A compound containing only carbon, hydrogen, and oxygen is analyzed using 1 combustion analysis. When 0.641 g of the compound is burned, 1.281 g of carbon dioxide and 0.524 g of water are collected. In order to determine the moles of carbon in the compound, first determine the moles of carbon dioxide that were produced from the combustion. a O of 0.63 points earned 5 attempts remaining

A compound containing only carbon, hydrogen, and oxygen is analyzed using 1 combustion analysis. When 0.641 g of the compound is burned, 1.281 g of carbon dioxide and 0.524 g of water are collected. In order to determine the moles of carbon in the compound, first determine the moles of carbon dioxide that were produced from the combustion. a O of 0.63 points earned 5 attempts remaining

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter2: Chemical Formulas, Equations, And Reaction Yields

Section: Chapter Questions

Problem 13P

See similar textbooks

Similar questions

An air bag is deployed by utilizing the following re tion the nitrogen gas produced inflates the air bag): :math>2NaN3(s)2Na(s)+3N2(g) 10.5 g of NaN1 is decomposed, what theoretical mass of sodium should be produced? If only 2.84 g of sodium is actually collected, what is the percent yield?
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
3.50 A test of an automobile engine's exhaust revealed that g of NO2 was emitted in 10 minutes of operation. How many moles of NO2 would this engine release if it were used for a 45-minute commute, assuming that this mea- sured number is representative of the emission under all circumstances?
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Freon-12, CCl2F2, is prepared from CCl4 by reaction with HF. The other product of this reaction is HCl. Outline the steps needed to determine the percent yield of a reaction that produces 12.5 g of CCl2F2 from 32.9 g of Cd4. Freon-12 has been banned and is no longer used as a refrigerant because it catalyzes the decomposition of ozone and has a very long lifetime in the atmosphere. Determine the percent yield.
Atoms of three different elements are represented by O, , and . Which compound is left over when three molecules of O. and three molecules of . react to form O. And O?
You have a chemical in a sealed glass container filled with air. The setup is sitting on a balance as shown below. The chemical is ignited by means of a magnifying glass focusing sunlight on the reactant. After the chemical has completely burned, which of the following is true? Explain your answer. a. The balance will read less than 250.0 g. b. The balance will read 250.0 g. c. The balance will read greater than 250.0 g. d. The scales reading cannot be determined without knowing the identity of the chemical.
What is true about the chemical properties of the product? a. The properties are more like chemical A. b. The properties are more like chemical B. c. The properties are an average of those of chemical A and chemical B. d. The properties are not necessarily like either chemical A or chemical B. e. The properties arc more like chemical A or more like chemical B, but more information is needed. Justify your choice, and for choices you did not pick, explain what is wrong with them.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
Hydrazine N2H4, emits a large quantity of energy when it reacts with oxygen, which has led to hydrazine’s use as a fuel for rockets: :math>N2H4(l)+O2(g)N2(g)+2H2O(g) w many moles of each of the gaseous products are produced when 20.0 g of pure hydrazine ¡s ignited in the presence of 20.0 g of pure oxygen? How many grams of each product are produced?