For the following reaction, 4.41 grams of carbon (graphite) are allowed to react with 15.8 grams of oxygen gas. carbon (graphite) (s) + oxygen (g) –→ carbon dioxide (g) What is the maximum amount of carbon dioxide that can be formed?| grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams

For the following reaction, 4.41 grams of carbon (graphite) are allowed to react with 15.8 grams of oxygen gas. carbon (graphite) (s) + oxygen (g) –→ carbon dioxide (g) What is the maximum amount of carbon dioxide that can be formed?| grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams

Introductory Chemistry: A Foundation

8th Edition

ISBN:9781285199030

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 19CR

See similar textbooks

Similar questions

For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
Consider the following balanced chemical equation: A+5B3C+4D a. Equal masses of A and B are reacted. Complete each of the following with either A is the limiting reactant because ; B is the limiting reactant because ____ ; or we cannot determine the limiting reactant because _____ i. If the molar mass of A is greater than the molar mass of B, then ii. If the molar mass of B is greater than the molar mass of A, then b. The products of the reaction are carbon dioxide (C) and water (D). Compound A has a similar molar mass to carbon dioxide. Compound B is a diatomic molecule. Identify compound B, and support your answer. c. Compound A is a hydrocarbon that is 81.7 1% carbon by mass. Determine its empirical and molecular formulas.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
Although many sulfate salts are soluble in water, calcium sulfate is not (Table 7. 1). Therefore, a solution of calcium chloride will react with sodium sulfate solution to produce a precipitate of calcium sulfate. The balanced equation is :math>CaCl2(aq)+Na2SO4(aq)CaSO4(s)+2NaCl(aq) a solution containing 5.21 g of calcium chloride is combined with a solution containing 4.95 g of sodium sulfate, which is the limiting reactant? Which reactant is present in excess?
4.70 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients. (c) identify the limiting reactant, and explain how the pictures allow you to do so.
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
Calculate the amounts of reactants needed in a chemical reaction to produce a specified amount of product.