Consider the following reactions. Are they spontaneous in the direction written, under standard conditions at 25°C? Standard electrode potentials in aqueous solution at 25°C are:Standard Electrode (Reduction) Potentials in Aqueous Solution at 25°CCathode (Reduction)StandardHalf-ReactionPotential, E (V)Cu²+ (ag) +e Cu* (aq)0.16Fe+ (ag) + e Fe2+ (ag)0.77O2 (9) + 4H (ag) + 4e - 2H20(1)1.23MnO4 (ag) + 8H* (aq) + 5e = Mn?+ (ag) + 4H2 0(1) 1.49a. Cu?+ (ag) + Fe?+ (ag) → Cu* (aq) + Fe+ (ag)O spontaneousO nonspontaneousb. 4MNO4 (ag) + 12H* (ag) → 4Mn?+ (ag) + 502(9) + 6H2O(1)O spontaneousOnonspontaneous

Answered: Image /qna-images/answer/4d25d0be-b8e3-4533-8cb9-59e75ee2e177.jpg

Consider the following reactions. Are they spontaneous in the direction written, under standard conditions at 25°C? Standard electrode potentials in aqueous solution at 25°C ar Standard Electrode (Reduction) Potentials in Aqueous Solution at 25°C Standard Cathode (Reduction) Half-Reaction Potential, E (V) Cu+ (aq) +e Cu* (aq) 0.16 Fe+ (aq) + e Fe?+ (aq) 0.77 O2 (9) + 4H (ag) + 4e 2H20(1) MnO, (ag) + 8H (aq) + 5e - Mn2+ (ag) + 4H2O(1) 1.49 1.23 a. Cu?+ (ag) + Fe2+ (ag) → Cu* (aq) + Fe+ (ag) spontaneous O nonspontaneous b. 4MNO, (ag) + 12H+ (ag) → 4MN²+ (aq) + 502 (9) + 6H2O(1) O spontaneous Ononspontaneous

Consider the following reactions. Are they spontaneous in the direction written, under standard conditions at 25°C? Standard electrode potentials in aqueous solution at 25°C ar Standard Electrode (Reduction) Potentials in Aqueous Solution at 25°C Standard Cathode (Reduction) Half-Reaction Potential, E (V) Cu+ (aq) +e Cu* (aq) 0.16 Fe+ (aq) + e Fe?+ (aq) 0.77 O2 (9) + 4H (ag) + 4e 2H20(1) MnO, (ag) + 8H (aq) + 5e - Mn2+ (ag) + 4H2O(1) 1.49 1.23 a. Cu?+ (ag) + Fe2+ (ag) → Cu* (aq) + Fe+ (ag) spontaneous O nonspontaneous b. 4MNO, (ag) + 12H+ (ag) → 4MN²+ (aq) + 502 (9) + 6H2O(1) O spontaneous Ononspontaneous

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 59P

See similar textbooks

Similar questions

For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
a Calculate G for the following cell reaction: Tl(s)Tl+(aq)Pb2+(aq)Pb(s) The Gf for Tl+(aq) is 32.4 kJ/mol. b From G, calculate the standard cell potential for the cell reaction and from this, determine the standard potential for Tl2+(aq)+eTl(s).
The standard potential of the cell reaction Ag+(aq)+Eu2+(aq)Ag(s)+Eu3+(aq) is E = +1.23 V. Use the tabulated standard potential of the silver half-reaction to find the standard reduction potential for the europium half-reaction.
Calculate the electrode potentials of the following half-cells. (a) Ag+(0.0436 M)|Ag (b) Fe3+ (5.34 10-4M),Fe2+ (0.090 M)|Pt (c) AgBr(sat’d),Br- (0.037 M)|Ag