Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C H* + H20

Q: CH3 NaOCH3 CH;OH II

A: Biomolecular elimination (E2) reaction:E2 reaction involves a one-step mechanism in which…

Q: Draw structural formulas for the major organic product of the reagents shown. ÇI H2SO4 HNO3 Он

A: Nitration of prachloro benzoic acid will majorly give only one product that nitro group will be…

Q: Write a balanced equation for the hydrogenation of eachof the following:a. Hexanal (a six-carbon…

A: Balanced equation: It is the chemical equation in which the number of atoms on the reactant side is…

Q: What reagent(s) needs to be added to cause the following transformation? CI ? NaOH NaOH, NaOCH3, or…

A:

Q: Draw the major organic product formed in the reaction. HBr -CH=CH-CH=CH2 (1 equiv.)

A: The reaction of alkene with HBr proceed through the formation of carbocation. if carbocation is less…

Q: H* H3C O-H + H3C.

A:

Q: What is the major organic product of the following reaction? 1. NaOEt 2. H30*

A: 1. We have reaction of diester compound with base we have to predict the major product. 2. We have…

Q: Draw the structure of the major organic product of the reaction. `NH2 CI

A: A question based on organic chemistry, which is to be accomplished.

Q: of NaOH (а) H2O OCH3 (b) NH3 + OCH3 HCI (с) CH3CH2OH + OCH3

A: We have reaction of ester with NaOH , ammonia and ethanol.

Q: Draw the structure of the major product of any five of the following reactions: diethyl ether 1…

A: 1. Gilman reagent: The Gilman reagent is a lithium and copper reagent compound, R2CuLi, where R is…

Q: Click the "draw structure" button to launch the drawing utility. Draw the producet formed from a…

A: We have reaction of cyclic ester with the ethyl formate , we have to predict the product .

Q: Draw the major product of this reaction. Ignore inorganic byproducts. 1. (CH3)2CHNH2, Na(CN)BH3, pH…

A: The given reactions are examples of reductive amination reactions. In the reductive amination…

Q: 1. Draw the structural formula for the major product from each of the following reactions: a) NH, CI…

A: a.

Q: What is the IUPAC name of the following structure? OCH3 O 5-ethyl-2-methoxy-3-methyl-4-pentyne…

A:

Q: Write IUPAC name of the major product formed as a result of the reaction indicated .CH3 Pd + H2 ?

A: In this given reaction,  The 1-methylcyclopent-1ene reactant is a starting material or reactant is…

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: % Yield of the reaction is a measure of reaction efficiency in terms of the amount of product formed…

Q: Draw the cordensed structural formula for the alcohol formed when each of the following is reduced…

A:

Q: Complete the following Fischer esterification reaction

A: When an alcohol reacts with a carboxylic acid in the presence of an acid to form an ester is called…

Q: 2. Draw in the space below the acetal formed in the following reaction. (include all products)…

A: Hemiacetal and Acetal formation:

Q: 8 Name the following ketones and aldehydes. When possible, give both a common name and an IUPAC…

A:

Q: 2. Name and draw the product produced by the oxidation of each compound. CH₂-CH₂-CH₂-CH-CH₂-OH CH₂…

A: Alcohols on oxidation gives carbonyl compounds. Aldehydes on oxidation gives carboxylic acids.…

Q: O-hydroxybenzoic acid is a major product formed with phenol and which other reactant/s I-primary…

A:

Q: Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in…

A: Given Chemical reaction: CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Mass of butanoic…

Q: Complete the following reaction of a thiol with an oxidizing agent. Draw the structure of the major…

A:

Q: Draw a structural formula for the major organic product of the reaction shown. CH;CH2 H c=c ÇH3 HBr…

A:

Q: The IUPAC name of the compound is (a) 5-formylhex-2-en-3-one (b) 5-methyl-4-oxohex-2-en-5-al (c)…

A: 1. Start numbering with functional group. Then write the IUPAC name. 2. Electrophile : Positively…

Q: Answer please, thanks! I will upvote your answer if you answer all the questions

A:

Q: Draw the structure of the major organic product of the following reaction. CHз KMNO, heat н*

A: The reaction sequence is completed and products are identified in step two.

Q: Which of the following is the correct IUPAC name for the compound below? HO а.…

A: The systemic name of organic compounds based on IUPAC nomenclature system. In this system, there are…

Q: Aldehydes and ketones are soluble in organic solvents True O False The IUPAC name of the compound…

A: True Butan-2-one Nitration of benzene Picric acid

Q: Provide the name of the product after heptanoyl chloride reacts with propan-1-ol under acidic…

A: The product of reaction between heptanoyl chloride and propanol can be predicted by its mechanism

Q: Draw a structural formula for the major organic product of the reaction shown. CH3CH2 c=c CH3 C=C…

A: protonation of alkene leading to the formation of more stable carbocation  attack of halide ion as…

Q: Complete the following reactions by supplying the necessary reagents. Type the THREE LETTER CODE…

A: We know that the particular set of reagents and reaction conditions when allowed it react with…

Q: Write IUPAC name of the major product formed as a result of the reaction indicated CH3 H3C H* + H20…

A: We have to predict the IUPAC nomenclature of product formed.

Q: . Draw the hydrochloride salt product for the following HCI CH2 CH2-NH2 но- a.

A: “Since there are multiple questions and it is not mentioned that which one has to be solved so I am…

Q: Give the systematic (IUPAC) names for these molecules. Boononon cnolonongron. НаСНз CHОССH2СH2СНCHЗ…

A: The systematic name for the given compounds has to be given

Q: What is required to complete the following reaction? O 1) HCI 2) CH3CH2OH 1) NaOH 2) CH3CH2CH3 1)…

A:

Q: OH CH3 H* H;CH,C ´OH

A: The reaction taking place is given as,

Q: Complete the following reaction: CH3-CH2-CH2-COOCH3 + NaOH…….> Name this reaction: B. C6H5-CONH2 +…

A: Esters react with base like NaOH to form carboxylic acid and alcohol.

Q: Write IUPAC name of the major product formed as a result of the reaction indicated H3C. Pt + H2

A: Alkenes are unsaturated hydrocarbons having a double bond Alkenes generally undergo electrophilic…

Q: what is the product of this reaction phenol-C=OOH CH3CH2MgCl

A:

Q: An alcohol does not react with aziridine unless an acid is present. Why is the acid necessary?

A: Aziridine is a three membered, heterocyclic organic compound. CH3OH is methanol (alcohol). HCl is…

Q: Br, 2NH, (а)

A:

Q: Ts. CH3 NaOH heat `CH3 Peaction R

A: Nucleophilic substitution reactions are those reactions in which nucleophile attacks the alkyl…

Q: Give the IUPAC name for the major organic product obtained from the following reaction. H3C-C=c Na…

A:

Q: Draw the structure of each of the following molecules. (a) pentanoyl chloride; (b)…

A: Structure of the following molecules to be drawn: (a) pentanoyl chloride; (b)…

Q: What is the IUPAC name of the aldehyde or ketone starting material needed to make each of the…

A: Oxidation is a process which loss electron or there is gain in oxygen Reduction is a process which…

Q: Fill in the blanks: H₂C. CH₂ H₂C. CH3 Br2 H₂C CH₂ FeBr3 H₂C CH₂ After the bromination reaction, the…

A:

Q: What two alkenes give rise to each alcohol as the major product of acid-catalyzed hydration?

A: Alcohols are the organic compounds with the functional group -OH. Alkenes are the organic compound…

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.