A compound containing only carbon, hydrogen, and oxygen is analyzed using combustion analysis. When 0.501 g of the compound is burned, 0.711 g of carbon dioxide and 0.436 g of water are collected. Given that there are 0.0161 moles of carbon and 0.0484 moles of hydrogen produced in the reaction, calculate the mass of oxygen in the original compound. You will need to subtract the mass of the carbon that ended up in the carbon dioxide and the mass of the hydrogen that ended up in the water from the mass of the original compound.

A compound containing only carbon, hydrogen, and oxygen is analyzed using combustion analysis. When 0.501 g of the compound is burned, 0.711 g of carbon dioxide and 0.436 g of water are collected. Given that there are 0.0161 moles of carbon and 0.0484 moles of hydrogen produced in the reaction, calculate the mass of oxygen in the original compound. You will need to subtract the mass of the carbon that ended up in the carbon dioxide and the mass of the hydrogen that ended up in the water from the mass of the original compound.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter2: Chemical Formulas, Equations, And Reaction Yields

Section: Chapter Questions

Problem 13P

See similar textbooks

Similar questions

An air bag is deployed by utilizing the following re tion the nitrogen gas produced inflates the air bag): :math>2NaN3(s)2Na(s)+3N2(g) 10.5 g of NaN1 is decomposed, what theoretical mass of sodium should be produced? If only 2.84 g of sodium is actually collected, what is the percent yield?
Sodium borate decahydrate, Na2B4O710H2O is commonly known as borax. It is used as a deodorizer and mold inhibitor. A sample weighing 15.86 g is heated until a constant mass is obtained indicating that all the water has been evaporated off. (a) What percent, by mass of Na2B4O710H2O is water? (b) What is the mass of the anhydrous sodium borate, Na2B4O7?
Suppose that Si28(1428Si) is taken as the standard for expressing atomic masses and assigned an atomic mass of 10.00 amu. Estimate the molar mass of sodium nitride.
Fig. 5-5 illustrates a schematic diagram of a combustion device used to analyze organic compounds. Given that a certain amount of a compound containing carbon, hydrogen, and oxygen is combusted in this device, explain how the data relating to the mass of CO2 produced and the mass of H2O produced can be manipulated to determine the empirical formula.
When 9.59 g of a certain vanadium oxide is heated in the presence of hydrogen, and a new oxide of vanadium are formed. This new vanadium oxide has a mass of 8.76 g. When the second vanadium oxide undergoes additional heating in the presence Of hydrogen, 5.38 g of vanadium metal forms, a. Determine the empirical formulas for the two vanadium oxides. b. Write balanced equations for the Steps of the reaction. c. Determine the mass of hydrogen needed to complete the steps of this reaction.
When elemental carbon is burned in the open atmosphere, with plenty of oxygen gas present, the product is carbon dioxide. :math>C(s)+O2(g)CO2(g) wever, when the amount of oxygen present during the burning of the carbon is restricted, carbon monoxide is more likely to result. :math>2C(s)+O2(g)CO(g) at mass of each product is expected when a 5.00-g sample of pure carbon is burned under each of these conditions?
he production capacity for acrylonitrile (C3H3N)in the United States is over 2 billion pounds per year. Acrylonitrile, the building block tor acrylonitrile fibers and a variety of plastics, is produced from gaseous propylene, ammonia, and oxygen: :math>2C3H6(g)+2NH3(g)+3O22C3H3N(g)+6H2O(g) l type='a'> Assuming 100% yield, determine the mass of acrylonitrile which can be produced from the mixture below: l> Mass Reactant msp;5.23102g propylene td> msp;5.00102g ammonia td> msp;1.00103g oxygen td> i>What mass of water is formed from your mixture? Calculate the mass (in grams) of each reactant after the reaction is complete.
Given that the molar mass of carbon tetrachloride, CCl4 , is 153 g, calculate the mass in grams of 1 molecule of CCl4 .
Urea, CO( NH2)2, is manufactured on a large scale for use in producing urea-formaldehyde plastics and as a fertilizer. What is the maximum mass of urea that can be manufactured from the CO2 produced by combustion of 1.00103 kg of carbon followed by the reaction? CO2(g)+2NH3(g)CO( NH2)2(s)+H2O(l)
hich of the following statements is true for the reaction of nitrogen gas with hydrogen gas to produce ammonia (NH3)? Choose the best answer. l type='a'> Subscripts can be changed to balance this equation, just as they can he changed to balance the charges when writing the formula for an ionic compound. i>The nitrogen and hydrogen will not react until you have added the correct mole ratios. i>The mole ratio of nitrogen to hydrogen in the balanced equation is 1:2. i>Ammonia will not form unless 1 mole of nitrogen and 3 moles of hydrogen have been added. i>The balanced equation allows you to predict how much ammonia you will make based on the amount of nitrogen and hydrogen present.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Lead(ll) oxide is obtained by roasting galena, lead(ll) sulfide, in air. The unbalanced equation is: PbS(s)+O2(g)PbO(s)+SO2(g) ) a. Balance the equation, and determine the theoretical yield of PbO if 200.0 g of PbS is heated. b. What is the percent yield if 170.0 g of PbO is obtained?