Sketch the structure of the complex in each of the follow- ing compounds and give the full compound name: (a) cis-[Co(NH3)4(H,O),](NO;)2 (b) Na,[Ru(H,O)Cl5] (c) trans-NH4[Co(C;04)2(H2O)z] (d) cis-[Ru(en);Cl2]

Q: The complex [Co(NH3)6]Cl3 is yellow orange while [Co(OH2)3F3] is blue. Suggest an explanation for…

A: The colour shown by the complexes are the complementary colours of the wavelength of light absorbed.…

Q: Draw the structures and give the stock names of complexes that can satisfy the conditon: 1.…

A: Ionization isomers in coordination complexes are identified by the ligands present outside the…

Q: Explain in words how potassium aluminum sulfate is formed via ligand exchange. Indicate clearly the…

A: A ligand exchange reaction is a reaction which involves the substitution of one or more ligands in a…

Q: What is the formula of the complex cation? + NH3 H3N 'CI NH3 trans-[Co(NH,),CI,] cis-[CoCI,(NH,),I…

A: Which of the given option is correct--

Q: Two Fe (II) complexes are both low spin but have different ligands. A solution of the other is red.…

A: The stronger the field, the greater the separation (in energy) between the split levels.  Electrons…

Q: Which ordering correctly describes the tendency of a ligand to direct ligand substitution in a…

A: Trans effect can be defined as the effect of a ligand towards substitution on other ligands which is…

Q: Draw the structures and give the stock names of complexes that can satisfy the following condition:…

A: Chiral compound is a molecule that has asymmetric center that is no plane or center of symmetry.…

Q: By plotting the structure of the dinitro tetraammin cobalt (III) chloride complex compound, specify…

A: Any compound that is written within square brackets is called a coordination compound. The ions…

Q: A complex is written as NiBr2 . 6 NH3. (a) What is the oxidationstate of the Ni atom in this…

A: (a) The given compound is [Ni(NH3)6]Br2 Oxidation number is the total number of electrons an atom…

Q: and eg t2g d. An analogous compound, [Cu(H₂O)6]2+ has a different arrangement of the Draw the…

A: Given that, a metal complex is [Cu(H2O)6]2+. We have to tell the different arrangement of the…

Q: (a) Draw all the possible isomers of [Fe(NH3);Br3] and for each isomer clearly indicate the…

A: a) There are two possible isomers of the given compound, fac and mer. These are shown as below:…

Q: CoCl3(H2N-CH2-CH2-NH2)2(H2O) corresponds to the empirical formula of two coordination compounds…

A: Coordination compounds are those in which a metal atom or ion forms coordinate bonds with the…

Q: Which of the following is used to examine the kinetic stability of a coordination compound? а.…

A: Since you have asked multiple question, we will solve the first question for you.If you want any…

Q: Explain the following giving an example in each case: (i) Linkage isomerism (ii) An outer orbital…

A:

Q: When a hexadentate ligand, An-, binds to a metal ion that has a coordination number higher than 6,…

A:

Q: When we consider the reaction of Fe3+ ion (SCN) with its ligand, by showing the ion-ligand bond in…

A: The reaction between Fe3+ and SCN- could be given as, Fe3+aq+SCN-aq→FeSCN2+ SCN- is a thiocyanate…

Q: What is the relationship between observed colour of the complex and the wavelength of light absorbed…

A: When light falls on a complex, certain part will get absorbed. If the crystal field splitting energy…

Q: When the K[PtCl3(C2H4)] complex obeys the 18 electron rule according to the electron pair donor…

A: The electron-pair donor method of counting the electrons is also known as the ionic method. The…

Q: For each of the following metals, write the electronic configurationof the atom and its 2+ ion: (a)…

A: Electronic Configuration is defined as the distribution of electrons of an atom or molecules in…

Q: 2. Red crystalline [NiCl,(PPh,CH,Ph)2] is diamagnetic. On heating to 387 K for 2 hours, a blue-…

A: In this complex, nickel is in +2 oxidation state and it has valence shell electronic configuration…

Q: Explain the terms diamagnetic and paramagnetic NiCl2(PPh3)2 is a green paramagnetic solid, while cis…

A: If a compound have unpaired electrons in its orbital, then the compound is known as paramagnetic in…

Q: The acetylacetone ion forms very stable complexes with many metallic ions. It acts as a bidentate…

A: Concept introduction: Ligands that can bind central metal ion from two sites are called bidentate…

Q: By taking into account the following complexes: A) [Co(en):]³* B)[CoCl3Br3]+ a) Give the oxidation…

A: In this question, we have to find out the correct answer of given problem by the help of the…

Q: Give 5 examples of metal coordination complexes and enumerate their importance

A: A question based on coordination complexes that is to be accomplished.

Q: For each of the following metals, write the electronic configurationof the atom and its 3+ ion: (a)…

A:

Q: Write the formula and the name of each complex ion- a complexion with Co3+ as the central ion and…

A: (1) a complexion with Co3+ as the central ion and three NH3 molecules and three CN-ions as ligands…

Q: With your knowledge in coordination chemistry, help these students label the solutions.

A: In contrast to non-transition metal ions, transition metal complex ions are usually colored because…

Q: Cis-diamminedichloroplatinum (II) or “cisplatin” is a square planar complex with the formula…

A: The structure of cis-platin and trans-platin is shown as follows: Among Geometrical Isomers,…

Q: nich is the crystal field energy level diagram for a square pyramidal ML5 complex that contains a…

A:

Q: Write the hybridization and shape of the following complexes: (i) [CO(NH3)6]3+ (ii) [NiCl4]2-…

A: Hybridization involves the mixing up of of atomic orbitals into new hybrid orbitals with different…

Q: Both H2O and ethylenediamine (en) have two nonbonding pairs of electrons. Whycan en act as a…

A: The number of donor atoms present in the ligand which can donate electrons to the central metal atom…

Q: In each the following generalized coordination complexes, M represents the central metal ion and L1,…

A: Two compounds that have the same molecular formula but the different structural representation of…

Q: 4. dibromotetracarbonyliron(I): 5. pentaamminechlorocobalt(III) chloride: 6.…

A: 4. [Fe(CO)4Br2]  5. [Co(NH3)5Cl]Cl2  6. [Cr(H2O)3ClBrI]

Q: 1. Draw two possible resonance structures for DMSO, where S is the central atom. What kind of bond…

A: 1. DMSO means dimethyl sulfoxide contains two S-Me and one S=O with one l.p. on S atom. It's…

Q: Give the systematic name of this coordination compound. [(en), ]Cl, systematic name:

A: Rules for naming complex compounds :-  In coordination sphere ligands are named fist in alphabetical…

Q: 3- The gap between the higher and lower energy levels is called the crystal-field splitting energy…

A: Strong field ligands cause a greater splitting of the d-orbitals of the central metal atom, than the…

Q: [NİCI2(PPH3)2] is paramagnetic while [PtCl2(PPH3)2] is diamagnetic, what are the possible structures…

A: Though Ni(II) and Pt (II) are both d8 system, Ni complex is tetrahedral, whereas Pt complex is…

Q: When Werner's student Edith Humphrey first synthesized the complex complex salts of formula…

A: This is an example of Linkage isomerism of -NO2 ligand.  When a particular ligand is binding to a…

Q: One of the more famous species in coordination chemistry is the Creutz-Taube complex: 5+ (NH3);RuN…

A: (a). There is one metal ion in the complex i.e; Ru. It exhibits two different oxidation states: 1st…

Q: What are the coordination numbers of cobalt(III), plat-inum(II), and platinum(IV) in complexes?

A: The coordination no. or ligancy of the central metal atom in a complex is defined as the total no.…