Aqueous sulfuric acid (H,SO,) reacts with solid sodium hydroxlide (NaOH) to produce aqueous sodium sulfate (Na, So,) and liquid water (H,O). If 0.351 of water is produced from the reaction of 2.9 g of sulfuric acid and 1.3 g of sodium hydroxide, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.

Aqueous sulfuric acid (H,SO,) reacts with solid sodium hydroxlide (NaOH) to produce aqueous sodium sulfate (Na, So,) and liquid water (H,O). If 0.351 of water is produced from the reaction of 2.9 g of sulfuric acid and 1.3 g of sodium hydroxide, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.

Chemistry

9th Edition

ISBN:9781133611097

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 159CWP: Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced...

See similar textbooks

Similar questions

In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
4.69 The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH. The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Propane, C3H8, is the fuel of choice in a gas barbecue. When burning, the balanced equation is C3H8+5O23CO2+4H2O a What is the limiting reactant in cooking with a gas grill? b If the grill will not light and you know that you have an ample flow of propane to the burner, what is the limiting reactant? c When using a gas grill you can sometimes turn the gas up to the point at which the flame becomes yellow and smokey. In terms of the chemical reaction, what is happening?
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): C5H12(l)+O2(g)CO2(g)+H2O(l) If 20.4 g of pentane are burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
4.27 Copper reacts with sulfuric acid according to the following equation: 2H2SO4+CuCuSO4+2H2O+SO2 How many grams of sulfur dioxide are created by this reaction if 14.2 g of copper reacts with 18.0 g of sulfuric acid?
For the chemical reaction C3H8O2+4O23CO2+4H2O how many product molecules are formed when nine C3H8O2 molecules react?