What is the IUPAC name for the following molecule?CH3For the toolbar, press ALT+F10 (PC) or ALT+FN+F10 (Mac).BIU SParagraphArialA vIxABC-[+1EvClick Save and Submit to save and submit. Click Save All Answers toJUL

Rules for naming cyclic organic compound is as follows; First, count the number of carbon atoms…

Answered: What is the IUPAC name for the…

Science

Chemistry

What is the IUPAC name for the following molecule? CH3

Organic Chemistry: A Guided Inquiry

2nd Edition

ISBN:9780618974122

Author:Andrei Straumanis

Publisher:Andrei Straumanis

Chapter6: Alkanes & Alkenes

Section: Chapter Questions

Problem 16E

See similar textbooks

Related questions

Q: What is the IUPAC name for the following molecule? ОН

A: The given compounds is : CH3CH2CH2CH2CH(OH)CH2CH2CH3 This compound is an alcohol as it contains -OH…

Q: What is the IUPAC name for the compound shown in the image?

A: The given compound is saturated hydrocarbon and has a ring structure with 5 carbon atoms. Since it…

Q: What is the IUPAC name for the following compound? CH3 CH;CH,OCOCH,CH3 danens ÓCH,CH3

A: Given: Determine the longest hydrocarbon chain and number them in a way such that the substituents…

Q: What is the IUPAC name of the following compound? н CHа н н CHа н T

A: For giving IUPAC name to the given compound,First identify the parent carbon chain and number it in…

Q: Fill in the blank: What is the IUPAC name for the following compound? Br

A: The given compound is: The IUPAC name of this compound has to be determined.

Q: Give the IUPAC NAME of the following compound: (CH3)2C=CH2 Your answer

Q: What is the IUPAC name for the following compound? NH₂

Q: What is the IUPAC name of the following compound? SH

A: The IUPAC name of the given compound is given in step 2

Q: What is the IUPAC name of the following compound? н cH н Cна н T T T

A: Given compound is an alkane. The IUPAC name of alkanes are written by giving “ane” as the suffix.…

Q: What is the IUPAC name for the following compound? HO

A: IUPAC name of the organic compound is composed of the following three components:Root name = depends…

Q: Fill in the blank: What is the IUPAC name for the following compound? SH

A: The structure of the given compound is given below.

Q: What is the IUPAC name of the following compound? H2N

Q: What is the IUPAC name for the molecule below? CH, CH₂NCH, T CH,

A: The IUPAC name of above amine derivative compund is N,N-Dimethylethanamine

Q: What is the correct IUPAC name for the compound below?

A: Given,

Q: What is the IUPAC name of the following substance? CH3C=CCH3

Q: What is the IUPAC name of the following compound? ball & stick + labels

A: For IUPAC naming first we have to identify the atoms in the molecule then we designate the according…

Q: What is the IUPAC name for the following compound? CH3 CH,=-CH=CH2

A: Select the longest carbon chain i.e. the principle carbon chain Numbering Naming (prefix + word…

Q: What is the IUPAC name of the following substance? CH3 HC=CCH,CHCH3

Q: What is the IUPAC name of the following compound? CH,CH3 I

Q: what is the correct IUPAC name for SO3

A: SO3 The correct iupac name is

Q: What is the IUPAC name for the following molecule? Br

Q: What is the IUPAC name of the following compound? Он CH3CH,CHCH3

A: The IUPAC name of the compound can be written on the basis of the main carbon chain, functional…

Q: What is the IUPAC name of the following compound? HS.

A: We have seen from structure, there is a functional group -SH is attached to a tertiary butyl alkyl…

Q: What is the IUPAC name for the compound? HO H3C

A: Cycloalkanes are monocyclic compounds. They are saturated hydrocarbons. They contain hydrogen and…

Q: CH3 NH2

A: To give the IUPAC name, we have to first consider the longest C chain and then while numbering this…

Q: он CH2 CI

A: Numbering will be anticlockwise becuase Cl is near to OH it is given by prority order of…

Q: NH2 сно ноос

Q: What is the IUPAC name of the following compound? gula HO. OH

Q: 2. What is the IUPAC name of this molecule? H3C CH3

A: In given compound, a ring of 5 carbon is present. -C=O functional group is present which is known…

Q: What is the IUPAC name of the following substance? CH3 HC=CCH2CHCH3

A: The IUPAC Name of the Compound is written in the following format: locant + prefix + root + locant +…

Q: What is the IUPAC name for the compound shown? Br H3C. CH3 IUPAC name:

A: During the IUPAC naming of a chemical compound, we have to remembered the main points are as given…

Q: Provide the correct IUPAC name for the compound shown here. H₂C. CH3

Q: What is the IUPAC name for the following compound? CI.

A: The iupac name is as follows:

Q: Fill in the blank: What is the IUPAC name for the following compound? CN

Q: What is the IUPAC name of the following compound? O CH₂CNHCH,

Q: NO2 CH3

A: To give the IUPAC name of:

Q: (F N.

A: We have to give IUPAC name of given compound

Q: What is the IUPAC name of the following compound? O CH3CHCH₂CNHCH3 Br

Q: What is the correct IUPAC name for the Al3+ jon?

A: Generally the cations are chemically represented as the name of the species followed by its…

Q: What is the IUPAC name of the following compound? OCH3 OCH3

A: 1. Select the principle carbon chain 2. Numbering 3. Naming (prefix + word root + suffix)

Q: What is the IUPAC name for the following compound? Br Br Br

A: The IUPAC stands for “international union of pure and applied chemistry”. This is the organization…

Q: Provide the correct IUPAC name for the compound shown here. H₂C CH3

A: Write the correct IUPAC name of the given compound --

Q: What is the IUPAC name of the following substance? CH-CHз НС—ССHCH2CH3

A: In the above molecule we have a alkyne functional group present hence the longest chain will have 5…

Q: What is the IUPAC name of the following compound? ball & stick +labels

A: The structure of organic compound shown in ball and stick model is given by

Q: What is the IUPAC name of the following compound? CH3CHÖÇHCH3 CH; CH3

A: Determine the functional group, to decide the secondary suffix for this compound.Then consider the…

Q: What is the IUPAC name of the following compound? HO HO.

Q: What is the IUPAC name of the following molecule? Br

A: While naming an organic compound, we follow IUPAC nomenclature, which has certain rules as: a) Find…

Q: What is the IUPAC name of the illustrated molecule? HO

A: The naming of an organic compound can be done with help of rules of international union of pure and…

Q: What is the IUPAC name of the following compound? CH3 CH3CHCHCH,OH CH3

A: IUPAC Name:- 2,3-Dimethylbutan-1-ol.

Q: Fill in the blank: What is the IUPAC name for the following compound? N.

Concept explainers

Alkanes and Cycloalkanes

Alkanes are saturated organic compounds which are made up of C and H atoms. Alkanes have the general formula of CnH2n+2. Alkane contains sp3 hybridized carbon atoms with four sigmas (σ) bonds & every hydrogen atom is connected with one of the carbon atoms. The size of the alkane could be determined by the number of carbon atoms located in it.

Question

What is the IUPAC name for the following molecule?
CH3
For the toolbar, press ALT+F10 (PC) or ALT+FN+F10 (Mac).
BIU S
Paragraph
Arial
A v
Ix
ABC
-
[+1
Ev
Click Save and Submit to save and submit. Click Save All Answers to
JUL

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Hello, I hope you are doing well on this fine day. For the following quetion please read carefully the question and instruction. PLEASE ANSWER QUESTION IN 20 MINTUES NOT MORE PLEASE AND THANK YOU. If you do answer the question correctly and post it in the next 20 minutes, NO NEED TO SHOW ALL THE WORK, I JUST WOULD LIKE THE CORRECT ANSWER AS SOON AS POSSIBLE. I will write a wonderful and generous feedback/review/rating about you. How many total pi bonds are in the following molecule? CH3CCCH3
please provide the machanisms of 1a, 1e, 1f
Kindly give the COMPLETE NEW iupac name amd COMMON NAME of numbers 1, 2, 3, 4, 5, 6, 7, 8, 9, 10. And on the roman numeral II, Kindly answer what is asked.
No line formula please! Hexanal + NaBH4
Give IUPAC name of the following molecule and indicate Z or E. Answer all four of them
Please help, asap The Kb of ethylamine,C2H5NH2, is 4.3 x 10-4.
A. Use the templates to draw two contributing structures of the following molecule each of which involves two of the three substituents on the benzene ring. Show all lone pairs. Please don't provide handwriting solution
I need help to perdect the ir spectreum digram for the staring matrial and also for it need to draw the staring matrial and labled the functional groups on it and on the ir spec digram I linked an example I made on how it suppose to look, its not the answer just the format
What is the IUPAC of the image attached?
5. Using only IR, explain in detail how one could most easily differentiate between oct-1-ene and oct-1-yne if all carbon to carbon bonds are ignored.
In light of the nitrogen rule mentioned in Problem 12-17, what is the molecular formula of pyridine, M+=79?
draw (s)-4-ethyloctane in a structural condensed format. use a dash or wedge bond to indicate stereochemistry of substituents on asymmetric centers, where applicable Please provide only typed answer solution no handwritten solution needed allowed