What is the concentration of hydroxide ions with a pH of 4.76?

Q: INT: This problem has 2 conversions. Convert the given to moles, then convert the moles to the final...

A: Given : Volume of CH4 = 28.8L

Q: ) Balance the following equations and state whether they are redox or non-redox reactions. For the r...

A: Redox reaction is the reaction in which oxidation that is loss of electrons as well as reduction tha...

Q: 2. Consider the reaction Pb(NO:)2 + NazCO3 -→ ? + ? (a) Write the molecular equation (b) write the I...

A: Spectator ions are that doesn't directly involve in the reaction or remain unchanged during the reac...

Q: Why is malonic acid a diprotic acid

A:

Q: The vapor pressure of an aqueous sucrose (C12H22O11) solution decreases by 0.475kPa at 25.0°C. Calcu...

A:  Vapour pressure of sucrose 0.475kPa. Temperature 25.0°C.=298 k. We have to find  concentration of s...

Q: 6. A container of yogurt has 240 Calories. What mass of perspiration would someone have to lose to g...

A: Given that, a container of yogurt has 240 calories. At body temperature, the latent heat of vaporiza...

Q: Let's put all of the relationships we have learned about together with a pushing question. Consider ...

A: To find the molarity of a solution-1 from the mixture of solution-1 and 2, the following equation is...

Q: Isopropyl alcohol is often used as a disinfectant. What are the consequences if this bottle of isopr...

A: Introduction :  Isopropyl Alcohol is a colourless liquid with a sharp, musty  odor, it is used in ma...

Q: specific heat

A:

Q: of nodal planes p

A:

Q: lease provide the reagents necessary to perform the conversions shown below. Please remember ou are ...

A: The answer is as follows:  

Q: Write the IUPAC name for the compound below. Be sure to use correct punctuation. CHy-CH-CHy-CH, CH3-...

A:   i) The longest carbon chain in the given compound contains nine carbon atoms. Therefore, the root ...

Q: y grams of

A: Since you have asked multiple questions, we will solve the first question for you. If you want any s...

Q: Which of the following compound pairs could be separated by simple distillation?  a. acetone and an...

A: Which of the following compound pairs could be separated by simple distillation? a. acetone and anil...

Q: The reaction of methane with water to form carbon dioxide and hydrogen is non- spontaneous at 298 K....

A: To become the spontaneous reaction it must have change in Gibbs free energy negative. In order to do...

Q: 6) How many grams of cobalt is produced when 3.56 g of cobalt (II) oxide and 3.69 g of aluminum are ...

A:

Q: Calculate the molarity of a Sulfuric acid reagent (98% w/w) with a specific gravity of 1.80.

A: Given,  Sulfuric acid reagent (98% w/w) with a specific gravity of 1.80 

Q: 1. Explain why the temperature gradually drops as the solution is in the process of freezing.

A: A process where a liquid turns into a solid at a constant temperature is known as freezing.

Q: formula

A:

Q: Give the systematic name for the following compounds. 1. C(CH3)3CH(CH3)CH2CH(CH2CH3)CH2CH3  2. CH3...

A:

Q: What mass of BaF2 (175.30 g/mol) must be added to 1275 g of water to lower the freezing point of the...

A:

Q: d) 1.EtMgBr. 2. HО PCC CH2Cl2 A

A:

Q: Consider a decomposition reaction that occurs via the following balanced chemical equation: X2Y → X2...

A:

Q: What is the hybridization of the central iodine atom in the triiodide ion, I3-? A. sp3 B. sp3d2 C...

A: The given compound is I3- (triiodide ion).

Q: F.

A: Axial and equatorial are types of bonds found in the 'chair' conformation of cyclohexane. The chair ...

Q: A chemist weighed out 101. g of calcium. Calculate the number of moles of calcium she weighed out. B...

A:  As the question asks to find out the no of moles ,so let me first define mole :- It is equal to the...

Q: at what temperature will a solution boil that contains 344g of nitrobenzene (123.11g/mol) to which 4...

A: Mass of solute of Toulene = 4.17 g  Mass of solvent , nitrobenzene = 344 g  Molar mass of Toulene = ...

Q: 11. Given the following galvanic cell, calculate the potential of the cell at 298 K Pb | Pb+2 (0.139...

A:

Q: The role of calcium ions (Ca) in neural signal transmission is to cause the relegs

A: In this question we have to choose correct option for the role of calcium ion in neural signal trans...

Q: Consider the hypothetical reaction: P+ Q product. Determine the rate law of the reaction using the p...

A: Given,

Q: MCPBA

A: Given, 

Q: Which compound has the highest lattice energy A. NaCl B. NaBr C. MgCl2 D. MgBr2

A:

Q: pH

A:

Q: Outline the properties that would be expected of the element flerovium (the period 7 element in grou...

A: Answer - Flerovium is a superheavy artificial chemical element with the symbol Fl and atomic number ...

Q: What is the difference between rate order and rate law?

A: In the Rate law expression , rate order terms are used.  Thus both are dependent on each other.  But...

Q: 2 N2O5(g) → 4 NO2(g) + O2(g) If the rate of disappearance of N2O5 is equal to 3.20 mol/min, what is...

A:

Q: a) What is the molar concentration of the Solution in 250.0mL b) if loo.OmL of solvent is added to t...

A: Mass of AuCl3 = 53.3g  Volume of water = 250mL  

Q: A weather balloon contains 68.5 g of helium (He) gas. Calculate the volume (in L) of the balloon at ...

A:

Q: Antimony, Sb has 2 isotopes and an atomic weight of 121.75 amu. The isotope anitimony-121 has a natu...

A: Given percentage abundance  Sb-121 = 57.25℅ Sb-123 = 41.75℅ Mass of Sb-123 = 122.9041 amu atomic mas...

Q: Menthol is a very cool compound. If a sample of menthol is examined by UV spectroscopy, what would y...

A: Given :- Menthol compound which is a very cool compound, so here we have to find that what would we ...

Q: grams per liter

A:

Q: Answer questions a-c about the Bronsted acid-base reaction below using the identifying letters A-D b...

A: Bronsted-Lowry acid-base theory: The Bronsted-Lowry acid-base theory states that the acid is a subst...

Q: Which indicator using in complexometeric and what the pH. Eriochromo red T and pH range is 8-10. Eri...

A: Answer of the question given below, 

Q: Determine the amount of heat (in kJ) required to convert 8.24 moles of liquid methanol at-22°C into ...

A:

Q: Which element in the periodic table has a specific heat of 0.099 Pick the closest if needed

A:

Q: A plot of pressure-volume isotherms for an ideal gas at two different temperatures is shown below. C...

A: For cyclic process,  Delta ( state function ) = 0  Because state function depends upon only it's ini...

Q: Benzoic acid is a weak acid that has antimicrobial properties. Its sodium salt, sodium benzoate, is ...

A:

Q: 1. Manufacturers of headache remedies routinely claim that their brands are more potent pain relieve...

A: Given that, extra-strength Tylenol uses 600 mg = (600/1000) g = 0.6 g of acetaminophen (C8H9NO2). We...

Q: Which element in the periodic table has a specific heat of 0.850

A:

Q: Sample Problem X. Percentage mass weight by volume and sample preparation Calculate the % w/v of 623...

A: Given: Mass of casein = 623 mg The volume of solution = 15.0 mL

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.