Answered: Calculate the enthalpy of the following…

Calculate the enthalpy of the following reaction using the data in the table. 2A +2B + 5C 4D + 4E sOU/mol/K) AHF°(kJ/mol) A -33.22 177.31 B -88.23 137.60 C 59.52 96.15 D 34.96 3.70 E 91.71 108.69

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter6: Thermochemistry

Section: Chapter Questions

Problem 128CWP: Calculate H for the reaction N2H4(l)+O2(g)N2(g)+2H2O(l) given the following data: Equation H(KJ)...

See similar textbooks

Related questions

Q: Calcium hydroxide, which reacts with carbon dioxide to form calcium carbonate, was used by the…

A: Given, moles of CaCO3 formed = 3.8 mol

Q: Given the standard enthalpy changes for the following two reactions (1) 4C(s) + 5H2(g)–C,H10(g) AH°…

A: If the given reaction is multiplied by 2 by two, then value of the given standard enthalpy change…

Q: Determine the standard enthalpy of formation (AH°t) for NO2(g) given the information from the…

Q: A scientist measures the standard enthalpy change for the following reaction to be -1142.2 kJ:…

A: Standard enthalpy of formation of H2S (g) = -20.1 kJ/molStandard enthalpy of formation of O2 (g) = 0…

Q: 14. A 222.5 mg sample of sucrose (C12H22O11) is combusted in a bomb calorimeter. The temperature of…

Q: Calculate the enthalpy of the reaction 2NO(g) + O2(g)→2NO2(g) given the following reactions and…

A: According to Hess law if a chemical equation can be written as sum of two or more chemical…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Standard Enthalpy change for chemical reaction can be calculate by using the standard heat of…

Q: Using the provided table, determine the enthalpy for the reaction: C₃H₈(g) + 5O₂(g) → 3CO₂(g) +…

A: Given information, ΔH0 C3H8 = −108.4 kJ/mol ΔH0 O2 = 0 kJ/mol ΔH0 CO2 = −393.5 kJ/mol ΔH0…

Q: 2. (a) The industrial process for the production of sulphuric acid has three steps. S (s) + O2 (g)…

Q: Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step,…

A: Let us consider; N2(g)+3H2(g)→2NH3(g) ; ∆H1=-92kJ…

Q: Carbon disulfide is a colorless liquid. When pure, it is nearly odorless, but the commercial product…

Q: Consider the following reaction: CH4 (9) + 20, (9) → CO2 (g) + 2H, O(1) AH=-891 kJ a. Calculate the…

A: We have enthalpy of combustion of methane as -891 KJ. a) we have to calculate the enthalpy change…

Q: 8. Determine the enthalpy for the following reaction, given AH (NH3(g)) =-46.1 kJ/mol, AH, (NO(g)) =…

Q: A scientist measures the standard enthalpy change for the following reaction to be -132.2 kJ :…

A: Given chemical reaction is 4HCl(g) + O2(g) ---> 2H2O(g) + 2 Cl2(g) Standard Enthalpy change of…

Q: 3. The production of steel from iron involves the removal of many impurities in the iron ore. The…

A: All elements in their standard states (oxygen gas, solid carbon in the form of graphite, etc.) have…

Q: Using the standard enthalpies of formation, what is the standard enthalpy of reaction? CO(g) +…

Q: Given the thermochemical equations below, calculate the standard enthalpy change for the following…

A: EXPLANATION: Standard enthalpy change is defined as the change in enthalpy of compound when there is…

Q: If 20.0 g of CH4 reacts with excess oxygen, what is the change in enthalpy for the reaction?…

A: The reaction considered is the combustion of methane and it is exothermic.

Q: ing the decay of organic matter, which contains sulfur. The gas burns in oxygen as follows: 2H,S(g)…

A: Hess's law states that the amount of heat evolved or absorbed in a process is independent of the…

Q: Calculate the change of enthalpy for the reaction CH4 (g) + NH3 (g) - -> HCN (g) +3H2 (g) from the…

A: Given reactions N2 (g) + 3H2(g) -----------> 2NH3(g) ∆H=-91.8kJ/mol. _____(1) C(s,graphite)…

Q: enthalpy change for the following reaction to be -826.6 kJ : Fe2O3(s) + 2 Al(s)Al2O3(s) + 2 Fe(s)…

A: Heat of reaction is defined as difference of energy of product and energy of Reactant. If heat of…

Q: I. Give the thermochemical data below, find the change in enthalpy for the following reactions: NO…

A: ∆H of a reaction is the amount of heat released in the reaction.

Q: Image attached

A: Consider the desired equation is as follows: 2NO2g→N2O4g Consider the given reactions as follows:…

Q: Determine the enthalpy change for the following reaction when 10.9 g of NH3 is formed. N2 (g) + 3…

Q: The standard molar enthalpy of formation of diborane, B2H6(g), cannot be determined directly because…

A: (a).

Q: For the chemical reaction H2 (g) + F2 (g) →2 HF (g) AH° = -79.2 kJ/mol. What is the enthalpy for the…

A: The enthalpy of a reaction is dependant on the stoichiometric coefficients of reactants and products…

Q: For the chemical reaction H2 (g) + F2 (g) → 2 HF (g) AH° = -79.2 kJ/mol. What is the enthalpy for…

A: Heat of formation, also called standard heat of formation, enthalpy of formation, or standard…

Q: Nitric oxide (NO) can be formed from nitrogen, hydrogen and oxygen in two steps. In the first step,…

A: The total change in enthalpy for the solution is the sum of all changes regardless of the distinct…

Q: Given the following reactions 2NO → N₂ + O₂ AH = -180 kJ 2NO+ 0₂ → 2NO2 AH = -112 kJ the enthalpy of…

Q: References Use the References to access important values if needed for this question. Given the…

A: From the given data of Reaction 1 & 2 we calculate the enthalpy change for Reaction 3 i.e for…

Q: Using standard heats of formation, calculate the standard enthalpy change for the following…

A: Given; Note: for standard enthalpy of formation, values are taken from the standard books.

Q: Hydrazine, N2 H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the…

Q: Carbon disulfide is a colorless liquid. When pure, it is nearly odorless, but the commercial product…

Q: Determine the enthalpy for this reaction: Express your answer in kilojoules per mole to one decimal…

Q: 12. The standard enthalpy of formation, ΔHfº, for which of the following is zero? a) F2(g) c)…

A: The difference in the standard enthalpies of formation of products and reactants gives the value of…

Q: Using the provided table, determine the enthalpy for the reaction 2 NH3 (g) + 3 N½O (g)→ 4 N2 (g) +…

A: A balanced equation of formation of Nitrogen from NH3 and N2O.

Q: A scientist measures the standard enthalpy change for this reaction to be 2863.2 kJ/mol. 6CO2(g) + 6…

A: We’ll answer the first question since the exact one wasn’t specified. Please submit a new question…

Q: Ethanol, a common ingredient in many cosmetics and beauty products has a chemical formula of…

A: The complete balanced equation involved in combustion of ethanol= CH3CH2OH +3 O2 → 2CO2 +3 H2O Now,…

Q: Ba(OH)2 8H20(s) + 2NH4NO3(aq) → calorimeter containing 200.0 mL of 0.01 M NH4NO3, changing the…

A: 1.) To calculate the Enthalpy change of reaction , formula used is : ∆Hrxn = - q / n where , q =…

Q: Hydrazine, N3H4, is a colorless liquid used as a rocket fuel. What is the enthalpy change for the…

A: ΔH is an extensive property....

Q: Nitric acid can be formed in two steps from the atmospheric gases nitrogen and oxygen, plus hydrogen…

A: Given data is as follows: N2(g) + 3H2(g) → 2NH3(g) ∆H1=-92 kJ…

Q: A scientist measures the standard enthalpy change for the following reaction to be -901.8 k) :…

A: Given, the standard enthalpy change for this reaction = -901.8 kJ We have to calculate the standard…

Q: Using the equations 2 Fe (s) + 3 CI, (g) → 2 FeCl, (s) AH° = -800.0 kJ/mol Si(s) + 2 CI, (g) → SICI,…

A: The value of ∆H of a thermochemical equation changes with the changes made in chemical equation If…

Q: The standard molar enthalpy of formation of diborane, B₂H₁ (g), cannot be determined directly…

Q: A chemist measures the enthalpy change AH during the following reaction: 2 Al(OH)3(5)→Al,O3(s) + 3…

A: It is amount of enrgy released (or) absorbed during chemical reaction symbol : ∆Hrxn If energy…

Q: Consider the reaction for the formation of aluminum oxide from aluminum and oxygen. 4 Al(s) + 30,(g)…

Q: Using the standard formation enthalpies that follow, calculate the standard enthalpy change for this…

A: Enthalpy of formation is equal to the release in energy when one mole of compound is formed from its…

Q: Calculate the standard enthalpy change for the reaction 2A +B= 2C+2D where the heats of formation…

A: In the given question we have to calculate the standard enthalpy change of the following Reaction…

Q: Using the equations Si(s) + 2 Cl2 (g)→ SICI4 (s) AH° = -640.1 kJ/mol 2 Fe (s) + 3 Cl2 (g) → 2 FeCl3…

A: Enthalpy of the reaction is a state function. It does not depend on the path of reaction but only on…

Q: Using the information provided along with an understanding of Hess's Law, determine the enthalpy of…

A: Given- 4Fe+3Sn->2Fe2O3+3Sn. ∆H=? 2Fe+1/2O2->Fe2O3. ∆H=-824.2kJ…

Concept explainers

Crystal Structures

Solids are present all around us. They have different properties and applications. Diamond and graphite are two well-known solids. Diamond is the hardest material in the world and is used in making jewelry. Graphite on the other hand is soft. The lead of your pencil is graphite. Why are they so different in appearance and properties despite the fact they are chemically the same? Both are allotropes of carbon. The answer lies in the structure, the way constituent particles are arranged in the solids.

Question

Calculate the enthalpy of the following reaction using the data in the table.
2A +2B + 5C 4D + 4E
sOU/mol/K)
AHF°(kJ/mol)
A -33.22
177.31
B -88.23
137.60
C 59.52
96.15
D 34.96
3.70
E 91.71
108.69

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step 3

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

The following reactions can be used to prepare samples of metals. Determine the enthalpy change under standard state conditions for each. (a) 2Ag2O(s)4Ag(s)+O2(g) (b) SnO(s)+CO(g)Sn(s)+CO2(g) (c) Cr2O3(s)+3H2(g)2Cr(s)+3H2O(l) (d) 2Al(s)+Fe2O3(s)Al2O(s)+2Fe(s)
Calculate H for the reaction N2H4(l)+O2(g)N2(g)+2H2O(l) given the following data: Equation H(KJ) 2NH3(g)+3N2O(g)4N2(g)+3H2O(l) 1010 N2O(g)+3H2(g)N2H4(l)+H2O(l) 317 2NH3(g)+12O2(g)N2H4(l)+H2O(l) 143 H2(g)+12O2(g)H2O(l) 286
At 298 K, the standard enthalpies of formation for C2H2(g) and C6H6(l) are 227 kJ/mol and 49 kJ/mol, respectively. a. Calculate H for C6H6(l)3C2H2(g) b. Both acetylene (C2H2) and benzene (C6H6) can be used as fuels. Which compound would liberate more energy per gram when combusted in air?
Coal is used as a fuel in some electric-generating plants. Coal is a complex material, but for simplicity we may consider it to be a form of carbon. The energy that can be derived from a fuel is sometimes compared with the enthalpy of the combustion reaction: C(s)+O2(g)CO2(g) Calculate the standard enthalpy change for this reaction at 25C. Actually, only a fraction of the heat from this reaction is available to produce electric energy. In electric generating plants, this reaction is used to generate heat for a steam engine, which turns the generator. Basically the steam engine is a type of heat engine in which steam enters the engine at high temperature (Th), work is done, and the steam then exits at a lower temperature (Tl). The maximum fraction, f, of heat available to produce useful energy depends on the difference between these temperatures (expressed in kelvins), f = (Th Tl)/Th. What is the maximum heat energy available for useful work from the combustion of 1.00 mol of C(s) to CO2(g)? (Assume the value of H calculated at 25C for the heat obtained in the generator.) It is possible to consider more efficient ways to obtain useful energy from a fuel. For example, methane can be burned in a fuel cell to generate electricity directly. The maximum useful energy obtained in these cases is the maximum work, which equals the free-energy change. Calculate the standard free-energy change for the combustion of 1.00 mol of C(s) to CO2(g). Compare this value with the maximum obtained with the heat engine described here.
The enthalpy of combustion of solid carbon to form carbon dioxide is 393.7 KJ/mol carbon, and the enthalpy of combustion of carbon monoxide to form carbon dioxide is 283.3 KJ/mol CO. Use these data to calculate H for the reaction 2C(s)+O2(g)2CO(g)
The enthalpy changes for the following reactions can be measured: CH4(g) + 2 O2(g) CO2(g) + 2 H2O(g) rH = 802.4 kJ/mol-rxn CH3OH(g) + 32 O2(g) CO2(g) + 2 H2O(g) rH = 676 kJ/mol-rxn (a) Use these values and Hesss law to determine the enthalpy change for the reaction CH4(g) + O2(g) CH3OH(g) (b) Draw an energy level diagram that shows the relationship between the energy quantities involved in this problem.
Shown below is a diagram depicting the enthalpy change of a chemical reaction run at constant pressure. a Is the reaction exothermic or endothermic? b What is the sign of H? c What is the sign of q? d If the reaction does no work, what is the sign of E for this process?
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
Explain why absolute enthalpies and energies cannot be measured, and only changes can be determined.
Using the data in Appendix G, calculate the standard enthalpy change for each of the following reactions: (a) Si(s)+2F2(g)SiF4(g) (b) 2C(s)+2H2(g)+O2(g)CH3CO2H(l) (c) CH4(g)+N2(g)HCN(g)+NH3(g) ; (d) CS2(g)+3Cl2(g)CCl4(g)+S2Cl2(g)
When 1.000 g of gaseous butane, C4H10, is burned at 25C and 1.00 atm pressure, H2O(l) and CO2(g) are formed with the evolution of 49.50 kJ of heat. a Calculate the molar enthalpy of formation of butane. (Use enthalpy of formation data for H2O and CO2.) b Gf of butane is 17.2 kJ/mol. What is G for the combustion of 1 mol butane? c From a and b, calculate S for the combustion of 1 mol butane.
9.42 Why is enthalpy generally more useful than internal energy in the thermodynamics of real world systems?