Percent yield of chemical reactionsYa1/5Gaseous ethane (CH;CH3)reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). If 17.9 g of water isproduced from the reaction of 11.7 g of ethane and 60.3 g of oxygen gas, calculate the percent yield of water.Round your answer to 3 significant figures.

Answered: Image /qna-images/answer/d02fba82-7c0c-4c92-ba1e-946b22b12ecd.jpg

15 Gaseous ethane (CH;CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). If 17.9 g of water is produced from the reaction of 11.7 g of ethane and 60.3 g of oxygen gas, calculate the percent yield of water. Round your answer to 3 significant figures.

15 Gaseous ethane (CH;CH3) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,O). If 17.9 g of water is produced from the reaction of 11.7 g of ethane and 60.3 g of oxygen gas, calculate the percent yield of water. Round your answer to 3 significant figures.

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.44PAE: 4.44 Industrial production of hydrogen gas uses the reaction shown below. If 1.00 metric ton of...

See similar textbooks

Similar questions

DDT, an insecticide harmful to fish, birds, and humans, is produced by the following reaction: In a government lab, 1142 g of chlorobenzene is reacted with 485 g of chloral. a. What mass of DDT is formed, assuming 100% yield? b. Which reactant is limiting? Which is in excess? c. What mass of the excess reactant is left over? d. If the actual yield of DDT is 200.0 g, what is the percent yield?
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
When small quantities of elemental hydrogen gas are needed for laboratory work, the hydrogen is often generated by chemical reaction of a metal with acid. For example, tine reacts with hydrochloric acid, releasing gaseous elemental hydrogen: :math>Zn(s)+2HCI(aq)ZnCl2(aq)+H2(g) at mass of hydrogen gas is produced when 2.50 g of zinc is reacted with excess aqueous hydrochloride acid?
Citric acid, C6H5CH3, a component of jams, jellies, and fruity soft drinks, is prepared industrially via fermentation of sucrose by the mold Aspergillus niger . The equation representing this reaction is C12H22O11+H2O+3O22C6H8O7+4H2O What mass of citric acid is produced from exactly 1 metric ton (1.000103kg) of sucrose if the yield is 92.30%?
For each of the following balanced chemical equations, calculate how many grams of the product(s) would be produced by complete reaction of 0.125 mole of the first reactant. msp;AgNO3(aq)+LiOH(aq)AgOH(s)+LiNO3(aq) msp;Al2(SO4)3(aq)+3CaCl2(aq)2AlCl3(aq)+3CaSO4(s) msp;CaCO3(s)+2HCl(aq)CaCl2(aq)+CO2(g)+H2O(l) msp;2C4H10(g)+13O2(g)8CO2(g)+10H2O(g)
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
In an experiment designed to produce calcium oxide by the chemical reaction 2Ca + O2 2CaO 177.2 g of CaO was obtained out of a possible 203.9 g ofCaO. a. What is the theoretical yield of CaO? b. What is the actual yield of CaO? c. What is the percent yield of CaO?
For each of the following unbalanced chemical equations, suppose exactly 5.0 g of each reactant is taken. Determine which reactant is limiting, and calculate what mass of each product is expected, assuming that the limiting reactant is completely consumed. msp;Na(s)+Br2(l)NaBr(s) msp;Zn(s)+CuSO4(aq)ZnSO4(aq)+Cu(s) msp;NH4Cl(aq)+NaOH(aq)NH3(g)+H2O(l)+NaCl(aq) msp;Fe2O3(s)+CO(g)Fe(s)+CO2(g)
The text explains that one reason why the actual yield for a reaction may be less than the theoretical yield is side reactions. Suggest some other reasons why the percent yield for a reaction might not be 100%.
For each of the following unbalanced chemical equations, suppose 25.0 g of each reactant is taken. Show by calculation which reactant is limiting. Calculate the theoretical yield in grams of the product in boldface. msp;C2H5OH(l)+O2(g)CO2(g)+H2O(l) msp;N2(g)+O2(g)NO(g) msp;NaClO2(aq)+Cl2(g)NaCl(aq) msp;H2(g)+N2(g)NH3(g)