chlorine(g) + sodium iodide(s) sodium chloride(s) + lodine(s) What is the formula for the limiting reagent? What is the maximum amount of sodium chloride that can be produced? moles For the following reaction, 83.3 grams of barium chloride are allowed to react with 73.7 grams of potassium sulfate barium chloride ( aq) + potassiunlfate ( aq) - barium sulfate (s) + potassium chloride ( aq) What is the maximum amount of barium sulfate that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams Retry Eintire Group more group attempts remaining Submit Anewer

chlorine(g) + sodium iodide(s) sodium chloride(s) + lodine(s) What is the formula for the limiting reagent? What is the maximum amount of sodium chloride that can be produced? moles For the following reaction, 83.3 grams of barium chloride are allowed to react with 73.7 grams of potassium sulfate barium chloride ( aq) + potassiunlfate ( aq) - barium sulfate (s) + potassium chloride ( aq) What is the maximum amount of barium sulfate that can be formed? grams What is the FORMULA for the limiting reagent? What amount of the excess reagent remains after the reaction is complete? grams Retry Eintire Group more group attempts remaining Submit Anewer

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 50A

See similar textbooks

Similar questions

In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
When solutions of silver nitrate and sodium carbonate are mixed, solid silver carbonate is formed and sodium nitrate remains in solution. If a solution containing 12.43 g sodium carbonate is mixed with a solution containing 8.37 g silver nitrate, calculate the mass of each of the four substances present after the reaction is complete.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?
Write an equation from the following description: reactants are gaseous NH3 and O2, products are gaseous NO2 and liquid H2O, and the stoichiometric coefficients are 4, 7, 4, and 6, respectively.
Small quantities of oxygen gas can be generated in the laboratory by the decomposition of hydrogen peroxide. The unbalanced equation for the reaction is H2O2(uz/)-? H2O(/) + O2(g) Calculate the mass of oxygen produced when 10.00 g of hydrogen peroxide decomposes.
For this reaction, fill in the table with the indicated quantities for the balanced equation. 4 NH3(g) + 5 O2(g) → 4 NO(g) + 6 H2O(g)
Urea is used as a fertilizer because it can react with water to release ammonia, which provides nitrogen to plants. (NH2)2CO(s) + H2O() 2 NH3(aq) + CO2(g) (a) When 300. g urea and 100. g water are combined, calculate the mass of ammonia and the mass of carbon dioxide that form. (b) Calculate the mass of the excess reactant that remains after reaction.
Ammonia can be formed by a direct reaction of nitrogen and hydrogen. N2(g) + 3 H2(g) 2 NH3(g) A tiny portion of the starting mixture is represented by the diagram, where the blue circles represent N and the white circles represent H. Which of these represents the product mixture? For the reaction of the given sample, which of these statements is true? (a) N2 is the limiting reactant. (b) H2 is the limiting reactant. (c) NH, is the limiting reactant. (d) No reactant is limiting: they are present in the correct stoichiometric ratio.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
4.111 Aluminum metal reacts with sulfuric acid to form hydrogen gas and aluminum sulfate (a) Write a balanced chemical equation for this reaction. (b) Suppose that a 0.792-g sample of aluminum that contains impurities is reacted with excess sulfuric acid and 0.0813 g of H2 is collected. Assuming that none of the impurities reacts with sulfuric acid to produce hydrogen, what is the percentage of aluminum in the sample?
Many cereals are made with high moisture content so that the cereal can be formed into various shapes before it is dried. A cereal product containing 58% H2O by mass is produced at the rate of 1000. kg/h. What mass of water must be evaporated per hour if the final product contains only 20.% water?