Examine the following half-reactions and select the strongest reducing agent among thespecies listed.Pbl2(s) + 2eCa2*(aq) + 2ePt2+(aq) + 2ePb(s) + 2 1(aq)E°red = -0.365 VCa(s)E°red = -2.868 V>Pt(s)E°red = 1.18 VBr2(1) + 2e2 Br (aq)E°red = 1.066 VBr (aq)Br2()Ca2+(aq)Pt2*(aq)Pt(s)Pb(s)Ca(s)Pbl2(s)

The addition of electrons or decreases in the oxidation state is known as a reduction reaction and…

Examine the following half-reactions and select the strongest reducing agent among the species listed. E° red -0.365 V Pbl2(s) + 2e –→ Pb(s) + 2 1'(aq) Ca2*(aq) + 2e¯ Pt2+(aq) + 2e %D Ca(s) E°red = -2.868 V Pt(s) E° red 1.18 V Br2(1) + 2e → 2 Br (aq) E°red = 1.066 V Br (aq) Br2(1) Ca2*(aq) Pt2*(aq) Pt(s) Pb(s) Ca(s) Pbl2(s)

Examine the following half-reactions and select the strongest reducing agent among the species listed. E° red -0.365 V Pbl2(s) + 2e –→ Pb(s) + 2 1'(aq) Ca2(aq) + 2e¯ Pt2+(aq) + 2e %D Ca(s) E°red = -2.868 V Pt(s) E° red 1.18 V Br2(1) + 2e → 2 Br (aq) E°red = 1.066 V Br (aq) Br2(1) Ca2(aq) Pt2*(aq) Pt(s) Pb(s) Ca(s) Pbl2(s)

Principles of Modern Chemistry

8th Edition

ISBN:9781305079113

Author:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Publisher:David W. Oxtoby, H. Pat Gillis, Laurie J. Butler

Chapter17: Electrochemistry

Section: Chapter Questions

Problem 105CP

See similar textbooks

Similar questions

Consider only the species (at standard conditions) Na+, Cl, Ag+, Ag, Zn2+, Zn, Pb in answering the following questions. Give reasons for your answers. (Use data from Table 17-1.) a. Which is the strongest oxidizing agent? b. Which is the strongest reducing agent? c. Which species can be oxidized by SO42 (aq) in acid? d. Which species can be reduced by Al(s)?
A solution contains the ions H+, Ag+, Pb2+, and Ba2+, each at a concentration of 1.0 M. (a) Which of these ions would be reduced first at the cathode during an electrolysis? (b) After the first ion has been completely removed by electrolysis, which is the second ion to be reduced? (c) Which, if any, of these ions cannot be reduced by the electrolysis of the aqueous solution?
The half-cells Ag+(aq. 1.0 M)|Ag(s) and H+(aq, ? M)|H2(1.0 bar) are linked by a salt bridge to create a voltaic cell. With the silver electrode as the cathode, a value of 0.902 V is recorded tor kcell at 298 K. Determine the concentration of H+ and the pH of the solution.
At 298 K, the solubility product constant for Pb(IO3)2 is 2.6 1013, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction Pb(IO3)2(s)+2ePb(s)+2IO3(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions, and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/Pb(IO3)2 electrode in a 3.5 103 M solution of NaIO3.
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mn(s)+Ni2+(aq)Mn2+(aq)+Ni(s) (b) 3Cu2+(aq)+2Al(s)2Al3+(aq)+3Cu(s) (c) Na(s)+LiNO3(aq)NaNO3(aq)+Li(s) (d) Ca(NO3)2(aq)+Ba(s)Ba(NO3)2(aq)+Ca(s)
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
Consider a voltaic cell in which the following reaction occurs. Zn(s)+Sn2+(aq)Zn2+(aq)+Sn(s) (a) Calculate E° for the cell. (b) When the cell operates, what happens to the concentration of Zn2+? The concentration of Sn2+? (c) When the cell voltage drops to zero, what is the ratio of the concentration of Zn2+ to that of Sn2+? (d) If the concentration of both cations is 1.0 M originally, what are the concentrations when the voltage drops to zero?
An electrolysis experiment is performed to determine the value of the Faraday constant (number of coulombs per mole of electrons). In this experiment, 28.8 g of gold is plated out from a AuCN solution by running an electrolytic cell for two hours with a current of 2.00 A. What is the experimental value obtained for the Faraday Constant?
A half-cell that consists of a copper wire in a 1.00 M Cu(NO3)2 solution is connected by a salt bridge to a solution that is 1.00 M in both Pu3+ and Pu4+, and contains an inert metal electrode. The voltage of the cell is 0.642 V, with the copper as the negative electrode. (a) Write the half-reactions and the overall equation for the spontaneous chemical reaction. (b) Use the standard potential of the copper half-reaction, with the voltage of the cell, to calculate the standard reduction potential for the plutonium half-reaction.
At 298 K, the solubility product constant for PbC2O4 is 8.5 1010, and the standard reduction potential of the Pb2+(aq) to Pb(s) is 0.126 V. (a) Find the standard potential of the half-reaction PbC2O4(s)+2ePb(s)+C2O42(aq) (Hint: The desired half-reaction is the sum of the equations for the solubility product and the reduction of Pb2+. Find G for these two reactions and add them to find G for their sum. Convert the G to the potential of the desired half-reaction.) (b) Calculate the potential of the Pb/PbC2O4 electrode in a 0.025 M solution of Na2C2O4.
Given this reaction, its standard potential, and the standard half-cell potential of 0.34 V for the Cu2+ |Cu half-cell, calculate E° for the Fe(s)|Fe2+(aq) half-cell.
The Nernst equation allows determination of the cell potential for a galvanic cell at nonstandard conditions. Write out the Nernst equation. What are nonstandard conditions? What do , n, and Q stand for in the Nernst equation? What does the Nernst equation reduce to when a redox reaction is at equilibrium? What are the signs of G and when K 1? When K 1? When K = 1? Explain the following statement: determines spontaneity, while determines the equilibrium position. Under what conditions can you use to predict spontaneity?