere at room temperature the concentration of N2 is 0.33 mol/L, and the concentration of O2 is about 25% of that value. Calculate the equilibrium concentration of NO in the atmosphere produced by the reaction of N2 and O2. How does this affect your answer to Question 11?
Two molecules of A react to form one molecule of B, as in the reaction 2 A(g) B(g) Three experiments are done at different temperatures and equilibrium concentrations are measured. For each experiment, calculate the equilibrium constant, Kc. (a) [A] = 0.74 mol/L, [B] = 0.74 mol/L (b) [A] = 2.0 mol/L, [B] = 2.0 mol/L (c) [A] = 0.01 mol/L, [B] = 0.01 mol/L What can you conclude about this statement: If the concentrations of reactants and products are equal, then the equilibrium constant is always 1.0.
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
Kc = 5.6 1012 at 500 K for the dissociation of iodine molecules to iodine atoms. I2(g) 2 I(g) A mixture has [I2] = 0.020 mol/Land [I] = 2.0 108 mol/L. Is the reaction at equilibrium (at 500 K)? If not, which way must the reaction proceed to reach equilibrium?
For the reaction N2(g)+3H2(g)2NH3(g) show that Kc = Kp(RT)2 Do not use the formula Kp = Kc(RT)5n given in the text. Start from the fact that Pi = [i]RT, where Pi is the partial pressure of substance i and [i] is its molar concentration. Substitute into Kc.
At high temperatures, a dynamic equilibrium exists between carbon monoxide, carbon dioxide, and solid carbon. C(s)+CO2(g)2CO(g);H=172.5kJ At 850C, Kc is 0.153. a What is the value of Kp? b If the original reaction system consisted of just carbon and 1.50 atm of CO2, what are the pressures of CO2 and CO when equilibrium has been established? c How will the equilibrium pressure of CO change if the temperature is decreased?
Gaseous acetic acid molecules have a certain tendency to form dimers. (A dimer is a molecule formed by the association of two identical, simpler molecules.) The equilibrium constant Kc at 25C for this reaction is 3.2 104. a If the initial concentration of CH3COOH monomer (the simpler molecule) is 4.0 104 M, what are the concentrations of monomer and dimer when the system comes to equilibrium? (The simpler quadratic equation is obtained by assuming that all of the acid molecules have dimerized and then some of it dissociates to monomer.) b Why do acetic acid molecules dimerize? What type of structure would you draw for the dimer? c As the temperature increases would you expect the percentage of dimer to increase or decrease? Why?