What is the oxidation product of the reaction below? KMNO4/OH" cold HO D. OH HO" A В. С. HO, O., HO,

Q: What are the reducing and oxidizing agents for the 3rd row?

A: Given redox reaction:

Q: 1. I+MnO → MnO 2 + I2 Oxidizing Agent: I- Reducing Agent: Mn0? Oxidation: I → I2 Reduction: Mno →…

A:

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A: In a reaction, if the oxidation number of an atom is increasing, it means it has lost electrons,…

Q: Consider this reaction: 2 FeCl3(aq)  +  3 Zn(s)  →  3 ZnCl2(aq)  +  2 Fe(s) a. What is reduced?…

A: The process in which oxidation number is increased is called oxidation and the process in which…

Q: 1. Find the oxidation number for nitrogen in the following species, a) NH3 b) N20 c) NO d) NO2 e)…

A: Note : Since you have posted multiple questions, we are entitled to answer the first only. Please…

Q: What quantity of electric current is required to deposit 0.750 g of Pt(s) from a solution containing…

A: The number of moles of a substance is defined as the mass of the substance upon molar mass.The…

Q: Balance the following reactions: Are the reactions oxidation-reduction reactions?   a)…

A: Yes, both of the given reaction are Redox Reactions as it involves oxidation & reduction of…

Q: What type of reaction is this? C3H,O + O, --> CO; + H;O What type of reaction is this? Caco, --> Cao…

A: The types of above reaction is given below

Q: In the following reaction, which element in what species is oxidized? Au(NO:)3 (aq) +3 Li(s) Au(s) +…

A: In a chemical reaction if oxidation state of the atom/element will increase then that process is…

Q: oxidized

A:

Q: Name of the Student Section: 3. Balance the following reactions based on the given method: (use the…

A:

Q: (d) NaBrO4 Element Oxidation Number Na i i Br i

A:

Q: How many electrons does this represent? b. How many coulombs does this represent? c. Assuming 100%…

A: (a)

Q: Is the use of glucose in human cells. C.H,O, (aq) + 60,(g)6H,Olaq)+ 6CO,(g), a redox reaction? O…

A:

Q: Wie tree op as i) oksideermiddel en ii) reduseermiddel in die onderstaande reaksie? Who acts as i)…

A: Here, canizzaro reaction is given. In this reaction two same molecule of aldehyde with lacking of…

Q: The following skeletal oxidation-reduction reaction occurs under basic conditions. Write the…

A:

Q: Determine the oxidation number for each atom in H,C,04 C: H: 0:

A:

Q: 1a.In which of the following substances does nitrogen exhibit the lowest oxidation number? A. NaNO2…

A:

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

A: Answer

Q: CIO4 + Hg-CIO3¯ + HgO In the above reaction, the oxidation state of chlorine changes from e to 8.…

A: The combining capacity of an element when it bonded with other elements is known as oxidation state…

Q: Give the oxidation numbers for the specified atoms in the following molecules and ions.(a) Mg3N2…

A: (a)Mg3N2:N: Assume that the oxidation state of N = xOxidation sate of Mg = +2

Q: XO4- (aq) +  Z3+ (aq)=X2+ (aq) + ZO22+ (aq)       Where: X = Metal #1 and Z = Metal #2 (a) the…

A:

Q: (ii) The thermite reaction can be used to join railway tracks together. Aluminium is used in this…

A: Ans

Q: The oxidation number of S in SO42- is ___

A: The oxidation number of an atom in a molecule is defined as the number of charges it would carry If…

Q: Give the balanced Oxidation and Reduction half reactions for CO2(g)+H2O(l)C6H12O6+O2(g)

A: During photosynthesis in presence of sunlight (hv) carbon-di-oxide and water reacts to form…

Q: (b) SO2 Element Oxidation Number S +4 i

A:

Q: Balance the reactions below using the change in oxidation number method. Show complete…

A: Oxidation number method The balancing method used in terms of balanced electron counts is called…

Q: Consider these generic half-reactions. Half-reaction E° (V) x+(aq) + e¯ → X(s) 1.52 Y2+(aq) + 2 e¯…

A: Applying basics of electrod potential, high --ve value represent strongest oxidizing agent and high…

Q: Rank the following compounds in the order of increasing oxidation levels (lowest to highest…

A: The order of increasing oxidizing levels is given below:

Q: Nitrate (N03') a) Is this an oxidation or reduction? Nitrite (NO2').

A: Oxidation and reduction in terms of oxygen transfer Oxidation is a gain of Oxygen Reduction is a…

Q: 1. Calculate the oxidation number of each element present in the following substances. a) FeO b)…

A:

Q: Assign oxidation states to each atom in each ion or compound Ag Ag+ CaF2 H2S CO32- CrO42-

A: Since you have posted multiple questions, we are entitled to answer the first only.

Q: You are designing a component for a new engine. This component will be made from steel (which is…

A: Sacrificial anode  is used as the protection of  metal structure from corrosion .

Q: Consider the reaction below.   S2O32‒(aq) + 4 Cl2(g) + 5 H2O(l) → 2 SO42‒(aq) + 8 Cl‒(aq) + 10…

A: Oxidation number of an element represents the number of electrons lost or gained by the element. The…

Q: Which element is the reducing agent in the following reaction? 3H2S + 2NO3 + 2H 3S + 2NO + 4H20 O…

A: In a redox chemical reaction, when an element is oxidized or loses electrons, then that element is…

Q: __ (1) is oxidized and (2) is reduced. In the reaction, Zn + Cu²* → Zn2* + Cu, A. Zn (1), Cu²+ (2)…

A: We have to check the standard reduction potential of both that is E0 Zn+2/Zn=-0.76V E0Cu+2/Cu= +.34V…

Q: Assign the oxidation numbers (ON) Zn S8 NaCl Cu2O CuO H2O2 H2O CaH2

A:

Q: (ii) The thermite reaction can be used to join railway tracks together. Aluminium is used in this…

A: Definition of redox reaction is, In redox reaction one species is oxidize and other is reduced.

Q: Give the oxidation numbers for the specified atoms in the following molecules and ions. (a) Mg3N2 N:…

A: Mg3N2N: Assume that the oxidation state of N = xOxidation sate of Mg = 2The sum of oxidation numbers…

Q: A solution of iron(II) sulfate was prepared by dissolving 10.00 g of FeSO4•7H2O (FW = 277.9) in…

A: Given data: Mass of  FeSO4•7H2O dissolved in water = 10.00 g, Volume of iron(II) sulfate solution =…

Q: + 1.14 V TI Pt Cr3+ (1 M) Cr2+ (1 M) T13+ (1 M) T13+ (aq) + 3e-→ TI (s) Cr2+ (aq) → Cr3+ (aq) + What…

A: From the above electrochemical cell it has been observed that the electrons are being transferred…

Q: Assign oxidation numbers to the atoms in the following: A) S^2- S: B) SO2 S: O: C) P4 P: D) PH3 P:…

A: Rule for identify oxidation number: The oxidation number of free element( such as O2,H2, N2, P4) or…

Q: Which choice correctly identifies the oxidation number (O.N.) for the given species? A) Mn²⁺, O.N. =…

A: Oxidation number in simple terms can be described as the number that is allocated to elements in a…

Q: 1. Find the oxidation number of the underlined atom. a. P2074 b. Są06? -2 c. ΑIΡΟ4 d. H2SO4 e.…

A:

Q: Balance the reaction below using the change in oxidation number method. Show complete solutions…

A: In the oxidation number method, the oxidation number are assigned to the atoms and depending upon…

Q: Consider the following equation in aqueous solution: PO₃³⁻(aq) + SO₂(g) → PO₄³⁻(aq) + S²⁻(aq) Write…

A:

Q: 1. Determine the oxidation number of each element in these substances: a. S203 b. O2 c. Al:(SO.)s 2.…

A:

Q: Magnesium metal (a component of alloys used in aircraft and a reducir used in the production of…

A: Density of seawater = 1.026 g/cm3

Q: Consider the redox reaction below: O2(g) + 2H*(aq) + Fe(s) → Fe2+(aq) + H2O2(aq) The reducing agent…

A: We are given a redox reaction. We need to determine the reducing agent in it.  Reducing agent is the…

Q: mine E´tor the naIT-reaction in n(S). 2ln(s) + 6H*(aq) 2ln3+(aq) + 3H2(g) E° = +0.34 V

A: Given , Chemical Reaction :  2 In (s) + 6 H+ (aq) ---> In3+ (aq) + 3H2 (g)  E° = +0.34 V