Cryolite, Na, AlF,(s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al, 0,(s) + NaOH(1) + HF(g) Na, AIF, + H,O(g) If 13.4 kg of AL,0,(s), 56.4 kg of NaOH(1), and 56.4 kg of HF(g) react completely, how many kilograms of cryolite will be produced? mass of cryolite produced: kg Na, AIF, Which reactants will be in excess? O HF

Cryolite, Na, AlF,(s), an ore used in the production of aluminum, can be synthesized using aluminum oxide. Balance the equation for the synthesis of cryolite. equation: Al, 0,(s) + NaOH(1) + HF(g) Na, AIF, + H,O(g) If 13.4 kg of AL,0,(s), 56.4 kg of NaOH(1), and 56.4 kg of HF(g) react completely, how many kilograms of cryolite will be produced? mass of cryolite produced: kg Na, AIF, Which reactants will be in excess? O HF

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter4: Stoichiometry

Section: Chapter Questions

Problem 4.87PAE

See similar textbooks

Similar questions

Nitric acid is produced commercially by the Ostwald process, represented by the following equations: 4NH3(g)+5O24NO(g)+6H2O(g)2NO(g)+O2(g)2NO2(g)3NO2(g)+H2O(l)2HNO3(aq)+NO(g) What mass of NH3 must be used to produce 1.0 106 kg HNO3 by the Ostwald process? Assume 100% yield in each reaction, and assume that the NO produced in the third step is not recycled.
Phosphoric acid, H3PO4, can be prepared by the reaction of phosphorus(V) oxide, P4O10, with water. 14P4O10(s)+32H2O(l)H3PO4(aq);H=96.2kJ What is H for the reaction involving 1 mol of P4O10? P4O10(s)+6H2O(l)4H3PO4(aq)
Write a balanced equation for (a) the combustion (reaction with oxygen gas) of glucose, C6H12O6, to give carbon dioxide and water. (b) the reaction between xenon tetrafluoride gas and water to give xenon, oxygen, and hydrogen fluoride gases. (c) the reaction between aluminum and iron(III) oxide to give aluminum oxide and iron. (d) the formation of ammonia gas from its elements. (e) the reaction between sodium chloride, sulfur dioxide gas, steam, and oxygen to give sodium sulfate and hydrogen chloride gas.
(a) Butane gas, C4H10, can burn completely in air [use O2(g) as the other reactant] to give carbon dioxide gas and water vapor. Write a balanced equation for this combustion reaction. (b) Write a balanced chemical equation for the complete combustion of C3H7BO3, a gasoline additive. The products of combustion are CO2(g), H2O(g), and B2O3(s).
The balanced equation for the reduction of iron ore to the metal using CO is Fe2O3(s) + 3 CO(g) 2 Fe(s) + 3 CO2(g) (a) What is the maximum mass of iron, in grams, that can be obtained from 454 g (1.00 lb) of iron(III) oxide? (b) What mass of CO is required to react with 454 g cot Fe2O3?
4.22 Generally, an excess of O2 is needed for the reaction Sn+O2SnO2 . What is the minimum number of moles of oxygen required to oxidize 7.3 moles of tin?
4.28 One of the steps in the manufacture of nitric acid is the oxidation of ammonia shown in this equation: 4NH3(g)+5O2(g)4NO(g)+6H2O(g) If 43.0 kg of NH3 reacts with 35.4 kg of O2, what mass of NO forms?
One of the ways to remove nitrogen monoxide gas, a serious source of air pollution, from smokestack emissions is by reaction with ammonia gas, NH3. The products of the reaction, N2 and H2O, are not toxic. Write the balanced equation for this reaction. Assign an oxidation number to each element in the reactants and products, and indicate which element is oxidized and which is reduced.
What is the mass of fish, in kilograms, that one would have to consume to obtain a fatal dose of mercury, if the fish contains 30 parts per million of mercury by weight? (Assume that all the mercury from the fish ends up as mercury (II) chloride in the body and that a fatal dose is 0.20 g of HgCl2.) How many pounds of fish is this?