Consider a galvanic cell constructed from the following half-cells at 298 K. Half-cell 1: Graphite electrode in a solution that is 0.0010 M Mn04¯, 0.20 M Mn²+, with pH = 2.00 Mn04 (aq) + 8H*(aq) + 5e¯ → Mn²*(aq) + 4H2O(1) E° = 1.51 V Half-cell 2: Copper electrode in 0.50 M Cu²+ Cu2*(aq) + 2e¯ → Cu(s) E° = 0.34 V a. Fill in the diagram. Label the electrode charges, current flow, anion flow, and cation flow. KNO3 salt bridge ANODE HALF-CELL CATHODE HALF-CELL b. Write the line notation for the cell. c. Write the balanced cell reaction and the equilibrium constant (K) for the cell reaction. d. Calculate the cell potential (E) and AG.

Consider a galvanic cell constructed from the following half-cells at 298 K. Half-cell 1: Graphite electrode in a solution that is 0.0010 M Mn04¯, 0.20 M Mn²+, with pH = 2.00 Mn04 (aq) + 8H(aq) + 5e¯ → Mn²(aq) + 4H2O(1) E° = 1.51 V Half-cell 2: Copper electrode in 0.50 M Cu²+ Cu2*(aq) + 2e¯ → Cu(s) E° = 0.34 V a. Fill in the diagram. Label the electrode charges, current flow, anion flow, and cation flow. KNO3 salt bridge ANODE HALF-CELL CATHODE HALF-CELL b. Write the line notation for the cell. c. Write the balanced cell reaction and the equilibrium constant (K) for the cell reaction. d. Calculate the cell potential (E) and AG.

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 76AP

See similar textbooks

Similar questions

The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for solid Ba(IO3)2 is 1.5 109. Use the standard reduction potential of Ba2+(aq) to find the standard potential for the half-reaction Ba(IO3)2(s)+2eBa(s)+2IO3(aq)
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Consider the following galvanic cell: A 15 0-mole sample of NH is added to the Ag compartment (assume 1.00 L of total solution after the addition). The silver ion reacts with ammonia to form complex ions as shown: Ag+(aq)+NH3(aq)AgNH3+(aq)K1=2.1103AgNH3+(aq)+NH3(aq)Ag(NH3)2+(aq)K2=8.2103 Calculate the cell potential after the addition of 15.0 moles of NH3.