17. Which statement best describes a molecular complex? The ligand in molecular complexes accepts the electrons donated by the metal ion to form the coordinate covalent bond. The interaction in molecular complexes occurs through the same charged ions such as the electrostatic forces. Molecular complexes can occur between two or more small molecules such as theophylline and EDTA. Molecular complexes result from covalent interactions between the ligand and the substrate. 18. Which statement best describes a coordination complex? A coordination complex is the interaction between two or more molecules which results in an acidic complex. A coordination complex results from covalent interactions between the ligand and the substrate. The interaction in a coordination complex is said to be classified as Lewis acid-base reaction. The ligand in a coordination complex accepts the electrons donated by the metal ion to form the coordinate covalent bond.

17. Which statement best describes a molecular complex? The ligand in molecular complexes accepts the electrons donated by the metal ion to form the coordinate covalent bond. The interaction in molecular complexes occurs through the same charged ions such as the electrostatic forces. Molecular complexes can occur between two or more small molecules such as theophylline and EDTA. Molecular complexes result from covalent interactions between the ligand and the substrate. 18. Which statement best describes a coordination complex? A coordination complex is the interaction between two or more molecules which results in an acidic complex. A coordination complex results from covalent interactions between the ligand and the substrate. The interaction in a coordination complex is said to be classified as Lewis acid-base reaction. The ligand in a coordination complex accepts the electrons donated by the metal ion to form the coordinate covalent bond.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 108IP: a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the...

See similar textbooks

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
How many geometric isomers of the complex ion [Cr(dmen)3]3+ can exist? (dmen is the bidentate ligand 1,1-dimethylethylenediamine.) 1,1-Dimethylethylenediamine, dmen
The square-planar complex Pt(en)Cl2 has chloride ligands in a cis configuration. No trans isomer is known. Based on the bond lengths and bond angles of carbon and nitrogen in the ethylenediamine ligand, explain why the trans compound is not possible.