For any of the following that can exist as isomers, state the type of isomerism and draw the structures:(a) [PtCl2Br2]2-               (b) [Cr(NH3)5(NO2)]2+            (c) [Pt(NH3)4I2]2+

Q: K3[Al(C2O4)3]*3H2O is colorless?

A: The given compounds are coordination compounds. Coordination compounds are those compounds which on…

Q: Two Fe (II) complexes are both low spin but have different ligands. A solution of the other is red.…

A: The stronger the field, the greater the separation (in energy) between the split levels.  Electrons…

Q: Which ordering correctly describes the tendency of a ligand to direct ligand substitution in a…

A: Trans effect can be defined as the effect of a ligand towards substitution on other ligands which is…

Q: Consider an octahedral complex MA3B3. How many geometric isomers are possible? Will any of the…

A: There are two geometrical isomer of the octahedral complex for MA3B3.

Q: A four coordinate complex MA2B2 is prepared and found to have two different isomers possible to…

A: Four coordinate complex MA2B2:In this complex, there are two types of ligands A and B with number…

Q: Consider an octahedral complex MA3B3. How many geometric isomers are expected for this compound?…

A: Isomerism-molecules with same molecular formula but different structural formula called as isomers…

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: A metal possesses two types of valencies -  primary and secondary. The combining power of a metal…

Q: A complex with the composition [MA₂B₂]X₂ is found to have no geometrical isomers. Both A and B are…

A: Suitably substituted square planar and octahedral complexes can show the cis-trans isomerism.…

Q: 4) The complex [Cr(OH2)3BrClI] has 4 possible isomers. Draw each of them.

A: In this question, we will draw the structure of all Four possible isomers.  You can see details…

Q: explain why heavier lanthanides form more stable complexes than lighter ones

A:

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: A complex, ML62+, is violet. The same metal forms a complex with another ligand, Q, that creates a…

A: Given: The complex given is  This complex is violet. The metal gets attached to the weak field…

Q: 2. Ferrocyanide and ferricyanide are a particular kind of transition metal complex. State what that…

A:

Q: Consider the compound (C8H8)Ru(CO)3 which is likely to be the best description of the C8H8 ligand ?

A: The stability of any organometallic compound is given by Effective Atomic Number (EAN Rule).…

Q: Mention and draw  the types of structural isomerism present in metal complexes and indicate to…

A: Answers are explained below.

Q: Draw the crystal-field energy-level diagrams and showthe placement of d electrons for each of the…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: How many unpaired electrons are there in a high-spin octahedral Fe2+ complex? A diagram will likely…

A: Octahedral Fe2+ complex:

Q: Give the formula of each coordination compound. Include square brackets around the coordination…

A: Coordination compounds can be named by using different IUPAC rules ,for metal atoms as well as…

Q: In the coordination compound (NH4)2[Fe(OH2)F;], the e is octahedrally coordinated. (a) Based on the…

A: a) The given compound is (NH4)2[Fe(OH2)F5] or [Fe(OH2)F5]2-. The oxidation state of Fe is +3 and it…

Q: When a hexadentate ligand, An-, binds to a metal ion that has a coordination number higher than 6,…

A:

Q: A four-coordinate complex MA2B2 is prepared and found tohave two different isomers. Is it possible…

A:

Q: Sketch the structure of the complex in each of the follow- ing compounds and give the full compound…

A: a) The Cis-[Co(NH3)4(H2O)2](NO3)2 complex is cis isomer that means the same ligands come on the same…

Q: Both H2O and ethylenediamine (en) have two nonbonding pairs of electrons. Why can en act as a…

A:

Q: a. Classify the isomer below and give the name of the isomers. [Cr(CO)6][CoCl6] and [Co(CO6)][CrCl6]…

A: The detailed solution of your question given below-- Since, we know that the concept of isomers in…

Q: i. State TWO (2) characteristics of a o-donor ligand. By using one example, explain how to change a…

A: A sigma-donor ligand is a ligand that acts as a Lewis base donating electrons from a lone pair to…

Q: Would you expect the complex [Cu(NH3)4(H2O)2]2+ to have isomers? If yes, what isomers would exist?

A: Yes there will be isomers of the complex [Cu(NH3)4(H2O)2]2+  this is because the H2O ligands can be…

Q: Which of the following ligands is an example of an ambidentate ligand? nitrite, NO₂ chloride, Cl…

A: A coordination compound is formed by a complex ion and a simple oppositely charged ion. In a complex…

Q: b) For each of the following pairs, identify the molecule that is more likely to act as a ligand in…

A: b)      We have pair of ions or molecules in both parts , we have to predict one which can act as…

Q: Explain the hybrid type and geometric structure of the K3 [Cr (C204) 3] .3H2O complex with VBT.

A: oxidation number of Cr is +3  in this compound .

Q: Give two examples of ligands which form coordination compounds useful in analytical chemistry.

A: The ligand is a molecule that has lone pair of electrons or negatively charged ions. In complex…

Q: There

A: We will identify same molecule and isomer of 1 molecule

Q: Sketch the structures of the following complexes. Indicate any cis, trans, and optical isomers.(a)…

A:

Q: Aqueous solutions of one of the following complexes of Cr(III) absorb yellow ; the other absorbs…

A: Given compounds, Cr(H2O)63+  and  Cr(NH3)63+

Q: When cobalt (II) chloride is treated, under certain conditions, with the bidentate ligand,…

A: i) Let the oxidation state of Co be x, the bidentate ligand, NH2CH2CH2NH2, is a neutral species so…

Q: Mention the types of structural isomerism present in metal complexes and indicate to which of them…

A: Coordination isomerism is a form structural isomerism in which the composition of coordination…

Q: y8gngu. Amino acids can act as ligands toward transition metal ions. The simplest amino acid is…

A: Ligands are the electron donating neutral or anionic group that donates the atleast one electron…

Q: Using IUPAC norms write the formulae for the following coordination compounds: (i)…

A: i) Metal name ends with -ate. That means, the complex is anionic. In the given coordination compound…

Q: Explain the bonding in coordination compounds in terms of Werner's nostulate

A:

Q: 4. *The three complexes [Co(NH3)6]3*, [Co(NH3)5(H20)]³*, and [CoF6]3- are colored red, yellow, and…

A: The question is based on the concept of coordination compounds. We have to assign different colours…

Q: What is required of Lewis bases to act as ligands in coordination compounds?

A: Lewis base is a species which can donate electron pair to a Lewis acid.

Q: The complex diamminedichloronickel(II), (Ni(NH3)2C12], is paramagnetic and does not have any…

A: When a metal linked with the ligands then it is known as coordination compound.

Q: When cobalt(II) chloride is treated, under certain condition, with the bidentate ligand,…

A: Coordination number: When the metal ion in a complex is directly bonded or attached to ligand donor…

Q: Which of the following is an optical isomer of the complex shown below? Br Co C NH3 NH3 H3N

A: Optical isomers are two compounds which contain the same number and kinds of atoms, and bonds (i.e.,…

Q: [NİCI2(PPH3)2] is paramagnetic while [PtCl2(PPH3)2] is diamagnetic, what are the possible structures…

A: Though Ni(II) and Pt (II) are both d8 system, Ni complex is tetrahedral, whereas Pt complex is…

Q: A, B, C, and D are four different ligands, draw all possible structures of geometric isomers for…

A: In square - planar complex- All the four ligand are different i.e A, B, C, and DThe complex is Pt…

Q: For the complex [Fe(en)2Cl2], Cl, (en = ethylene diamine), identify(i) the oxidation number of…

A: Organometallic compounds contains a bond between a metal and a carbon atom of an organic ligand.…

Q: One of the more famous species in coordination chemistry is the Creutz-Taube complex: 5+ (NH3);RuN…

A: (a). There is one metal ion in the complex i.e; Ru. It exhibits two different oxidation states: 1st…

Q: Which of the following ligands is bidentate?

A: Edta , diene and triene have more than 2 donor sites.

Coordination Chemistry

It is a part of chemistry, in which the study of compounds that have central atoms surrounded by molecules or ions, known as ligand, is known as coordination chemistry.