4.A galvanic cell is composed of one electrode with a tin conductor in aSNSO4(aq) solution and a second electrode with a copper conductor in aCuSOa(aq) solution.Sn2*(aq) + 2eSn(s)E = -0.136 VCu2 (aq) + 2eCu(s)E = +0.337 V(a) Determine the overall cell reaction and calculate the standard cell potential. (c) Calculate Ecell at 298 K when [Sn2*]= 4.0-10-2 M and [Cu2"] = 1.5-104 M.%3D

Given : Sn2+aq+2e- →Sns E° =-0.136VCu2+aq+2e- →Cus E° =-0.337VTo find; Overall cell reaction and…

4. A galvanic cell is composed of one electrode with a tin conductor in a SnSO4(aq) solution and a second electrode with a copper conductor in a CUSO4(aq) solution. Sn2 (aq) + 2e Cu2"(aq) + 2e Sn(s) E° = -0.136 V Cu(s) E = +0.337 V (a) Determine the overall cell reaction and calculate the standard cell potential.

4. A galvanic cell is composed of one electrode with a tin conductor in a SnSO4(aq) solution and a second electrode with a copper conductor in a CUSO4(aq) solution. Sn2 (aq) + 2e Cu2"(aq) + 2e Sn(s) E° = -0.136 V Cu(s) E = +0.337 V (a) Determine the overall cell reaction and calculate the standard cell potential.

Chemistry & Chemical Reactivity

10th Edition

ISBN:9781337399074

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter19: Principles Of Chemical Reactivity: Electron Transfer Reactions

Section: Chapter Questions

Problem 84GQ

See similar textbooks

Similar questions

Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?
The standard potential for the reduction of AgSCN is 0.0895 V. AgSCN(s)+eAg(s)+SCN(aq) Find another electrode potential to use together with the above value and calculate Kspfor AgSCN.
Consider the voltaic cell 2 Ag+(aq) + Cd(s) 2 Ag(s) + Cd2+(aq) operating at 298 K. (a) Calculate the Ecell for this cell. (b) If (cone. Cd2+) = 2.0 M and (cone. Ag+) = 0.25 M, calculate Ecell. (c) If Ecell = 1.25 V and (cone. Cd2+) = 0.100 M, calculate(cone. Ag+).
What is the voltage of a concentration cell of Cl ions where the concentrations are 1.045 and 0.085 M? What the spontaneous reaction?
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
Calculate the theoretical potential of each of the following cells.Is the cell reaction spontaneous as written or spontaneous in the opposite direction? (a) Bi|BiO+ (0.0300 M),H+ (0.100 M)||I- (0.100 M), AgI(sat’d)|Ag (b) Zn|Zn2+(5.75 10-4M)||Fe(CN)64-(530 10-2 M),Fe(CN)63-(6.75 10-2M)|Pt (c) Pt,H2O (0.200 atm)|HCI(8.25 10-4M), AgCI(sat’d)| Ag
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Which of the changes below will increase the voltage of the following cell? Co|Co2+(0.010M)H+(0.010M)|H2(0.500atm)|Pt (a) Increase the volume of COCl2 solution from 100 mL to 300 mL. (b) Increase [H+] from 0.010 M to 0.500 M. (c) Increase the pressure of H2 from 0.500 atm to 1 atm. (d) Increase the mass of the Co electrode from 15 g to 25 g. (e) Increase [CO2+] from 0.010 M to 0.500 M.