Using the Ideal Gas Law PV = nRT where R = 0.0821Latn /mol Kcalculate the volume in liters of oxygen produced by the catalytic decomposition of 255 g potassium chlorate according to the following reactionThe oxygen is collected at 2.22 atm and 25.44°C. Express your answer to the correct number of significant figuresBe sure to show all steps completed to arrive at the answer 2KClO 3 (s) 2KCl(s) + 3O 2 (g)

Q: Startting with benzene and using any other necessary reagents of your choice, design a synthesis for...

A: The synthesis of the given compound is given below-  

Q: How many moles are there in 7.56 x 10^23 molecules of propane 

A: Since 1mole of any compound  contains = 6.023 *1023 molecules  i.e. is equal to Avagadro no.

Q: y = 3506.2x + 0.0421      R2 = 0.9978 A student prepared a solution that had 5.00 mL 0.002 M iron(II...

A: The equation of graph of Absorbance v/s concentration is y = 3506.2x + 0.0421 Calculation of concent...

Q: Explain the difference between a homogeneous and a heterogeneous mixture.

A: Homogenous solution: Solution having uniform property and composition throughout the solution. Heter...

Q: Solids, liquids, and gases are the three most commonly accepted phases of matter. Explain the proper...

A: solids have a very distinct shape and volume, liquids have a precise volume and takes the shape of t...

Q: 5

A: ***As per Bartleby's guidelines, I can solve only the first three questions. You can resubmit the re...

Q: What percent of the chlorine sources are natural?What percent are manufactured compounds?

A: Chlorine is a reactive element that finds various applications in industries. Natural chlorine can b...

Q: How much mass will the cube in Figure 1.21 have if a 2-c m 3 cube of the same material has a mass of...

A: The box made up of the same material means their density will be constant. This means the box of vol...

Q: Round each number to four significant figures, and write the answer in scientific notation.a. 0.0005...

A: The quantities which come across during the scientific studies are named as physical quantities. The...

Q: The heat of fusion of water is 79.9 Cal/G. How much heat would be required to melt 75.9 G of ice?

A: Given: Mass of ice, m =75.9  g The heat of fusion of water =79.9 Cal/g  

Q: After burning for three hours, a candle has lost half of its mass. Explain why this example does not...

A: Law of conservation of mass states that Mass can not be created or can not be destroyed during any c...

Q: A sample of nitrogen has a volume of 4.72 L at 1,040 mmHg and -31 degree C. What volume will it occu...

A: V1 = 4.72 L P1 = 1040 mmHg = 1.368 atm T1 = – 31°C = (–31 + 273 )K = 242 K At STP, P2 = 1 atm T2 = 0...

Q: Name and define the common states of matter

A: Matter: Any substance in universe that has mass and occupies some space is termed as matter.

Q: Explain the differences between an ideal gas and a real gas.

A: Ideal gas : A gas that have negligible volume and no interactions between molecules (randomly moving...

Q: Chemistry 1. calculate the emission wavelength in nm of the photon that is emitted when an electron...

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question s...

Q: The mole is a counting number that allows scientists to describe how individual molecules and atoms ...

A:

Q: Explain why the concentration of CFCs increased in the atmosphere.

A: Chlorofluorocarbons(CFCs) are a chlorine-containing compound used in several appliances and cause de...

Q: 25 L  of a gas were collected over water when the barometer read 505.0 mmHg  and the  temperature wa...

A: First find the moles and then volume at standard conditions.

Q: The warmest temperature ever measured in the United States is 134 °F, recorded on July 10, 1913, in ...

A: Interpretation -  To convert the temperature to oC  and K when warmest temperature ever measured in ...

Q: If you mix 11.5 grams of HNO3 into 10.26 liters of water, what is the pH? How many grams of Acetic ...

A: Given data,Mass of HNO3=11.5gVolume of water=10.26L

Q: How do solids, liquids, and gases differ?

A: Solids, liquids and gases are all three states of matter. Each matter of state is made up of atoms a...

Q: For the given molecule, what is the hybridization at the atom numbered 2?    For atom 3, what is the...

A: Applying concept of hybridization and bond angle.

Q: For each number, underline the zeroes that are significant and draw an x through the zeroes that are...

A: For each number, underline the zeroes that are significant and draw an x through the zeroes that are...

Q: Gaseous hydrogen and oxygen can be prepared in the laboratory from the decomposition of gaseous wate...

A: Applying concept of limiting reagent and mole concept.

Q: complete part E AND F ONLY

A: NaH is a base so it will abstract proton (H) proton from  carboxylic acid.

Q: Answer number 6 please put I graph format

A: Formation of ammonia  3 H2 + N2 → 2 NH3 From this Reaction we get that , by 3 moles of H2 we get the...

Q: Classify each of the listed properties of isopropyl alcohol (also known as rubbing alcohol) as physi...

A: Physical properties can be measured or observed without changing the identity of the substance. Phys...

Q: #23, d,e,f, g

A: We know that ; 1 mole = 6.022 × 1023 atoms  By using this from the moles we can find the number of a...

Q: Calculate the number of moles of solute in 90.79 mL90.79 mL of 0.1895 M K2Cr2O7(aq).

A: Molarity of K2Cr2O7  = 0.1895 M = 0.1895 mol/L   Volume of solution = 90.79 mL  ( 1 mL = 10-3 L ) = ...

Q: 100 80 60 PE (kJ) A+B 40 20 C+D - Progress of the reaction

A: If the potential energy of product is less than the reactant then it will  be exothermic reaction an...

Q: How many grams of H2 are needed if we want to make 80.49 grams of CH4 by the reaction  C+2H2 —->...

A:

Q: Design a concept map that shows the relationships among the following terms: volume, derived unit, m...

A: Units are two types: fundamental units/base unit and derived units. Fundamental units/base units are...

Q: Consider the reaction.   2Fe2O3⟶4Fe+3O2Δ?∘rxn=+824.2 kJ2Fe2O3⟶4Fe+3O2ΔHrxn°=+824.2 kJ   The format...

A: Balanced Reaction 2Fe2O3 ⟶ 4Fe+3O2 ΔH°rxn =+824.2 kJ Fe2O3 produces iron and oxygen on heating. This...

Q: Compare a base unit and a derived unit, and list the derived units used fordensity and volume.

A: The base unit and derived unit has to be compared. The derived units of density and volume has to be...

Q: The compound tris-(8-hydroxyquinolato)aluminum(III). Draw the structural isomers for this compound....

A: Tris(8-hydroxyquinolinato)aluminium is the chemical compound with the formula Al(C9H6NO)3. Point gro...

Q: Compare and contrast elements and compounds.

A: Elements and compounds have to be compared and constructed below.

Q: Consider the reaction shown.   4HCl(g)+O2(g)⟶2Cl2(g)+2H2O(g)4HCl(g)+O2(g)⟶2Cl2(g)+2H2O(g)   Calculat...

A: The balanced Chemical equation given in the question is -   4HCl(g) + O2(g)⟶ 2Cl2(g) + 2H2O(g)   The...

Q: List three examples of substances. Explain why each is a substance.

A: List three examples of substances. Explain why each is a substance.

Q: 1. calculate the emission wavelength in nm of the photon that is emitted when an electron in a hydro...

A: “Since you have asked multiple questions, we will solve the first question for you. If you want any ...

Q: 3) Calculate the physiological AG for the reaction: Phosphocreatine + ADP → creatine + ATP at 25 °C ...

A:

Q: 5. Use standard heats of formation from table A-14 to calculate the heats of reaction for the follow...

A: formula used:- ∆H°f = ∆H°(product)-∆H°f( reactant)

Q: Solve the following problems.a. (2 × 1 0 3) × (3 × 1 0 2)b. (9 × 1 0 8) ÷ (3 × 1 0 -4)

A: a.  (2 × 1 03) × (3 × 1 02)= 6 × 105            ( am × an = am+n)    

Q: s Fe3+ is both enviromentally friendly is L UDdent in nature A in

A: The symbol Fe3+ represents iron in +3 oxidation state. It is also denoted as ferric ion. It is an im...

Q: Chemistry Question

A: The standard reduction potential of Na+ , K+ , H+ and Cu2+ are -2.71 V, 2.93 V, 0 V and 0.34 V. This...

Q: The black hole in the M82 galaxy has a mass about 500 times the mass of the Sun. It has about the sa...

A: Given information: Mass of the sun = 1.9891 ×1030 kg Volume of moon = 2.1968 × 10 10 km3

Q: Three students use a meterstick with millimeter markings to measure a length of wire. Their measurem...

A: Given: Their measurements are 3 cm, 3.3 cm, and 2.87 cm, respectively   To find: Explain which answe...

Q: A solution contains 1.0 x 10S M Na3PO4. What is the minimum concentration of AGNO3 that would cause ...

A: Hello. Since your question has multiple parts, we will solve first question for you. If you want rem...

Q: 2. How many moles of iron (II) oxide will be synthesized if you start with 5.3 grams of iron metal? ...

A: Molar mass of iron = 55.845 g/mol  From balanced equation, 4 mol of Fe produces 2 mol of Fe2O3. Mola...

Q: Name the compound in iupac system

A: Name the compound in IUPAC system,

Q: Chemistry Question

A:

Mole Concept

Mole concept is a method to determine the amount of any substance that consists of some elemental particles using a grouping unit called ‘mole’. The mole concept enables one to handle the large amount of small elementary particles. The mole concept can be used in many calculations related to mole calculation, molar amount, mole ratio, and so on, which are significant in chemistry.