A voltaic cell is constructed in which the following cell reaction occurs. The half-cell compartments are connected by a salt bridge. Cl2(g) + Cu(s) –→ 2C1'(aq) + Cu"(aq) The anode reaction is: The cathode reaction is: In the external circuit, electrons migrate v the Cr|Cl, electrode v the Cu Cu* electrode. In the salt bridge, anions migrate v the CI|Cl2 compartment v the Cu|Cu* compartment.

A voltaic cell is constructed in which the following cell reaction occurs. The half-cell compartments are connected by a salt bridge. Cl2(g) + Cu(s) –→ 2C1'(aq) + Cu"(aq) The anode reaction is: The cathode reaction is: In the external circuit, electrons migrate v the Cr|Cl, electrode v the Cu Cu* electrode. In the salt bridge, anions migrate v the CI|Cl2 compartment v the Cu|Cu* compartment.

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 135CWP: Consider a galvanic cell based on the following half-reactions: a. What is the expected cell...

See similar textbooks

Similar questions

At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
Consider a galvanic cell based on the following half-reactions: a. What is the expected cell potential with all components in their standard states? b. What is the oxidizing agent in the overall cell reaction? c. What substances make up the anode compartment? d. In the standard cell, in which direction do the electrons flow? e. How many electrons are transferred per unit of cell reaction? f. If this cell is set up at 25C with [Fe2+] = 2.00 104 M and [La3+] = 3.00 103 M, what is the expected cell potential?
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
The half-cells Fe2+(aq) | Fe(s) and O2(g) | H2O (in and solution) are linked to create a voltaic cell. (a) Write equations for the oxidation and reduction half-reactions and for the overall (cell) reaction. (b) Which half-reaction occurs in the anode compartment, and which occurs in the cathode compartment? (c) Complete the following sentences: Electrons in the external circuit flow from the _______ electrode to the _____ electrode. Negative ions move in the salt bridge from the _____ half-cell to the ______ half-cell.
Consider a cell reaction at 25°C where n=4 . Fill in the following table.
Consider a cell reaction at 25°C where n=2 . Fill in the following table.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag