BALANCING REDOX REACTIONS, VOLTAIC CELL AND ELECTROLYSIS1. A student constructed a voltaic cell using nickel and lead as electrodes. He also used 0.50 M Ni(NO3)2 asthe anolyte and 0.25 M Pb(NO3)2 as the catholyte.Ni2+(aq) + 2eNi(s), Eºred = -0.25 VPb2+(aq) + 2e → Pb(s), Eºred. = -0.13 VA. Write the balanced reaction occurring in the voltaic cell. Write your answers in your solution sheet.B. Compute the standard cell potential, Eºcell-C. Calculate the cell potential at 28 °C, Ecell-D. If the concentration of Pb(NO3)2 solution used was increased, what will be the effect on the measuredpotential? (increase, decrease, no effect)42. Ate Shawol and Concertina performed electrolysis to determine the identity of an unknown metal X. Theydetermined that 2 electrons are involved in the reaction per mole of the unknown metal X. After applying1.295 A of current for 16.00 hours, 21.59 g of the unknown metal was deposited to the electrode. HelpAte Shawol and Concertina determine the identity of the unknown metal X.3. Complete and balance the chemical reaction using method of half-reactions. Write your answer in yoursolution sheet.Al(s) + NO2 (aq) = Al(OH)4 (aq) + NH3(aq) (basic solution)

Dear student , since you have posted multiple parts questions we will allow to solve only first…

1. A student constructed a voltaic cell using nickel and lead as electrodes. He also used 0.50 M Ni(NO3)2 as the anolyte and 0.25 M Pb(NO3)2 as the catholyte. Ni2+, (aq) + 2e Ni(s), Eºred = -0.25 V Pb2+ (aq) + 2e Pb(s), Ered. = -0.13 V A. Write the balanced reaction occurring in the voltaic cell. Write your answers in your solution sheet. B. Compute the standard cell potential, Eºcell- C. Calculate the cell potential at 28 °C, Ecell.

1. A student constructed a voltaic cell using nickel and lead as electrodes. He also used 0.50 M Ni(NO3)2 as the anolyte and 0.25 M Pb(NO3)2 as the catholyte. Ni2+, (aq) + 2e Ni(s), Eºred = -0.25 V Pb2+ (aq) + 2e Pb(s), Ered. = -0.13 V A. Write the balanced reaction occurring in the voltaic cell. Write your answers in your solution sheet. B. Compute the standard cell potential, Eºcell- C. Calculate the cell potential at 28 °C, Ecell.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
Which of the changes below will increase the voltage of the following cell? Co|Co2+(0.010M)H+(0.010M)|H2(0.500atm)|Pt (a) Increase the volume of COCl2 solution from 100 mL to 300 mL. (b) Increase [H+] from 0.010 M to 0.500 M. (c) Increase the pressure of H2 from 0.500 atm to 1 atm. (d) Increase the mass of the Co electrode from 15 g to 25 g. (e) Increase [CO2+] from 0.010 M to 0.500 M.
Calculate the theoretical potential of each of the following cells. Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Pt|Cr3+(2.00 10-4M),Cr2+(1.50 10-3 M)||Pb2+ (5.60 0215 10-2M)|Pb (b) Hg|Hg22+(2.00 10-2 M)||H+(1.50 10-2 M),V3+ (2.00 10-2M),VO2+(3.00 10-3M)|Pt (e) Pt|Fe3+(3.00 10-2 M), Fe2+ (4.00 10-5M)||Sn2+ (3.50 10-2M), Sn4+ (5.50 10-4 M)|Pt
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Describe how to set up a voltaic cell using the following half-reactions: Reduction half-reaction:Ag+(aq) + e Ag(s) Oxidation half-reaction:Ni(s) Ni2+(aq) + 2 e Which electrode is the anode, and which is the cathode? What is the overall cell reaction? What is the direction of electron flow in an external wire connecting the two electrodes? Describe the ion flow in a salt bridge (with NaNO3) connecting the cell compartments.
The half-cells Fe2+(aq) | Fe(s) and O2(g) | H2O (in and solution) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the _______ electrode to the _____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the ______ half-cell.
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?