Name the following compounds and answer the sub-questions that follow: 1.Name the following compounds:(a) [CoBr(NH3)5]SO4(b)[Al(OH)4(H₂O)₂](c)[RhCl₂(NH3)4]*(d)[Ni(NH3)%],[Co(NO,)6]z2. For the cation complexes in (a), (c) and (d) above:(a)What is the coordination number?3. Write the chemical formula:Tetraaquadibromochromium(III) chloride

1.Name the following compounds: (a) [CoBr(NH3)5]SO4 (b)[Al(OH)4(H₂O)₂] (c)[RhCl₂(NH3)4]* [Ni(NH3)6]3[Co(NO₂)6]₂ (d) 2. For the cation complexes in (a), (c) and (d) above: (a)What is the coordination number? 3. Write the chemical formula: Tetraaquadibromochromium(III) chloride

1.Name the following compounds: (a) [CoBr(NH3)5]SO4 (b)[Al(OH)4(H₂O)₂] (c)[RhCl₂(NH3)4]* [Ni(NH3)6]3[Co(NO₂)6]₂ (d) 2. For the cation complexes in (a), (c) and (d) above: (a)What is the coordination number? 3. Write the chemical formula: Tetraaquadibromochromium(III) chloride

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter8: Bonding In Transition Metal Compounds And Coordination Complexes

Section: Chapter Questions

Problem 33P

See similar textbooks

Related questions

Q: IIA. Balance the following chemical reactions (1-10) IIB Identify the type of chemical reaction…

A: According to law of mass conservation we know that in a chemical reaction mass is neither created…

Q: One day in lab, while adding a gnarled root to a dark liquid bubbling in an iron cauldron, your…

Q: Consider isobars with mass number A=53, which is the one with least number of neutrons?

A: Isobars are those elements who have different atomic numbers but same mass numbers i.e. total no of…

Q: Question 17 The value of Kw at body temperature (37 °C) is 2.1 x 10-14. What is neutral pH at this…

A: Given :(17) Kw = 2.1 × 10-14 Tip. = Kw = Ka × Kb

Q: An atom with 15 protons and 18 neutrons would be an isotope of: arsenic Ophosphorus argon sulfur

A: Phosphorus ---> option(b)

Q: CI B O + Não-

Q: Compound X has a molar mass of 104.01·gmol−1 and the following composition: element mass %…

A: we have to calculate the molecular formula for X

Q: Assign each 13C of the molecule below to a peak in the following 13C NMR spectrum. Ideally, you will…

A: Higher the deshielding higher will be the chemical shift.

Q: Calculate the pH of a formic acid solution that contains 1.43% formic acid by mass. (Assume a…

A: we have to calculate the pH of formic acid solution

Q: Methanol is an important alcohol used in the manufacture of adhesives, fibres and plastics. It is…

A: We would use relation between equilibrium constant and free energy to calculate its value.

Q: The polyamide structure shown below provides lightweight, heat and flame resistant performance for…

A: A polymer is a large molecule or macromolecule that is essentially a combination of many subunits.…

Q: Determine the pH during the titration of 18.0 mL of 0.399 M hydrochloric acid by 0.180 M sodium…

Q: For a 8.40×10-² M solution of H₂CO3, calculate both the pH and the CO3²- ion concentration. H₂CO3 +…

Q: The following graph shows the pH curve for the titration of 25 mL of a 0.1 M monoprotic acid…

A: Answer: Equivalence point is the volume of base at which all the acid has been neutralized and end…

Q: The percent yield for the reaction PCl3 + Cl2 → PCl5 is 67.7 percent. What mass of PCl5 would be…

Q: 1.What is the most effective pH buffering range for a alazarin yellow indicator? (benzoic acid Ka =…

A: 1) Buffer Solution : It is a mixture containing a weak acid and its conjugate base or a weak base…

Q: Write the empirical formula for at least four ionic compounds that could be formed from the…

A: An ionic compound is formed by an anion and a cation. Let us make the compounds from the given ions.

Q: Cs+ and I- Express your answer as a chemical formula.

Q: Hi! Could someone help me find the correct IUPAC names for these compounds and their…

Q: Draw the molecular orbital energy diagram (like we did in class, not the fancy general chemistry…

A: In the given compound, NH3 acts as the nucleophile in which the HUMO is nonbonding n orbitals. The…

Q: Calculate the pressure (in atm) of a 2.90 mol sample of CO₂ gas at 475 K in a 0.750 L container…

Q: The following data was collected for the reaction: A + B + C = Products Experiment…

Q: Question 11 Calculate the pH of a 0.30 M HNO3 solution. O 2.00 O 1.25 O 0.52 O 13.50 Question 12…

A: Given, [HNO3] = 0.30 M we know, HNO3 dissociate into one moles of H+ and one moles of NO3- which…

Q: Question: The solubility of Oxygen gas (O2(g)) in water in units of (g O₂/100 g H₂O) is described by…

Q: Looking up one snowy afternoon from a book titled The Moral Case Against Turning Lead Into Gold (Or…

Q: If you have 0.301 m³ of water at 25.0 °C in an insulated container and add 0.142 m³ of water at 95.0…

Q: A sample of ammonia, NH3, has a mass of 77.25 g. Calculate the number of ammonia molecules in the…

Q: How many moles of vanadium atoms, V, are needed to combine with 0.145 mol of O atoms to make…

A: Vanadium reacts with oxygen to form vanadium pentaoxide (V2O5). The molecular formula of the…

Q: AHºrn and the Standard Enthalpies of Formation; Read Section 7.9. You can click on the Review link…

A: Fermentation of ethanol can be done from the glucose. We have to write the balance chemical equation…

Q: How many grams of AgNO3 are in 45.0 mL of a 0.693 M solution?

A: Given Volume of Solution = 45.0 mL Molarity of solution = 0.693 M Molar mass of AgNO3 = 169.87…

Q: The vapor pressures of benzene and toluene can be modeled by the expressions 3856.6 K T In In…

Q: 1.Identifying if lonic or Covalent bond and show how they form their bonds. 1.Show how Mg and Cl…

A: According to guidelines we are supposed to answer one question only. If you want rest of the…

Q: Exercise: For the complex cation [Cr(NH3)4Cl₂]+ (a) What is the oxidation number of the metal ion?…

Q: Enter your answer in the provided box. What mass of naphthalene must be dissolved in 2.10 x 102 g of…

A: Given data :

Q: draw the products you get with syn- and anti- addition of bromine to z-stilbene. For each of these…

A: When the larger group are on same side of double bond, it is called Z isomer. Let us discuss the…

Q: Entropy of vaporization of water(at boiling temperature) is equal to 109 J mol^-1 K^-1. Is it…

A: Trouton’s rule: When a liquid vaporized its entropy will be increased. Trouton’s rule states that…

Q: For each of the following molecules, (1) Draw the individual bond dipole moments. (2) Rank the…

Q: A 32.1 g iron rod, initially at 21.5 °C, is submerged into an unknown mass of water at 63.5 °C, in…

Q: ,Chlorine gas can be prepared in the laboratory by the reaction of hydrochloric acid with manganese…

Q: Determine the critical cation to anion ratio (Rx/Rz) that separates cubic coordination (8-fold) from…

A: We need to look at the relative sizes of the atoms to see what occurs when one of the relevant ions…

Q: Why is total pressure at equilibrium less than initial total pressure for: 2 SO2 (g) + O2 (g) 2…

A: Sulfur dioxide reacts with oxygen to form sulfur trioxide. The equation for the balanced chemical…

Q: +2 -3 a. solid calcium nitride plus heat Ca Na 3 Ca +2N → b. solid lead (IV) carbonate plus heat…

Q: 5. Why can tin (IV) sulfide and antimony (III) sulfide be separated from copper (II) sulfide and…

Q: (What does it me Model 1: General structure of an a-amino acid in acidic, neutral, or basic…

A: Answer is given below from model 1 related questions, due to absence of model 2 answers are not…

Q: 3. For each of the following molecules, label each stereogenic center as R or S. Label the molecules…

A: We have to determine R and S configuration and tell if the compound is chiral or meso compound

Q: added from the burette is used up. 2. In the titration of a strong acid with a strong base, the pH…

Q: Cu²+ (aq) + 2e →→ Cu (s) Zn(s) →→→ Zn²+ (aq) + 2e- (reduction). (oxidation).

A: We have to tell why the first reaction undergoes reduction and the second reaction undergoes…

Q: Question 7 Why does an ionic bond have a high melting point? A lot of energy is required to overcome…

A: Ionic bond are held together by strong attractive forces between cation and anion. This bond is much…

Q: When heated, KCIO, decomposes into KCl and 0₂. 2 KClO32 KCl +30₂ If this reaction produced 98.2 g…

Q: From the reaction below, which are possible products? مويل ملود 2 H OH-, heat Fylax tha sobox caf…

Concept explainers

Atomic Structure

The basic structure of an atom is defined as the component-level of atomic structure of an atom. Precisely speaking an atom consists of three major subatomic particles which are protons, neutrons, and electrons. Many theories have been stated for explaining the structure of an atom.

Shape of the D Orbital

Shapes of orbitals are an approximate representation of boundaries in space for finding electrons occupied in that respective orbital. D orbitals are known to have a clover leaf shape or dumbbell inside where electrons can be found.

Question

Name the following compounds and answer the sub-questions that follow:

1.Name the following compounds:
(a) [CoBr(NH3)5]SO4
(b)[Al(OH)4(H₂O)₂]
(c)[RhCl₂(NH3)4]*
(d)[Ni(NH3)%],[Co(NO,)6]z
2. For the cation complexes in (a), (c) and (d) above:
(a)What is the coordination number?
3. Write the chemical formula:
Tetraaquadibromochromium(III) chloride

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 1 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Four different octahedral chromium coordination compounds exist that all have the same oxidation state for chromium and have H2O and Cl as the ligands and counterions. When 1 mole of each of the four compounds is dissolved in water, how many moles of silver chloride will precipitate upon addition of excess AgNO3?
Suppose that rather than reacting copper(II) with ammonia, you had reacted it with an ammonium salt, such as NH4Cl. Would the same coordination complex have formed? Why or why not? What product would have formed?
If you want to use any of the [IrCl(CO)(PPh3)2] and [(η6-C6H6)Cr(CO)3] complexes as a catalyst in any organic reaction, which would you prefer? Please explain.
Carbon monoxide, CO, is an important ligand in coordinationchemistry. When CO is reacted with nickel metal,the product is [Ni(CO)4], which is a toxic, pale yellow liquid.(a) What is the oxidation number for nickel in thiscompound? (b) Given that [Ni(CO)4] is a diamagneticmolecule with a tetrahedral geometry, what is the electronconfiguration of nickel in this compound? (c) Write thename for [Ni(CO)4] using the nomenclature rules for coordinationcompounds.
Consider Complex 3 from the previous question, Na4[CuCl6].Would the electron configuration of the d electrons for the copper center change if the chloride ligands were replaced with ammonia ligands? Assume the charge on the copper ion stays the same.
In the preparation of some of the solutions of metal complexes, what is done to ensure that the desired form of the complex is stable?
Aqueous solutions of [Mn(H2O)6]2+ are faint pink, so much so that they appear to be colorless, which is in contrast to other coordination complexes that we have seen to this point in the course. a) Please explain why this solution is colorless. b) If the water ligands were changed to bipyridine (bpy) ligands and you had [Mn(bpy)3]2+, would the solution still be colorless? What changes, if any, would you expect to see in the visible spectrum? If the complex would be expected to have absorptions, please note now many.
There are two geometric isomers of octahedral complexes of the type MA3X3 (Figure 1), where M is a metal and A and X are monodentate ligands. Of the complexes shown here, which are identical to (1) and which are the geometric isomers of (1)?
CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds denoted A and B. When A is reacted with silver nitrate, 2/3 of the chlorine atoms precipitate. B, submitted to the same treatment, exhibits the precipitation of 1/3 of the present chlorine atoms. What are the spatial structures of complex ions A and B? (If necessary, draw their different stereoisomers).
What is the oxidation state of the metal centre in the [Cr(CO3)3(C6H6)] complex?
The following coordination complex takes on a yellow-orange color: [[Cr(NH3)6]Cl3 Answer the following in 1-2 complete sentences each a) How does the crystal field splitting of this compound compare to [Cr(H2O)6]Cl3, and what causes this effect? b) How does the energy and wavelength of light absorbed by this compound compare to [Cr(H2O)6]Cl3? c) Based on your answers to a and b, propose a color [Cr(H2O)6]Cl3 may appear.
When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand, NH2CH2CH2NH2, (which can be represented by the symbol “en”), the compound [CoC12(en)2]Cl is formed. a. What is the coordination number of cobalt in this compound? b. When this compound is treated with aqueous silver nitrate, only one mole of silver chloride is produced per mole of compound. Explain this observation.