Please answer both and ignore my working out 3. Which one of the following 4-coordinate group 10 complexes is tetrahedral? Explain yourchoice.a) [Ni(CN)4]²-b) [NiCl4]²-c) [Pd(CN)4]²-d) [PdCl4]²-e) [Pt(CN)4]²-f) [PtCl4]²-A. [Ir(CN)6]³--3-0-9-8-3) -123d ¹2B. [Cr(NO₂)3(PPh 3)] → do, low spinC. [FeBr6]³-58.800-3-0=-3, №¹2, high spin8(--3)=1220Ni108.42PdPausum4. Would you expect the following complexes to be to be high- or low-spin?Hints: Start calculating the oxidation state of the metal.Ptlow spin

Here we have to choose which one complex is tetrahedral amongst given complexes and we have to tell…

Which one of the following 4-coordinate group 10 complexes is tetrahedral? Explain your choice. a) [Ni(CN)4]²- b) [NiCl4]²- c) [Pd(CN)4]²- d) [PdCl4]²- e) [Pt(CN)4]²- f) [PtCl4]²- 12 A. [Ir(CN)6]³-3-0-9-8-3) = 12sd B. [Cr(NO₂)3(PPh 3)] → d, low spin C. [FeBro]³- d¹2, high spin -3-0--3 8(-3)=12 58.593 45 Ni Nicket Would you expect the following complexes to be to be high- or low-spin? Hints: Start calculating the oxidation state of the metal. Pd Pt low spin

Which one of the following 4-coordinate group 10 complexes is tetrahedral? Explain your choice. a) [Ni(CN)4]²- b) [NiCl4]²- c) [Pd(CN)4]²- d) [PdCl4]²- e) [Pt(CN)4]²- f) [PtCl4]²- 12 A. [Ir(CN)6]³-3-0-9-8-3) = 12sd B. [Cr(NO₂)3(PPh 3)] → d, low spin C. [FeBro]³- d¹2, high spin -3-0--3 8(-3)=12 58.593 45 Ni Nicket Would you expect the following complexes to be to be high- or low-spin? Hints: Start calculating the oxidation state of the metal. Pd Pt low spin

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 2RQ

See similar textbooks

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.