CH3 CH CH3 CH3

Q: What is the IUPAC name of the following compound? Ме. "Ме Ме O A.…

A: 1. Given that : We have to give the IUPAC name for the following compound :

Q: Give the IUPAC name for each ketone. C-CHCH,CH3 b. a.

A: A molecule or compound has many names. Different naming systems exist in the world. Among these…

Q: Give the IUPAC name and a common name for the following ether  CH3-CH2-O-CH2-CH2-CH3 CH3-O-CH3

A: Ether- Alkoxy derivatives of an alkane called as ether Ether has functional group is (R-O-R’) group.…

Q: (d) CH3CHCH,OCH,CH3

A: The IUPAC is a system that contains some rule that helps in the naming of the organic compounds. The…

Q: Give both the IUPAC name and the common name for each alcohol. (CH3)2CHCH2CH2OH

A: Given, (CH3)2CHCH2CH2OH

Q: a) CH3-C (CH3)2- CH = CH2 b) -Br

A: Iupac name following compounds depend longest possible carbon chain.

Q: GIVE IUPAC NAMES FOR THE FOLLOWING STRUCTURES: (a) (b) CHO (c) H-C-OH CH2OH CH3

A: Since you have posted a question with multiple sub-parts, we will solve first three parts for you.…

Q: What is the IUPAC name of the ether that has the structure shown? -O-CH3

A: We have to predict the iupac nomenclature of given structure.

Q: 1. Name each compound according to the IUPAC system. a) CH,CH,CHCH,CH,CH, CH, b) CH,CHCH,CH,CHCH,CH,…

A: Note: As per our guidelines, we are supposed to do only three subparts when question with multiple…

Q: Provide the IUPAC and common name for the ether shown here:

A: The IUPAC name of the ether is given as alkoxyalkane where alkoxy group represents the oxygen atom…

Q: 11. CH;CHCH3 CH2-CH2-OH What is the IUPAC name for the above? O 1-hydroxy-3-methylbutane O…

A: IUPAC nomenclature is used for naming the organic compounds as recommended by international union of…

Q: Give the IUPAC name for each compound. CH3 a. CH,CHCH-C CHO b. CH3 H CH2CH3

A: The IUPAC name of the compound has to be provided.

Q: Assign an IUPAC name to each of the following compounds. a. CHy-C-O-C-CH,-CH, b. CH3-CH-CH-CH-C-CI…

A: "Since, you have posted multiple questions , we will solve only 1st question for you. To get the…

Q: The IUPAC name of the compound H- is (a) 5-formylhex-2-en-3-one (b) 5-methyl-4-oxohex-2-en-5-al (c)…

A:

Q: Name the IUPAC name or common name for the following ether: CH3-CH2-O-CH2-CH2-CH3

A: The compound given can be expanded as

Q: Give the IUPAC name for each alcohol HỌ CH3 (CH),CHCH,CHCH,CH3 CH̟CH,CH,OH CH,CHCH,CH,CH3 b. а. Но.…

A: Note: According to our guidelines we are supposed to answer only one question.  Kindly repost other…

Q: Write the IUPAC name for the compound shown. CH3 H;C CH3

A: Given compound: We have to write the IUPAC name of this compound.

Q: What alkenes are formed when each alcohol is treated with H 2SO 4? Use the Zaitsev rule to predict…

A: The dehydration of alcohol results in the formation of alkene in the presence of H2SO4. The Zaitsev…

Q: Give the IUPAC name for each compound. CH3 CH2CH3 Br a. PHCH(CH3)2 b. С. d.

A: Since you have posted multiple sub-parts, the answer for first three sub-parts are given below.…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

A: Given chemical formula, (a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3

Q: Provide IUPAC names for each structure below H. CH3 H H.

A: The IUPAC (International Union of Pure and Applied Chemistry) nomenclature is used to names the…

Q: What is the IUPAC name for the following compound? cyclohexyl ethyl ether ethyl cyclohexyl ether…

A:

Q: What is the IUPAC name for the following compound? CH CH-CH=CH-CHCH-CH-CH

A:

Q: What is the IUPAC name of the following compound? a. (R)-1-chloro-3-methyl-2-cyclohexene b.…

A: ANS. Option C. (R)-3-chloro-1-methylcyclohexene

Q: CI-CH2-O-CH3 O.

A: The IUPAC full form is International Union of Pure and Applied Chemistry. The IUPAC is used to name…

Q: 2. Lycopene is a bright red carotenoid hydrocarbon found in tomatoes and other red fruits and…

A: Answer  Carotenoids are plant pigment responsible for bright red…

Q: Give the IUPAC name for each of the following compounds: 1. Br a) (CH3);C-COOH b) CH;-ĊH-CH,-COOH…

A: a) b)

Q: Provide the correct IUPAC name for the compound shown here. f HO 3- 4- 5- 7- sec- tert- iso 6- 2- di…

A:

Q: Write the IUPAC name and any common name for each of the following ethers: a. CH;-CH,-CH2-0-CH,-CH3…

A: These compounds are ethers. They are named by the IUPAC or common systems. The IUPAC name is…

Q: H;C. CH3 What is the systematic IUPAC name of this compound? H;C Select one: a.…

A: Find the IUPAC nomenclature

Q: Give the IUPAC name for each of the following compounds: 1. Br a) (CH3);C-COOH b) CH,-СH-CH,-соОН…

A:

Q: What is the correct IUPAC name of the following compound? g O 3-ethoxy-1-isopropoxycyclohexane O…

A: In this question we have to tell name of the given compound.

Q: 4. What is the IUPAC name of the following compound? CH3-CH-CEC-CH2-CH-CH3 CH3-CH2 CH2-CH3 (a)…

A: The given compound is an alkyne. The IUPAC name of alkynes end with a suffix "-yne".

Q: What is the IUPAC name for the compound shown? CH3 НзС- -CH-CH2- CH2-CH3 -CH2—CHз ČH3 CH2—CНз IUPAC…

A: The systematic naming of organic compound is given by IUPAC. The naming of organic compound is done…

Q: CH3-CH-CH,-CH2-CH2-CH2 2. The correct IUPAC name for ОН ÓH is hexyl dialcohol 2,6-dihydroxyhexane a)…

A:

Q: 12.2 Give the IUPAC name for each of the following: a. OH b. CH, CH,-CH; -CH-CH;-OH c. OH d.

A: "Since you have asked multiple Questions with multiple subparts, therefore I am solving one for you.…

Q: Give the IUPAC name and any common name for each of the following: ОН CH3 Cl а. b. с. Cl CH3 CH3 Br…

A:

Q: Draw structures for the four constitutional isomers of molecular formula C4H10O that contain an OH…

A: Double Bond Equivalent (DBE) = (C+1)-H/2 = (4+1)-10/2 = 5-5 = 0.  So, it is an aliphatic alcohol.…

Q: он он 8. a 9. 10. ÓCH,CH,CH, 11.

A:

Q: Categorize each alcohol below as primary, secondary or tertiary OH H3C CH3 CH3 HO.

A:

Q: What is the IUPAC name of the following compound? Br CH3 CH3-CH2-CH-CH-CH2-0-CH-CH3 Br O A.…

A: The IUPAC name for the following question is-

Q: Question attached

A: Note: Since you have posted a question with multiple subparts, we will solve the first three…

Q: H H C H .H H H C -C H H C H-C H I H O: == H

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: What is the IUPAC name for the compound shown? CH3 H3C- -C- CH CH2- CH2-CH3 CH3 ČH2-CH3 IUPAC name:

A:

Q: 1. Give the IUPAC names for the following alcohols. (а) ОН OH (Ь) ОН (с) НО CH3CHCH2CHCHCH3…

A: Rules for IUPAC nomenclature:  1) select the longest carbon chain as parent chain. 2) identify the…

Q: What is the IUPAC name of the ether that thas the structure shown?

A: The given molecule is represented as follows:

Q: The IUPAC Name for the following Compound is CH3 H;C H2 H2 H3C-C -C-C-C -C-C-C-CH3 H2 H2 H H2 H2…

A: Rule of IUPAC- 1) Longest chain as parent chain. 2) Numbering start from those side where more prior…

Q: Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH

A: (a) Given chemical formula, CH3CH(OH)(CH2)4CH(OH)C(CH3)3 IUPAC name of the given diol is…

Q: Assign the IUPAC name to the following ether CH;CH–0 CH,

A: We have to give the IUPAC name of the given compound. The given compound is an ether. Now, the…

Q: Give the IUPAC name for each of the following compounds. (a) CH3 CH3 C O- Na+ H2 H2 (b) H3C-C H2 H2…

A: