A solution is made from 0.45M NH3 and 0.44 M NH4CI. What is the pH if the Kh for NH3 is 1.8x107 Express your answer to two decimal places.

Q: Handwritten work for the pH of a solution that 0.82 M

A:

Q: 69. A 0.185 M solution of a weak acid (HA) has a pH of 2.95. Calculate the acid ionization constant…

A: A weak acid are those which does not completely dissociate to liberate H+ ion

Q: Calculate the pH of each solution given the following. [H3O+]=9×10−6M  Express your answer using…

A:

Q: The K, of yittrium hydroxide, Y(OH),(s), is 1 x 10 22 at 298 K. The pH of this solution to one…

A: The product of equilibrium concentrations of the constituent ions raised to the power equal to their…

Q: A student prepares three solutions, X, Y, and Z, as described in the table above. The values of Ka…

A: We are given 3 solutions X, Y and Z. In order to compare their pH, we have to calculate the pH of…

Q: Calculate the pH of a solution that is 0.175M benzoic acid and 0.250M sodium benzoate, a salt whose…

A: A buffer solution is a solution which resist change in pH when small amount of an acid or base is…

Q: If the K, of a weak base is 7.2 × 10-6, what is the pH of a 0.33 M solution of this base? pH =

A: in this question given data is  α=KaC   ka×kb=10-14C=0.33MPH=-logH+ Apply the value given formula,…

Q: Enter your answer in the provided box. The K, for benzoic acid is 6.5 x 10. Calculate the pH of a…

A: Given that : Ka for benzoic acid = 6.5 x 10-5 Concentration of benzoic acid = 0.13 M We have to…

Q: if 3,11•10^-4 moles of NaOH is reacted with 5,71•10^-4 moles of HCL,what is the pH if the total…

A: Consider the neutralization reaction between NaOH and HCl is as follows: NaOH + HCl → NaCl + H2O…

Q: What is the ph of a 0.214 M weak base solution? The Kb of the weak base is 0.000033.

A: Given :-  Concentration of weak base = 0.214 M  Kb = 0.000033  To calculate :-  pH of solution

Q: How many moles of NH3 must be dissolved in water to give 819.8 mL of solution with a pH of 10.97? K,…

A:

Q: What is the pH of a 0.627 M weak base solution? The Kb of the weak base is 0.000066.

A: Given :- concentration of weak base solution = 0.627 M  Kb for weak base = 0.000066  To calculate :-…

Q: When calculating the [H3O+} for a polyprotic acid, the second ionization step can often be…

A: Polyprotic acids are capable of releasing more than 3 protons. The ionization constant value for the…

Q: What is the pH and pOH of a solution made by adding water to 15 grams of hydroiodic acid until the…

A:

Q: Calculate the pH of a solution that is 0.245M benzoic acid and 0.130M sodium benzoate, a salt whose…

A: The solution of benzoic acid and sodium benzoate forms an acidic buffer solution which consists of a…

Q: An aqueous solution at 25 °C is 12.9% HNO, by mass and has a density of 1.049 g/mL. What is the pH…

A: Assuming we have 100 g of solution  hence mass of HNO3 in it = mass % X mass of solution / 100 =…

Q: What is the pH of a 50 cm3 KOH solution if the concentration of it is 0.0100 mol/dm3. How the pH is…

A:

Q: When the pH is equal to pKa, the solution is said to be A) Basic [B Charged C. On its stoichiometric…

A: Given : pH and pKa are equal for a solution. To find: Type of solution. Solution: As we know, on the…

Q: An aqueous solution at 25 ∘C is 14.7% HNO3 by mass and has a density of 1.043 g/mL. What is the pH…

A: The acidity of a solution depends on the concentration of the [H]+ ion. The pH is the most…

Q: Enter your answer in the provided box. The K, for benzoic acid is 6.5 X 10. Calculate the pH of a…

A: Given- Ka for benzoic acid =6.5×105  Concentration of benzoi acid= 0.13M

Q: Suppose a 0.10OM solution of each of the following substances is prepared. Rank the pH of the…

A: There are some substance :-  KF, NH4I ,HBr, NaCl, LiOH . We have to calculate the PH of the  0.100M…

Q: 5. A solution contains 0.0085 M ammonia. What is the pH of this solution? For ammonia: Kb=1.8×105.

A:

Q: An unknown weak base with a concentration of 0.0910 M has a pH of 10.90. What is the Kb of this…

A:

Q: An unknown weak base with a concentration of 0.0910 M has a pH of 10.80. What is the Kb of this…

A: Welcome to bartleby!  Introduction :  We have to calculate Kb of the base .

Q: Would a 1 M solution of just acetic acid resist increases to pH, decreases to pH, neither, or both?…

A: 1M acetic acid is acidic, because Ka value of acetic acid is greater than kb value of its conjugate…

Q: If the K, of a weak base is 1.7 × 10-6, what is the pH of a 0.18 M solution of this base? pH =

A: pH of a substance represents the strength of an acid or base. If the pH is small, it is a strong…

Q: In the laboratory, a general chemistry student measured the pH of a 0.319 M aqueous solution of…

A: using the given PH using the PH calculate the H+ concentration . PH=-logH+ put the value pH  then…

Q: A chemist dissolves 595. mg of pure nitric acid in enough water to make up 360. mL of solution.…

A: Molar mass of HNO3,

Q: - solution is made from 0.19 M CH3NH2 (a weak base) and 0.27 M CH3NH3CI. What is the pH of the…

A: Solution-  CH3NH2=0.19 MCH3NH3Cl=0.27MUsing the henderson eqution -GivenKb=4.4×10-4 pKb=-logKb…

Q: Calculate the pH of a solution that is 0.135M benzoic acid and 0.260M sodium benzoate, a salt whose…

A:

Q: A 0.1130 M solution of a base is 4.9% ionized. Calculate the base ionization constant Kb.

A:

Q: A 0.15 M solution of a certain weak acid has a pH of 4.25. The K, of the weak acid is

A:

Q: In the laboratory, a general chemistry student measured the pH of a 0.386 M aqueous solution of…

A: Note: As per our guidelines we are suppose to do only first question. To get the solution of other…

Q: Calculate the pH of a solution that is 0.115M benzoic acid and 0.140M sodium benzoate, a salt whose…

A: Concentration of benzoic acid = 0.115 MConcentration of Sodium benzoate = 0.140 MSince the buffer…

Q: A solution is prepared at 25 °C that is initially 0.42M in ammonia (NH,), a weak base with K, = 1.8…

A:

Q: Calculate the pH of a solution made by mixing 18.5mL of 0.15M HCI with 6.7mL of 0.10M NaOH. Enter…

A:

Q: In the laboratory, a general chemistry student measured the pH of a 0.558 M aqueous solution of…

A:

Q: For each of the following solutions, calculate the initial pH and the final pH after adding 0.0100…

A: a) For pure water, [H+]=[OH-]=10-7pH=-log[H+]pH=-log(10-7)pH=7

Q: Calculate the pH of a solution that is 0.165M benzoic acid and 0.200M sodium benzoate, a salt whose…

A: pH = pKa + log[Conjugate base]/[acid]

Q: In the laboratory a student measures the percent ionization of a 0.558 M solution of formic acid ,…

A: The dissociation of formic acid: Concentration of formic acid =0.558M. Percentage ionization of…

Q: What is pH of a solution consisting of 1.35 M NH3 and 2.08 M NH,NO,? K, of NH, is 5.8 x 10 10 0 9.13…

A: Given: Concentration of NH3 = 1.35 M Concentration of NH4NO3 = 2.08 M Ka for NH4+ = 5.8×10-10 We…

Q: 6 g of LIOH is added to water to make 500 mL of solution. What is the pH?

A:

Q: Consider a solution of an unknown salt having the general formula BHCl, where B is one of the weak…

A: Given  Concentration of unknown salt = 0.1 M pH of salt solution = 5.82

Q: A 0.2690 M solution of a base is 2.8% ionized. Calculate the base ionization constant Kh.

A: Base ionization constant Kb is a measure of the strength of the base.

Q: You have a 0.125 M solution of ammonium chloride.  If the Kb of NH3 = 1.75x10-5, calculate the pH of…

A:

Q: In the laboratory, a general chemistry student measured the pH of a 0.591 M aqueous solution of…

A:

Ionic Equilibrium

Chemical equilibrium and ionic equilibrium are two major concepts in chemistry. Ionic equilibrium deals with the equilibrium involved in an ionization process while chemical equilibrium deals with the equilibrium during a chemical change. Ionic equilibrium is established between the ions and unionized species in a system. Understanding the concept of ionic equilibrium is very important to answer the questions related to certain chemical reactions in chemistry.

Arrhenius Acid

Arrhenius acid act as a good electrolyte as it dissociates to its respective ions in the aqueous solutions. Keeping it similar to the general acid properties, Arrhenius acid also neutralizes bases and turns litmus paper into red. 

Bronsted Lowry Base In Inorganic Chemistry

Bronsted-Lowry base in inorganic chemistry is any chemical substance that can accept a proton from the other chemical substance it is reacting with.