Balance the chemical equation Fe2O3 + ____Al = Al2O3 + _____Fe

Balance the chemical equation Fe2O3 + Al = Al2O3 + _Fe

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter7: Chemical Reactions: An Introduction

Section: Chapter Questions

Problem 35A

See similar textbooks

Related questions

Q: Balance the equation: Cl2+ BaI2→I2+ BaCl2

A: The balanced equation can be defined as the chemical equation where the number of each atom on both…

Q: Balance the chemical equation: C8H18+O2 -> CO2 + H2O

A: We have to predict the balanced equation.

Q: Balance this chemical equation (shown below) with the algebraic method. FeS + O2 ----> Fe2O3 +…

A: Given FeS + O2 ----> Fe2O3 + SO2

Q: An aqueous solution containing 9.61 g of lead(II) nitrate is added to an aqueous solution containing…

A: the balanced equation is-PbNO32aq+2KClaq→PbCl2s+2KNO3aqEach chemical reaction occurs according to…

Q: For the following reaction, 6.62 grams of calcium hydroxide are mixed with excess hydrochloric acid.…

A: We can solve the given problem by using this formula % yield= (observed yield/theoretical yield)×100

Q: balance XCl2 + AgNO3 -> X(NO3)2 + AgCl

A: Balancing of chemical equationIt may be defined as the method of making the number of atoms of…

Q: PbCO3(s)→PbO(s)+CO2(g) Balance the question then express your answers as integers separated by…

A: Balanced chemical equation:- It may be defined as the chemical equation which has all the atoms in…

Q: Iron(III) chloride and sodium sulfide react to form iron(III) sulfide and sodium chloride, according…

A: The reaction given is => FeCl3 + Na2S ---------> Fe2S3 + NaCl

Q: Write the six mile-to-mole conversions factors that can be derived from the balance chemical…

A: The balanced reaction given is, => 2 NH3 -------> 3 H2 + N2

Q: S2Cl2 (l) + NH3 (g) à S4N4 (s) + S8 (s) + NH4Cl (s) balance the equation

A: A balanced reaction is that in which no. of atoms on the product side and reactant side are equal…

Q: Balance the chemical equation: XCl2(aq) + AgNO3(aq) --> X(NO3)2(aq) + AgCL(s)

Q: 47: Balance each chemical equation Na2S(aq) + Cu(NO3)2(aq) -> NaNO3(ag) + CuS(s) HCI(aq) + 02(g) ->…

A: For balancing a chemical equation, we have to balance each and every element present in the reaction…

Q: Balance the chemical equation C7H14O2+ O2------> CO2+H2O

Q: Q8. Balance the following equations: Q 1. Hg2(C2H3O2)2(aq) + KCl(aq) → Hg2Cl2(s) + KC2H3O2(aq) Q2.…

A: 1) The balance chemical equation for this reaction is as follow Hg2(C2H3O2)2(aq) +…

Q: Balance the following skeletal chemical equations. (Use the lowest possible coefficients.)(a) Al(s)…

A: Balanced the following reactions-

Q: For the following reaction, 4.77 grams of hydrochloric acid are mixed with excess barium hydroxide.…

A: Write down the reaction between HCl and BaOH2. Ba(OH)2 (aq) +2 HCl(aq) → BaCl2(s) + 2 H2O(l) From…

Q: Balance the following equations: (g) Hg2(C2H3O2)2(aq) + KCl(aq) ----> Hg2Cl2(s) + KC2H3O2(aq) (h)…

A: Given reaction equations, (g) Hg2(C2H3O2)2(aq) + KCl(aq) → Hg2Cl2(s) + KC2H3O2(aq) (h) KI + Br2 →…

Q: Balance the following chemical equation: K2S(s) + HBr(aq) >H2S(g) + KBr(aq)

A: A balanced chemical equation is that in which all the reactants and products are written with their…

Q: For the following reaction, 3.86 grams of barium hydroxide are mixed with excess hydrochloric acid.…

A: Given mass of Ba(OH)2 = 3.86 g Reaction yield of BaCl2 = Actual yield = 3.27 g Theoretical yield…

Q: Balance the following equations: (d) AgNO3 + Ni ----> Ni(NO3)2 + Ag (e) Bi2S3 + HCl ----> BiCl3 +…

A: A balanced chemical equation is an appropriate representation of the chemical reaction happening…

Q: Balance the following equation H2S+CI>HCI+S

A: Balanced equation: When the number of the same kind of element on the reactant side is equal to the…

Q: For the following reaction, 6.94 grams of sulfuric acid are mixed with excess zinc hydroxide. The…

A: Theoretical yield :- The maximum amount of product that can be obtained when reactants are consumed…

Q: Balance the equation ____AIBr3+____K—->KBr+____AI

A: The given reaction is, AlBr3 + K ---> KBr + Al

Q: Balance the chemical equation: C4H8 + O2 → CO2 + H2O There is a blank for all coefficients -…

Q: Balance chemical equation: H2(g)+ P4(s)---PH3(g)

Q: balance the equation H2SO(aq)+Pb(OH)4(s) -> Pb(SO4)2(s)+H2O(I)

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: CH4 + 2O2 à 2H2O + CO2 Blank 1 - 1 Blank 2 -2 Blank 3 -2 Blank 4 -1

Q: For the following reaction, 3.68 grams of carbon dioxide are mixed with excess potassium hydroxide.…

A: The amount of the product we should get which is calculated from the reaction equation is known as…

Q: Balance the following: NH3 + Cl2 --> N2 + NH4Cl Mg2SO3 + S8 --> Mg2S2O3

Q: Balance these chemical equations. (Use the lowest possible whole number coefficients.) (a) S8 +…

A: Since you have posted question with multiple sub-parts, we are entitled to answer the first 3 only.…

Q: balance the chemical equation: Cu2CO3(OH)2 + H2O+ HCO2H → CO2+ H2O+ Cu(CHO2)2 * 4H20

A: Balanced chemical equation of a reaction is written according to law of conservation of mass.…

Q: The balanced equation for the reaction of nitrogen and fluorine gas to form nitrogen trifluoride is…

A: Nitrogen reacts with fluorine to form nitrogen trifluoride. The balanced chemical reaction is as…

Q: When it is properly balanced, what are the coefficients of the following chemical equation? Al + HCI…

A: Any chemical reaction is said to be balanced if no of each atom on reactant and product side is…

Q: Writing and Balancing Chemical Equations 1.C12H22O11 (s) + O2 (g) --> CO2 (g) + H2O (

A: A chemical equation is a textual statement that describes the changes that occur in chemical…

Q: Balance the equation below by typing in the correct coefficients 02 (g) C3H8 (g) H2O (g) CO2 (8) +

A: Answer :- Here I have explained complete solution :--- So Firstly , to balance these equations, list…

Q: For the following reaction, 3.91 grams of sulfuric acid are mixed with excess barium hydroxide. The…

Q: For the following reaction, 6.53 grams of calcium hydroxide are mixed with excess sulfuric acid. The…

A: Given,

Q: For the following reaction, 6.75 grams of barium hydroxide are mixed with excess hydrochloric acid.…

Q: For the following reaction, 6.37 grams of phosphoric acid are mixed with excess potassium hydroxide.…

A: Given :- potassium hydroxide + phosphoric acid → potassium phosphate + water mass of phosphoric…

Q: Balance the chemical equation. MnO2 + K2CO3 + KNO3→K,MnO4 + KNO, + CO2 Assume the coefficient of CO,…

A: Solution Writing balanced chemical equations is crucial for class. Here ar samples of balanced…

Q: Balance each equation. _Ba(NO3)2 +_ H2S →_ BaS +_ HNO3 _CH4 + _O2 → _CO2 +_ H2O _C4H10 +_O2 →_ CO2…

A: “Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: For the following reaction, 4.13 grams of hydrochloric acid are mixed with excess calcium hydroxide.…

A: Given reaction: calcium hydroxide (aq) + hydrochloric acid (aq) → calcium chloride (aq) + water (l)…

Q: Balance the following equation ____ H2SO4 + ____ NaOH ===> ____ Na2SO4 + ____ H2O

A: When we are balancing any chemical equation the number of each atom should same in reactant as well…

Q: Balance the following chemical equation: B2Br6+B2Br6+HNO3→HNO3→B(NO3)3+B(N

A: Balanced the given equation--

Q: balance the following equation CH3Cl + O2 = CO2 + H2O + Cl2

A: The balance chemical reaction for the following equation = ? CH3Cl + O2 ----> CO2 + H2O + Cl2

Q: Fill in the coefficients (include a 1 where appropriate or a single space) to balance this chemical…

A: 2Cu2O --> 4Cu+ + 1 O2

Q: How many grams of chlorine gas react when 266.28 grams of aluminum reacts?

Q: KI

A: Dear student I have given answer to your question in the image format.

Q: Balance the equation: C8H18 + O2 -> CO2 + H2O

A: To find: The balanced equation for the given reaction

Q: Balance chemical equations Lazls Tio Ti Oz La Ti Oz La Fe O. LaOg Feg Ou

A: As oxygen is a gaseous substance, so it can easily escape in the atmosphere and leaves the…

Question

Balance the chemical equation Fe2O3 + ____Al = Al2O3 + _____Fe

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

Balance the following equations: a. Li3N(s)Li(s)+N2(g) b. Cu2O(s)+O2(g)CuO(s) c. Zn(s)+HNO3(aq)Zn(NO3)2(aq)+H2(g) d. K2SO4(aq)+BaCl2(aq)BaSO4(s)+KCl(aq) e. dinitrogenmonoxidenitrogen+oxygen f. dinitrogenpentoxidenitrogendioxide+oxygen g. P4O10(s)+H2O(l)H4P2O7(aq) h. CaCO3(s)+HCl(aq)CaCl2(aq)+H2O(l)+CO2(g)
Balance the following equations. a Sn + NaOH Na2SnO2 + H2 b Al + Fe3O4 Al2O3 + Fe c CH3OH + O2 CO2 + H2O d P4O111 + H2O H3PO4 e PCl5 + H2O H3PO4 + HCl
4.36 Sometimes students in chemistry labs determine percentage yields greater than 100%. Assuming there is no calculation error, how could this happen?
The sugar sucrose, which is present in many fruits and vegetables, reacts in the presence of certain yeast enzymes to produce ethanol and carbon dioxide gas. Balance the following equation for this reaction of sucrose. C12H22O11(aq) + H2O(l) C2H5OH(aq) + CO2(g)
You have a chemical in a sealed glass container filled with air. The setup is sitting on a balance as shown below. The chemical is ignited by means of a magnifying glass focusing sunlight on the reactant. After the chemical has completely burned, which of the following is true? Explain your answer. a. The balance will read less than 250.0 g. b. The balance will read 250.0 g. c. The balance will read greater than 250.0 g. d. Cannot be determined without knowing the identity of the chemical.
Balance the following chemical equations. a. H2S + O2 SO2 + H2O b. Ni + HCl NiCl2 + H2 c. IBr + NH3 NH4Br + NI3 d. C2H6 + O2 CO2 + H2O
Calculate the percentage composition for each of the following compounds (three significant figures). a NO2 b H2N2 c KClO4 d Mg(NO3)2
4.6 Use the web to research prices of gasoline at the pump for consumers in your area during the past year. Also find information about the price of crude oil for the same period. Discuss any correlations you observe between the two prices.
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.