Give the systematic names for the following coordination compounds:10. (NH4)2[Ni(C204)2(H20)2]Swipe up for filtersAdd a caption..> Status (Contacts)

Ligand name - For H2O ~ aqua For C2O4 ~ oxalato and complex sphere is anion then metal is written as…

Answered: 10. (NH4)2[Ni(C204)2(H20)2]

Science

Chemistry

10. (NH4)2[Ni(C204)2(H20)2]

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 46E

See similar textbooks

Related questions

Q: [Ni (NH3) 6] C12 Explain the hybridization, geometry and magnetic property of the complex structure.

Q: The delta octahedral of [Ru(H20)6]3+ is larger than that of [Fe(H20)6]3+. Briefly explain.

A: In the absence of any field the five d-orbitals are degenerate. When the metal comes under the…

Q: Is H a terminal group (atom) or the central atom in the species CH3-? Select the term terminal group…

A: Basically, in case of a compound having two atoms, the terminal atoms are the ones which are more in…

Q: How many ligands are present in [Co(NH3)4Cl2)]Cl?

A: A ligand represents an ion as well as molecule that connects to central metal atom to establish a…

Q: How does 14Si have the same valence of 126C ?

A: A group in a periodic table is the vertical column of elements having the same chemical properties…

Q: Why do stable xenon flourides have an even number of F atoms?

A: The term electronic configuration can be defined as the distribution of electrons of a given atom or…

Q: addition of S2- ion to Fe(OH)2(s) results in the formation of FeS(s). Explain why the addition of…

Q: Which of the following is paramagnetic? [Zn(H₂0)6]²+ [Cu(H₂0)6]* Onone of these [Co(NH3)6]³+ (strong…

A: “Since you have asked multiple question, we will solve the first question for you. If youwant any…

Q: what are the number of geometrical isomers of {PtBrCl(NH3)Py} ?

A: Those compounds which have same molecular formula but have different structural formula are known as…

Q: H₂N. Br Br HO NO₂ HN O

A: Here we have to determine the azo dye formed in the reaction of the following given compounds.

Q: What are the charge and coordination number of the centralmetal ion(s) in each compound (a)…

A: The coordination number in coordination compounds is described as the neighbouring ligands…

Q: What is the crystal field stability energy (CFSE) value for [RhMe3(PMe3)3]?

A: Given, Complex is = [RhMe3(PMe3)3] What is the crystal field stability energy (CFSE) value for…

Q: Draw two linkage isomers of [Mn(NH3)5(NO2)]2+?

Q: ntify the type of reaction for the che ation shown: + 2BCI3 3CaCl2 + B

A: The question is based on concept of chemical reaction. we have to identify what kind of reaction is…

Q: Which of the following compounds are chiral? Br Br CH, HO HO Br Br OH но Br Br Br III IV

A: In compound II there is a plane of symmetry.in compound III there is not a choral center as both…

Q: How many unpaired electrons do you predict for the tetrahedral[MnCl4]2 - ion?(a) 1, (b) 2, (c) 3,…

A: [MnCl4]2 - ion Electronic configuration - [Ar] 3d5

Q: (üi) 1) H2SO4, 140 °C >? 2) NaOH Br „MgBr cat. Ni/ligands (iüi) →?

Q: Kp %3D II

Q: Two coordination sphere isomers for MnCl3(CN)3

Q: Why is [Cr(NH3)6]3+ more stable than [Cr(PH3)6]3+ ?

A: Here the central metal ion is the same in both the coordination compounds which is Cr3+. But the…

Q: 4. N204 5. CO

A: Empirical formula contains elements in the simplest whole number ratio.

Q: Is peroxide ion O22- paramagnetic or diamagnetic?

Q: Draw two linkage isomers of (Mn(NH,);(NO,)]2+.

A: Linkage isomers Isomers obtained when same ligand connected by different atoms. When ligands contain…

Q: Which of the following will be paramagnetic? Multiple Choice V5+ Ni2+ Mn7+

A: To determine whether the ion is Paramagnetic or diamagnetic. We check unpaired electrons. If all the…

Q: Determine the number of unpaired electrons, n and magnetic moment, µ for the [Cr(CN)6]4-. O a. n =…

Q: A Jahn-Teller effect will most likely be observed with O [Zn(H2O)g]²+ O Co(pyridine)4(CN)2 O…

A: The complex which has unsymmetrical eg orbital shows Jhan Teller effect.

Q: Write down the formula of : Tetraamineaquachloridocobalt(III) chloride.

A: The given coordination complex is tetraamineaquachloridocobalt(III) chloride.

Q: Select the metal centre with d2sp3 hybridization. О а. [Rh(acac)3] O b. [Ru(acac)2(H2O)2] Ос.…

Q: Draw the current density-polarization curve for noble, basic, and extremely basic metals.

A: Current density affects the polarization of the species. The current density here refers to as…

Q: Determine the formal bond order between the two metals in the complex [Ru2(mu-O2CCH3)4]2*

Q: (üi) 1) H2SO4, 140 °C →? Br 2) NaOH MgBr (iüi) cat. Ni/ligands →?

Q: Mez CH2- CH2 Why this Titanium conplee dou landerys elininatien? not H. to Meg ce

A: Given: To explain the Titanium complex does not undergo elimination

Q: Why the reactivities of either Co (III) and Cr(III) are very slow

A: In chemistry, reactivity is the impetus that causes a chemical element to undergo a chemical…

Q: What are the charge and coordination number of the centralmetal ion(s) in each compound:(a)…

A: Coordination number It is the number of ligands attached to the metal center in a coordination…

Q: How many delectrons (nof dn) are in the central metal ionin (a) Ca[IrF6]; (b) [HgI4]2-; (c)…

A: a) Ca[IrF6] First find the oxidation state of Ir in Ca[IrF6] The sum of the oxidation number of…

Q: Explain how many unpaired electrons a tetrahedral d4 ion will have.

A: Crystal field theory (CFT) : CFT is basically gives the d-orbital interaction of metal with the…

Q: N N No No +) OR? R1 R2 R1* A B

A: Diazonium salt is very unstable. They contains N2^+. They will produce secondary carbocation after…

Q: What chemical change is responsible for the yellow solution observed during the qualitative test for…

Q: Would you expect the Mg3[Cr(CN)6]2 to be diamagnetic or paramagnetic? Explain your reasoning.

Q: Draw the d orbital electronic configuration of [Cr(co)6]3+ how many unpaired electrons are present…

Q: Octahedral [Ni(NH₃)₆]²⁺ is paramagnetic, whereas planar[Pt(NH₃)₄]²⁺ is diamagnetic, even though…

A: Paramagnetic substances are those having unpaired electrons whereas diamagnetic substances are those…

Q: inorganic chemistry which is a harder metal: Fe2+ or Ru2+

A: A chemical compound consists of two or more different elements which are bonded with each other…

Q: H₂N. I CN OH OH NO₂

Q: State TWO (2) organometallic reactions that involve the concept of d (pi) ― p (pi) bonding.

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

Give the systematic names for the following coordination compounds:
10. (NH4)2[Ni(C204)2(H20)2]
Swipe up for filters
Add a caption..
> Status (Contacts)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Give the coordination number for each metal ion in the following compounds: (a) [Co(CO3)3]3- (note that CO32- is bidentate in this complex). (b) [Cu(NH3)4]2+. (c) [Co(NH3)4Br2]2(SO4)3. (d) [Pt(NH3)4][PtCl4]. (e) [Cr(en)3](NO3)3. (f) [Pd(NH3)2Br2] (square planar). (g) K3[Cu(Cl)5]. (h) [Zn(NH3)2Cl2]
Trimethylphosphine, P(CH3)3, can act as a ligand by donating the lone pair of electrons on the phosphorus atom. If trimethylphosphine is added to a solution of nickel(Il) chloride in acetone, a blue compound that has a molecular mass of approximately 270 g and contains 21.5% Ni, 26.0% Cl, and 52.5% P(CH3)3 can be isolated. This blue compound does not have any isomeric forms. What are the geometry and molecular formula of the blue compound?
A coordination compound of cobalt(III) contains four ammonia molecules, one sulfate ion, and one chloride ion. Addition of aqueous BaCl2 solution to an aqueous solution of the compound gives no precipitate. Addition of aqueous AgNO3 to an aqueous solution of the compound produces a white precipitate. Propose a structure for this coordination compound.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.