The Ostwald process is used commercially to produce nitric acid, which is, in turn, used in many modern chemical processes the first step of the Ostwald process, ammonia is reacted with oxygen gas to produce nitric oxide and water. What is the maximum mass of H,0 that can be produced by combining 65.4 g of each reactant? 4 NH, (g) + 50,(g) → 4 NO(g) + 6 H,O(g)

The Ostwald process is used commercially to produce nitric acid, which is, in turn, used in many modern chemical processes the first step of the Ostwald process, ammonia is reacted with oxygen gas to produce nitric oxide and water. What is the maximum mass of H,0 that can be produced by combining 65.4 g of each reactant? 4 NH, (g) + 50,(g) → 4 NO(g) + 6 H,O(g)

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.87PAE

See similar textbooks

Similar questions

3.113 MgCl2 is often found as an impurity in table salt (NaCl). If a 0.05200-g sample of table salt is found to contain 61.10% Cl by mass, describe how you could determine the percentage of MgCl2 in the sample.
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?
When solid silicon tetrachloride reacts with water, solid silicon dioxide and hydrogen chloride gas are formed. (a) Write a balanced equation for the reaction. (b) In an experiment, 45.00 g of silicon tetrachloride are treated with 45.00 mL of water (d=1.00g/mL). What is the theoretical yield of HCI (in grams)? (c) When the reaction is complete, 17.8 L of HCl gas (d=1.49g/L at the conditions of the experiment) are obtained. What is the percent yield? (d) How much of the reactant in excess is unused?
Both water and sulfur dioxide are products from the reaction of sulfuric acid (H2SO4) with copper metal, asshown by the equation 2H2SO4 + Cu SO2 + 2H2O + CuSO4 How many grams of H2O will be produced at the same time that 10.0 g of SO2 is produced?
Boron forms an extensive series of compounds with hydrogen, all with the general formula BxHy. To analyze one of these compounds, you burn it in air and isolate the boron in the form of B2O3 and the hydrogen in the form of water. You find that 0.1482 g BxHy gives 0.4221 g B2O3 when burned in excess O2. Determine the empirical I formula of BxHy.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Nitrobenzene, C6H5NO2, an important raw material for the dye industry, is prepared from benzene, C6H6, and nitric acid, HNO3. C6H6(l)+HNO3(l)C6H5NO2(l)+H2O(l) When 21.6 g of benzene and an excess of HNO3 are used, what is the theoretical yield of nitrobenzene? If 30.0 g of nitrobenzene is recovered, what is the percentage yield?
Hydrogen cyanide is produced industrially from the reaction of gaseous ammonia, oxygen, and methane: 2NH3(g)+3O2(g)+2CH4(g)2HCN(g)+6H2O(g) If 5.00 103 kg each of NH3, O2, and CH4 are reacted, what mass of HCN and of H2O will be produced, assuming 100% yield?
4.21 Ammonium nitrate, NH4NO3, will decompose explosively to form N2, O2, and H2O, a fact that has been exploited in terrorist bombings. What mass of nitrogen is formed by the decomposition of 2.6 kg of ammonium nitrate?
The reaction of methane and water is one way to prepare hydrogen for use as a fuel: CH4(g) + H2O(g) CO(g) + 3 H2(g) If you begin with 995 g of CH4 and 2510 g of water, (a) Which reactant is the limiting reactant? (b) What is the maximum mass of H2 that can be prepared? (c) What mass of the excess reactant remains when the reaction is completed?
How many moles of beryllium (Be) are needed to completely react with 10.0 moles of N2 in the synthesis of the compound Be3N2?
Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.