6) Complexes with five d electrons (d) are sometimes tetrahedral and sometimes octahedral.Consider the high-spin complexes [FeCl] and [FeCI]-.Knowing the splitting energy of the octahedral complex A.= 11000 cm-, deduce thatcorresponding to the tetrahedralA,(cm-1) 3=( five significant figures)

Given is ∆o =11000 cm-1 And we have to determine ∆t Also we know that ∆t = 4/9 ∆o

6) Complexes with five d electrons (d) are sometimes tetrahedral and sometimes octahedral. Consider the high-spin complexes [FeCla] and [FeCl,]. Knowing the splitting energy of the octahedral complex A.= 11000 cm-, deduce that corresponding to the tetrahedral A,(cm-1) = ( five significant figures)

6) Complexes with five d electrons (d) are sometimes tetrahedral and sometimes octahedral. Consider the high-spin complexes [FeCla] and [FeCl,]. Knowing the splitting energy of the octahedral complex A.= 11000 cm-, deduce that corresponding to the tetrahedral A,(cm-1) = ( five significant figures)

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter20: Chemistry Of Selected Transition Elements And Coordination Compounds

Section20.7: Crystal-field Theory: Color And Magnetism In Coordination Compounds

Problem 20.10PSP

See similar textbooks

Related questions

Q: Explain the effect of functional groups on the structure of the ligand (A) by considering HSAB on…

A: Here, we need to explain the formation of complex B by using ligand A by employing concept of Hard…

Q: This question involves a calculation of the octahedral preference energy for the aqua complexes of…

A: Note: Since you have posted multiple independent questions in the same request, we will solve the…

Q: So I am working with an octahedral complex that has two weak field ligands (Cl) and 4 strong field…

Q: The rates of exchange of CO on cis square-planar Ir complexes have been observed for the following…

A: Given, all three reactions have large negative values of entropy of activation that indicates in…

Q: You have a neutral, 4-coordinate macrocyclic ligand that binds to Ni(II). When a weakly-coordinating…

A: Square-planar Ni(II) complexes are diamagnetic and their colour is usually red, yellow or…

Q: The ligand-field strength also depends on the identity of the central ion, the order being Mn2+ <…

Q: Fill in the blanks : (i) When a ligand has a two-complexing or donor group in its structure, it is…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Do you expect any tetragonal distortion from octahedral structures of the following complexes.…

A: The Jahn Teller Effect is a geometric distortion of a non linear molecular system that reduces its…

Q: The metal ion, M2+, formed a paramagnetic tetrahedral complex [MJ4]2+, having three unpaired…

A: Given: We have to calculate the hybridization of given M2+ ion.

Q: the complex [CrO7]² is bright orange colored, suggest reason for that ?

A: In this question, we will discuss about why complex [Cr2O7]2- ion is bright orange color. You can…

Q: The factor determining the mechanism observed in the substitution reactions of square plane…

A: Substitution reactions in coordination complexes are the reactions in which one ligand in a complex…

Q: Complex [Co(en):] [Co(CN)} [CoF6] [Co(NH;)6]* [Co(H2O),]*" Ao (cm ) 23,160 33,700 13,100 23,000…

A: 3. a. We have to tell among the given complexes, which two would be best explained by the σ-only…

Q: 4. Many transition metal complexes are said to follow the "18-electron rule," meaning they form…

A: The molecular orbital is used to show the availability of electrons in the bonding orbitals,…

Q: [FeL6]* complex (L indicates a monodentate ligand) has a magnetic moment of approximately 1.73 B.M.…

Q: 1.Show how a Fischer carbene complex can be prepared starting from Mo(CO)6 . 2.How would you explain…

A: Back donation:The carbonyl ligand that coordinated with the metal has electron rich sp orbital. The…

Q: Predict the geometry and number of unpaired spins in thefollowing four-coordinate complexes:…

A: [AuBr4]- Given information says that it is a 4-coordinate, hence it can be either square planar or…

Q: A d' octahedral complex is found to absorb visible light, with the absorption maximum occurring at…

Q: When the K[PtCl3(C2H4)] complex obeys the 18 electron rule according to the electron pair donor…

A: The electron-pair donor method of counting the electrons is also known as the ionic method. The…

Q: C1....... Cu ***.... CI 5. Answer the following questions related to crystal field splitting. A. For…

Q: Explain why the tetrahedral complexes A and B have magnetic moments of 1.89 and 0.0 BM respectively

A: Fe2+ is 3d6 It Has 0 unpaired electron in l.s. complexes and thus the magnetic moment would be close…

Q: Why d7,d8,d9 complexes prefer square planar with pi acceptor strong field ligands

A: Ligands are those species which forms a bond with metal by donating the electrons. Pi acceptor…

Q: Explain why there is no distinction between low and high-spin arrangements for an octahedral d8…

Q: 13. A complex ion has been observed which starts with a violet color with six aqua ligands attached.…

Q: Explain by means of different mechanisms of stereochemical fluctuations, how cistrans-isomerization…

A: Let's discuss about the mechanism for cis-trans isomerisation in five coordinated transition metal…

Q: The factor determining the mechanism observed in the substitution reactions of square plane…

A: here, for the nucleophilic substitution reaction Sn2 for the inorganic reaction mechanism yes, This…

Q: The ligand-field-stabilization-energies (LFSE) of three pairs of [ML«]³" and [ML«J* complexes are…

A: For octahedral complexes: For a high spin complex the energy gap between t2g and eg is less but for…

Q: Sketch the orientation of the orbitals relative to the ligandsin an octahedral complex to explain…

A: Crystal field splitting (CFT)-bonding interaction between the transition metals The orientation of…

Q: Each of a series of ligands, A, B and C can bind Li' ions. The values of AH (KJmol') for the…

A: The stability of coordination complex is an important factor that decides the stability and…

Q: 9. Describe the various ligand classes and give an example in each case! 10. Justify why…

A: Ligand is atom or ion which donate electron density to metal ion.

Q: Consider the reactions below. Which of the following correctly identifies the coordinate complex?…

Q: a) Draw the lewis structure of the nitrate ion and discuss its potential to serve as an ambidentate…

A: Ambidentate Ligand : This are one type of monodentate ligands having two different donar atoms, that…

Q: . Explain why octahedral coordination complexes withthree and eight d electrons on the central metal…

A: The stability of the octahedral complexes can be best explained by carefully examining the…

Q: 1. The UV-visible spectrum of an aqueous solution of CuSO, (which contains a Cu2+ metal center)…

A: ∆Oct is an energy term, representing the energy gap between the splitted orbitals and have an…

Q: When MCl4(NH3)2 is dissolved in water and treated withAgNO3, 2 mol of AgCl precipitates immediately…

A: When MCl4(NH3)2 is dissolved in water and treated withAgNO3, 2 mol of AgCl precipitates immediately…

Q: 6.) a.) In the series of Werner complexes (after the German-Swiss chemist) [CoX(NH3)s]** with X =l',…

Q: The ion [Fe(CN)6]3- has one unpaired electron, whereas[Fe(NCS)6]3- has five unpaired electrons. From…

A: The coordination complexes can be defined as the complex compounds which have coordinate linkage…

Q: 15. In 1844, cis- and trans-[PtCl2(NH3)2] were discovered. The FDA approved the anti-cancer drug…

Q: Consider a d5 complex in tetrahedral symmetry. The dipole moment is found to be 1.73 μB. Is the…

Q: (a) Draw labelled d-orbital splitting diagrams for the metal centres in [CO(OH₂)6]Cl2 and…

Q: Explain why there is no distinction between low and high-spin arrangements for an octahedral d8…

Q: (b) Discuss the electric quadruple splitting in Mössbauer spectroscopy. Explain how this is helpful…

A: Answer - Quadrupole splitting - Quadrupole splitting is measured as the separation between these two…

Q: This complex in organometallics is described as: haxacarbonyl Fe- complex sandwich complex dinuclear…

Q: Estimate the crystal field stabilization energy for the octahedral ion hexaaquacobalt(III) , if the…

A: CFSE value calculation of a hexaaquacobalt complex :

Q: The complex [FeL2X2] {where L = 1,10-phenanthroline and X = thiocyanate} gives a magnetic moment,…

A: The answer of the question is given below:

Q: Why are there both high-spin and low-spin octahedral com-plexes but only high-spin tetrahedral…

Q: The octahedral complex ion [Co(NH3)6]** has fewer unpaired spins than the octahedral complex ion…

Q: Experiments can measure not only whether a compound is paramagnetic, but also the number of unpaired…

A: In the given complexes, CN- is a strong field ligand, and H2O is a weak field ligand.

Q: What is the difference between a monodentate and a multidentate ligand? Is a chelating ligand…

A: A ligand contains 1 or more donor atoms which are coordinated to the central metal atom to form a…

Concept explainers

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.

Question

100%

6) Complexes with five d electrons (d) are sometimes tetrahedral and sometimes octahedral.
Consider the high-spin complexes [FeCl] and [FeCI]-.
Knowing the splitting energy of the octahedral complex A.= 11000 cm-, deduce that
corresponding to the tetrahedralA,(cm-1) 3=
( five significant figures)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Is it possible for a complex of a metal in the transition series to have six unpaired electrons? Explain.
Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
1. Give a diagram and explain briefly how the d orbital degeneracy is removed in an octahedral complex in which a transition metal atom is surrounded by 6 ligands.
. Explain why octahedral coordination complexes withthree and eight d electrons on the central metal atom areparticularly stable. Under what circumstances would youexpect complexes with five or six d electrons on the central metal atom to be particularly stable?
Explain why the tetrahedral complexes A and B have magnetic moments of 1.89 and 0.0 BM respectively. Comment on the observations.
3 You have a neutral, 4-coordinate macrocyclic ligand that binds to Ni(II). When a weakly-coordinating perchlorate ion (CIO4-2) is the anion in solution, it produces a red-colored diamagnetic low-spin d8 complex. When perchlorate is replaced by two thiocyanate ions, (SCN-), the Ni-macrocycle complex turns violet and has two unpaired electrons. Predict what has happened to the geometry and the d-orbital splitting that has resulted in the change in color?
What structural distortions would you expect to occur in the complex LnM( eta 4- butadiene) if the ligands L were made more electron releasing?
The values for lmax for complex A and B are 512 nm and 650 nm respectively. A has the structure [Co(NH3)4CO3]NO3 while B is [Co(NH3)4Cl2]Cl. Explain this data based on the Crystal Field Theory UV-visible spectroscopy provides information about cobalt(III) complexes. A blue cobalt complex has molar absorbtivity of 125 Lmol-1cm-1. Is the complex octahedral or tetrahedral? Justify your answer and explain the colour of the complex.
I'm struggling to understand magnetic moments. If [Mn(NCS)6]4- shiwed a value if 6.06 micro B, I guess that the complex would be low-spin. How would I show this and relate it to an energy level diagram showing the splitting of 3d orbitals? thankyou for any help .
Sketch the orientation of the orbitals relative to the ligandsin an octahedral complex to explain the splitting and the relativeenergies of the dxyand dx2-y2 the orbitals.
The metal ion, M2+, formed a paramagnetic tetrahedral complex [MJ4]2+, having three unpaired electrons. Whereas, with the ligand monodentate anionic ligand A-, it forms the paramagnetic octahedral complex [MA6]4-, having the same number of unpaired electrons as that of for [MJ4]2+.Another octahedral, low-spin complex [MG3]2+, which has one unpaired electron. 1.Show the orbital diagrams for the determination of the hybridization of M2+ in the complexes [MA6]4- and [MG3]2+. Give the hybridization of M2+ in the complexes.