4. Many transition metal complexes are said to follow the "18-electron rule," meaning they form particularly stable complexes when the metal + ligand electrons contributing to the MOs add up to a total of 18 electrons. Use the full MO diagram for an octahedral metal complex with pi-acidic ligands we derived in class to justify why 18-electrons might be particularly stable.

4. Many transition metal complexes are said to follow the "18-electron rule," meaning they form particularly stable complexes when the metal + ligand electrons contributing to the MOs add up to a total of 18 electrons. Use the full MO diagram for an octahedral metal complex with pi-acidic ligands we derived in class to justify why 18-electrons might be particularly stable.

Fundamentals Of Analytical Chemistry

9th Edition

ISBN:9781285640686

Author:Skoog

Publisher:Skoog

Chapter26: Molecular Absorption Spectrometry

Section: Chapter Questions

Problem 26.30QAP

See similar textbooks

Similar questions

A 3.03-g petroleum specimen was decomposed by wet ashing and subsequently diluted to 500 mL in a volumetric flask. Cobalt was determined by treating 25.00-mL aliquots of this diluted solution as follows: Assume that the Co(II)-ligand chelate obeys Beer’s law, and calculate the percentage of cobalt in the original sample.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
Many transition metal complexes are said to follow the “18-electron rule,” meaning they form particularly stable complexes when the metal + ligand electrons contributing to the MOs add up to a total of 18 electrons. a. Use the full MO diagram for an octahedral metal complex with pi-acidic ligands we derived in class to justify why 18-electrons might be particularly stable. b. Use the 18-electron rule to predict which 1st row transition metal would be most likely to form an octahedral M(CO)6 (Note: there is no charge; the metal retains all its electrons.) c. Qualitatively, how would you expect the CO bond to change when it forms this complex? Would it be stronger, weaker, or the same compared to free CO? (Hint: think about what a ? −???? means and what the orbital does from the perspective of the M–CO interaction as well as the C– O interaction).
Construct an MO correlation diagram for the complex ion[Ni(NH3)6]2+ and populate the orbitals with electrons. Do youexpect p bonding to be important for this complex? Whatfeatures of this diagram correspond to those predicted usingcrystal field theory? What kind of bonding would VB theorypredict for d8 complexes, and how does MO theory accountfor the bonding more accurately, even qualitatively?
Sketch structure of Mo(DMe) Cl2 (NMe,)2 , thhen apply ean to this complex showing ligand analysis and oxidation state analysis
Sketch the orientation of the orbitals relative to the ligandsin an octahedral complex to explain the splitting and the relativeenergies of the dxyand dx2-y2 the orbitals.
Determine the symmetry of the orbital groups for the donor sigma bonds (σ) of the ligand in an octahedral complex. Construct an MO diagram for the formation of this complex and indicate which orbitals determine the Δo. Clearly indicate the procedure.
Compounds with lone pair of electrons are able to form complexes via the donation of electrons intothe empty d orbital of transition metals. Which of these two: NF3and NH3has greater tendency to do so?and give reason for your choice.
Provide crystal field splitting diagrams that clearly show orbital names, orbitalelectron population, and 10Dq (i.e. ∆o) for the following complexes. Use your knowledge of the spectrochemical series and crystal field theory to determine LS vs. HS
Are bipyridines (bipy) and analogous amines, phenanthroline (phen) and terpyridine (terpy) chelate ligands?Is there the possibility of the formation of complexes of these ligands with metals in a low oxidation state? Why?
Which ligand below gives the LEAST stability to Pd2+ in forming a square planar complex
Why d7,d8,d9 complexes prefer square planar with pi acceptor strong field ligands