Why is there a need to add two (2) equivalents of amine in the reaction of an acid chloride and an amine ? A) The extra amine will deprotonate the amine or alcohol, making it a better nucleophile. B) The extra amine will neutralize the acid by-product of the reaction. C) The extra amine will protonate the carbonyl of the acid chloride, making it more reactive. D) The extra amine will absorb the heat of the reaction.

Why is there a need to add two (2) equivalents of amine in the reaction of an acid chloride and an amine ? A) The extra amine will deprotonate the amine or alcohol, making it a better nucleophile. B) The extra amine will neutralize the acid by-product of the reaction. C) The extra amine will protonate the carbonyl of the acid chloride, making it more reactive. D) The extra amine will absorb the heat of the reaction.

Organic Chemistry: A Guided Inquiry

2nd Edition

ISBN:9780618974122

Author:Andrei Straumanis

Publisher:Andrei Straumanis

ChapterNW4: Nomenclature Worksheet 4: Carbonyl Compounds

Section: Chapter Questions

Problem 31CTQ

See similar textbooks

Similar questions

Why can you not use this reaction to make a secondary amine? a) Alkyl halides are weak electrophiles.b) Primary amines are weak nucleophiles.c) The primary amine is too nucleophilic, so over-reaction will occur.d) The secondary amine product is more nucleophilic than the primary amine reactant, so over-reaction will occur.
a) Put these three common types of carbonyl compound in order of decreasing reactivity ester amide acid chloride b) For the least reactive, show the interconversion to its other resonance form: How does this electron delocalisation make it stable? c) For the most reactive, draw the mechanism of its undergoing hydrolysis (reaction with H2O): Why makes this type of carbonyl so reactive to nucleophiles?
In the following reaction, which chemical species is acting like a nucleophile?
Indicate who acts as nucleophile and electrophile in the reaction and draw the hemiacetal product.
When trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels, at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.
In the reaction CH₂O + HCN CH₂CNOH, which species serves as a nucleophile?
When trichloroacetaldehyde is dissolved in water, almost all of it is converted to the hydrate. Chloral hydrate, the product of the reaction, is a sedative that can be lethal. A cocktail laced with it is known—in detective novels,at least—as a “Mickey Finn.” Explain why an aqueous solution of trichloroacetaldehyde is almost all hydrate.
Two reactions occur when sodium hydroxide is added to methyl salicylate. One is immediate and one only occurs with reflux over time. What type of reaction occurs immediately and with which functional group on methyl salicylate does it react? What type of reaction occurs with reflux over time and with which functional group on methyl salicylate does it react?
3. You are given a mixture of aspirin, phenol, and naphthalene that you need to separate. i) Draw the structures of each, and identify if they are acidic, basic, or neutral compounds. For each compound draw their reaction with the appropriate acidic or basic conditions that will change their solubility and allow them to be separated. ii) What modifications would you have to make to the experimental protocol in order to separate these three compounds? Provide specifics.
Complete each acid-base reaction and predict whether the position of equilibrium lies toward the left or toward the right. (a) CH3CCH+CH3CH2ONa+CH3CH3OH (b) CH3CCCH2CH2OH+Na+NH2NH3(l)
Thiols or thiol (-SH) group is a better base than hydroxide (-OH) group in elimination reactions.
Out of acid chlorides (least stable), anhydrides, esters, and amides (most stable). True or false Acid chlorides would be the most reactive to hydrolysis and Amides would be the least reactive