A species is reduced when it gains electrons and considered - الاختيارات none of them O reducing agent O oxidizing agent O oxidation numbers O

Q: Acetaminophen is the active ingredient in Tylenol. Write the molecular formula of the compound. What…

A:

Q: prepare 0.9% potassium Chloride (KCI) in 0.5 liter ?

A:

Q: 5.) What is the difference between -OH and OH-?

A:

Q: What is the oxidation state on the central carbon in the following compound? 0 HẠN CNH, 00 +1 +2 +3…

A: Given, Compound 1.H2N -CO-NH2 Compound 2. H3C-CH(CH3)-CH3

Q: Consider the following reaction: COCI2(g) CO(g) + Cl₂(g) Kc = 7.3x10-4 Calculate [CO]eq, [Cl₂eq],…

A: Given, COCl2(g) ⇌ CO(g) + Cl2(g) Equilibrium constant (Kc) = 7.3 × 10-4 Initial concentration of…

Q: Write a balanced equation for the double-replacement precipitation reaction described, using the…

A:

Q: 2. Answer parts a-e using the skeletal structure of the molecule shown below. NB # -NC=N; NÁ a. Add…

A:

Q: How much energy is released when 8.1 g of water is heated from 12 °C to 18 °C? 203.3 J 203.3 kJ…

A: We have to calculate how much energy

Q: HERE IS THE DESCRIPTION: Start with the condensed structural formula CH3-C(CH3)=CH-C(CH3)2-CH(CH3)2…

A:

Q: Which of the following conformations is the most stable? -CH3 S H₂C. CH3 CH3 CH3 -CH3

A:

Q: What is the molar mass (in kg/mol) of carbon tetrachloride (CC14)? 6 17 C CL 35.45 12.01 2. 0.2535…

A: Here we are required to find the molar mass of carbon tetrachloride

Q: where does 0.5116 and 1.0074466?

A: The pH of a solution is determined by the Henderson-Hasselbalch equation. It is used to calculate…

Q: Which ion would you expect to have the largest crystal field splitting, A? strong weak CN,CO NO₂ en…

A: "To get remaining sub-parts solved please repost the complete question and mention the sub-parts to…

Q: An aqueous solution of hydrofluoric acid is 30.0% HF, by mass, and has a density of 1.101 g cm³.…

A: Given data :

Q: 8. In the following diagram, the letter which represents the position of the activated complex is: A…

A:

Q: Pb²+ + Zn²+ + 2H₂O-Zn + PbO₂+ 4H+ In the above redox reaction, use oxidation numbers to identify the…

A: Recall the given redox reaction,                             Pb2+  +  Zn2+  +  2 H2O  →   Zn  +…

Q: Give a clear handwritten answer with explanation....Complete the following reaction..and define…

A: In this question, we will complete the given reactions and also identify which one is acid and which…

Q: The conjugate base of propan-1-ol, CH3CH2OH, is shown belo :0: *1₂ H3C-C- -CH3 H TRUE, FALSE OR IT…

A: A congugate base is the chemical species which is left over when an acid looses its proton and the…

Q: Which of the following species are likely to be nucleophiles and which electrophiles? OH CH3O CH3CI…

A:

Q: Draw a skeletal ("line") structure of this molecule: 0 CH3 0 || | || CH3-C-N-C-CH₂-CH3

A:

Q: Consider the following thermochemical equation 25O2 + O₂ → 2SO3 AH = -198.2 kJ What is the energy…

A:

Q: Consider the following reaction:       CO(g) + 3H2 (g) ⇌  CH4 (g) If Kc = 3.46 What is Kc for the…

A: If the equilibrium reaction is reversed then the equilibrium constant of the reversed reaction will…

Q: The Lewis Dot Structure rule states that S=N-A. Recall that N represents the TOTAL number of valence…

A:

Q: Question 19 The following is an example of a(n)__________ reaction. 0 0 CH,COCH,CH, но — CH₂COH.…

A:

Q: At what temperature will 19.4 g of molecular oxygen, O2, exert a pressure of 1820 mm Hg in a 5.12 L…

A:

Q: Calculate the wavelength (in n) of the red light emitted by a neon sign with frequency of 4.74x10

A: In this question, we will determine the wavelength for red light when frequency for light should be…

Q: Consider the structure of testosterone to identify the best suitable quantitative analysis for…

A: The steroid hormone testosterone is very significant. Total testosterone levels in healthy,…

Q: Consider the following reaction: CH₂(g) + H₂O(g) = CO(g) + 3 H₂(g) AH = 231 kJ predict the…

A: Dear student ,   since you have posted multiple parts questions we are allowed to solve only first…

Q: The electron in a Bohr hydrogen atom is bound less tightly when it has a quantum number of 3 than…

A:

Q: 15 mL of a 0.4M solution of tripeptide Glu-Arg-His is adjusted to pH=6.0. the solution is then…

A: Millimoles of tripeptide taken =Molar concentration of tripeptide×Volume of tripeptide=0.4 M×15 mL=6…

Q: 2. Clearly explain, using Le Chataliers Principle, why the equilibrium shifts the way it does when…

A: As you have requested for the solution of question number 2 .  That explanation of Le chatelier's…

Q: empirical formula for a compound that contains 20.24% aluminum and 79.76% chlorine.

A:

Q: 6. The structure originally proposed for Cordycepic acid, [a] = +40.3°, has been ન shown to be in…

A: Cordyceps is said to help fight inflammation in the body. Although some inflammation is good, too…

Q: What is a correct name of the following molecule? C1 4-chloro-1,2-dimethylcyclopentane…

A: Correct ans is  D) cis-1-chloro-trans-3,4-dimethylcyclopentane

Q: Question 6 Which of the following self-exchange redox reactions would have a significantly higher…

A: Outer sphere mechanism is an electron transfer mechanism which takes place between two separate…

Q: (7.6) Aluminum oxide decomposes to aluminum and oxygen gas by the following reaction. Al2O3(s)…

A:

Q: Which of the following is the best HBA? a) b) c) d) R-C Els er de de R-P R-N OH XR Ob) Od d) O=

A: Hydrogen bond is formed between hydrogen bond donor and hydrogen bond acceptor.

Q: Time felt 0:04 An aqueous of gold (III) nitrate Au(NO3)3 was electrolyzed with a current of 0.015 A…

A:

Q: V Draw a skeletal ("line") structure of this molecule: Ọ CHỌ || | || CH3-C-N-C-CH₂-CH3

A: According to the question, we need to draw the skeletal structure of the given organic molecule.

Q: 2. Using reagents and condition show how the following compounds can be converted into the…

A: (i) When 3,4-dimethylpent-1-yne is treated with Lindlar's catalyst then due to Hydrogenation it will…

Q: what are the spectator ions in the reaction equation between koh(aq) and hno3(aq)

A: we know, the balanced chemical reaction between KOH and HNO3 is  KOH(aq) + HNO3(aq) ---->…

Q: What charge is likely for an ion formed from this element?

A:

Q: Calculate the volume (in mL) of 0.797 M HNO3 needed to react completely with 5.76 g of NiCO3 in a…

A: Given that -  Molarity of nitric acid HNO3 = 0.797 M  Mass of Nickel (II) Carbonate NiCO3 = 5.76 g…

Q: Provide the correct IUPAC name for the skeletal (line-bond) structure shown here.

A: The IUPAC name of a molecule can be determined based on the IUPAC rules. According to which, first…

Q: What volume (in mL) of a 0.450 g KCI dissolved in 100.0 mL solution will completely react with 0.125…

A: Given, mass of KCl = 0.450 g Volume of KCl solution = 100.0 mL = 0.1 L Concentration of Fe(NO3)2…

Q: 9. Determine whether the following drugs comply with Lipinski's rule. Also investigate the…

A: Lipiniski rule States --> 1.Not more than 5 hydrogen bond donars. 2. Not more than 10 H bonding…

Q: 6. In the titration of a strong acid with a weak base, the smaller the Kb: a. the stronger the base…

A: 6. If Kb of the base is smaller it is more easier to determine the equivalence point in the…

Q: Elaborate four (4) components of spontaneous potential

A:

Q: What mass of potassium nitrate is needed to generate 243.0 L of gas, composed of 97.00 L of N₂ and…

A: As per the guidelines, I am allowed to answer one question at a time. Please re upload the rest.…

Q: a-pinene en a-pinene reacts with 1. BH3; 2. H₂O₂, NaOH, H₂O ssible cis,trans isomers can be formed,…

A: According to the question, we need to draw the major product formed when pinene is treated with BH3…

Potentiometric Titrations

Potentiometric titration is one of the important titration methods and is mainly carried out to characterize acid solutions. It follows a method similar to that of the normal titration technique, but the main difference is that there is no indicator used in the potentiometric titrations. Instead of using an indicator, electrodes are employed for monitoring the whole titration process. A scientist named Robert Behrend did the potentiometric titration for the first time, and it was done using the mercurous solution and potassium chloride.