Answered: for the equilibrium…

Science

Chemistry

for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius calaculate Kc

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter14: Chemical Equilibrium

Section: Chapter Questions

Problem 14.3QE: Describe a nonchemical system that is not in equilibrium, and explain why equilibrium has not been...

See similar textbooks

Related questions

Q: onsider the equilibrium N2(g) + O2(g) + Br2(g) ⇌ 2 NOBr(g) Calculate the equilibrium constant Kp for…

Q: For which one of the following reactions does Kp equal Kc? A. 4 NH3(g) + 3 O2(g) ⇌ 2 N2(g) + 6…

A: Relation between Kp and Kc is given as: Kp = Kc*(RT)Δng where, Kp is equilibrium constant with…

Q: CH3OH(g)⇌CO(g)+2H2(g)CH3OH(g)⇌CO(g)+2H2(g) (Note that…

A: we need to calculate ΔG for the given reaction

Q: For the equilibrium 2 SO31g2 ∆ 2 SO21g2 + O21g2, Kc is 4.08 * 10-3 at 1000 K. Calculate the value…

A: Since the relationship between Kp and Kc is given by => Kp = Kc X (RT)Δn where R = gas constant…

Q: Calculate the equilibriumconstant, K, and ΔG° at 298 K for each of the followingreactions:(a) H2(g)…

A: The formula to calculate ΔG°f is shown below.

Q: Write the equilibriu heterogeneous equilibria. a. P4(s) + 6F2(g) = 4PF3(g) b. Xe(g) + 2F2(g)…

A: equilibrium constant

Q: What is ∆G for a reaction where ∆G° = -4.5 kJ/mol and Q = 4.0 at 295 K? (R = 8.314 J/mol ･ K)

A: The given problem can be solved by using the formula given below as; ∆G = ∆G° + 2.303 RT log Q…

Q: Determine Kp for the reaction 2 N2O(g) + 3 O2(g) ⇄ 2 N2O4(g) from the following information at 298…

A: For the calculation of equilibrium constant for the above given reaction can be determined by…

Q: Convert the values of Kc to values of KP or the values of KP to values of Kc.…

A: Given information, Kc=4.7×10−2 Temperature = 25∘C = 298 K

Q: Calculate Kc for the reaction Kp= 1.2 at 400 degrees C

Q: What is ∆G for a reaction where ∆G° = -4.5 kJ/mol and Q = 3.0 at 295 K? (R = 8.314 J/mol ･ K)

A: The spontaneity and feasibility of reaction can be predicted by the Gibb’s free energy of that…

Q: Determine Kcand Kp at 298 K for the reaction: NOBr(g) = ½ N2(g) + ½ O2(g) + ½ Br2(g) from the…

Q: Consider the equilibriumN2(g) + O2(g) + Br2(g) ⇌ 2 NOBr(g)Calculate the equilibrium constant Kp for…

A: To calculate the Kp formula used is: R is gas constant. T is the temperature. Kc and Kp is the…

Q: Consider the following generic system at equilibrium: 2M (g) + N (g) O (g) + P (g)…

Q: Fluorine, F2, dissociates into atoms on heating. 1/2 F2(g) F(g) The value of Kp at 741°C is 7.04 ✕…

A: The reaction given is 1/2 F2(g) --------> F(g) Kp = 7.04 X 10-2

Q: For which of the following equations would the value of Kp = Kc(RT)²? %3D A) A (s) +3B (g)=C (g) +…

A: Kp And Kc are the equilibrium constant of an ideal gaseous mixture. Kp is equilibrium constant used…

Q: 20. Calculate Kc for the following equilibria: CO(g) + Cl2g) 00 COC12«g); Kp = 3.9 x 10-2 at 1000 K.…

A: Kp = Kc (RT)∆n Where, ∆n = number of product molecules - number of reactant molecules

Q: What is K for a reaction if ∆G° =-232.9 kJ/mol at 25°C (or 298 K)? (R = 8.314 J/mol ･ K)

A: We know that ∆G° = - RT lnK

Q: he equilibrium constant Kc for the reaction fructose-1,6-diphosphate ⇋ glyceraldehyde-3-phosphate…

A: Given Reaction:- fructose-1,6-diphosphate⇋glyceraldehyde-3-phosphate + dihydroxyacetone phosphate

Q: At 1500 °C the equilibrium constant for the reaction CO(g) + 2H₂(g) CH₃OH(g) has the value Kp = 1.4…

A: Given reaction: CO(g) + 2H₂(g) ⇌ CH₃OH(g) Kp = 1.4 x 10⁻⁷ We have to calculate ΔG° for this…

Q: For the equilibrium 2 SO3(g) ⇌ 2 SO2(g) + O2(g),Kc is 4.08x 10-3 at 1000 K. Calculate the value for…

A: Since the relationship between Kp and Kc is given by => Kp = Kc X (RT)Δn where R = gas constant…

Q: 9. The Kp for the following reaction at 450 C is 6.50 x 107: A(g) + 4B(I) 3C(g) + 2D(g). Determine…

A: The relationship between Kp and Kc at temperature T can be given as Kp = Kc(RT)∆n where R is the…

Q: If Ke 0.042 for PCI3 (g) + Cl2 (g) = PCI5 (g) for at 500 K, what is the value of Kp for this…

A: PCl3 (g) + Cl2 (g) <--> PCl5 (g) Given that Kc = 0.042…

Q: Consider the following reactions for which Kp values at 300 ∘C are provided: Eqn. 1 CO(g) + 2…

A: Given, Eqn. 1 CO (g) + 2 H2S (g) ⇌ CS2 (g) + H2O (g) + H2 (g) Kp1 = 5.0×105 NOTE : Eqn. 2 is…

Q: For the equilibrium 2 SO3(g) <=> 2 SO2(g) + O2(g), Kc is 4.08 * 10-3 at 1000 K. Calculate the…

A: Relation between Kp and Kc- Kp = Kc(RT)∆n Where, Kp = equilibrium constant for partial pressure of…

Q: For the following reaction: SO2 (?) + 1/2 ?2 (?) ↔ ??3 (?) At 1000K, Kp has a value of 1.85.…

Q: the equilibrium concentration constant for the phase phase change, A(l) ⇄ A(g), at 60 °C. (PH2O,…

A: Given-> A(l) ----> A(g) T = 60°C = 60 +273 = 333 K pH2O(vap.) = 0.196 atm

Q: Choose an expression for the equilibrium constant (Kc) for the following chemical equation: 2K2O2…

Q: The equiliorim constant Kc is 10.5 @350 K. 2 CH2 Clz (g)a CHy(G)+ CCl4 ) Calculate equililarium Con…

A: The chemical reaction taking place is: 2CH2Cl2g ⇔ CH4g + CCl4g The given information is: Kc = 10.5…

Q: Consider the reaction below: 2 SO₃(g) ⇌ 2 SO₂(g) + O₂(g) The Kp is 1.81 × 10⁻⁵ at 350.0°C. Calculate…

A: Given Kp = 1.81 × 10-5 Temperature (T) = 350 ℃ = (350 + 273 )K…

Q: Given the following information A(I) + B(g) + C (g) - 3D(g) Kp = 5.20 x 10-10 at 298 Determine Kc at…

A: For reaction : A + B + C ----> 3 D Kp = 5.20 x 10-10

Q: What is ∆G for a reaction where ∆G° = -4.5 kJ/mol and Q = 2.5 at 295 K? (R = 8.314 J/mol ･ K)

A: According to thermodynamics equation, dG = dG° + RTlnQ On solving above equation we get,

Q: . 1 SO3(g) + 1 H2O(g)⇌ 1 H2SO4(g) Kp = 0.423 ΔH = +130 kJ a) Write the Kp expression (above is…

Q: 3) CO2 (g) → CO(g) + ½ O2 (g) AG° = 61380 cal H2O(g) O H2 (g) + ½ O2 (g) AG° = 54656 cal Calculate…

Q: At 400 degrees celsius, Kp = 64 for the following reaction: H2 (g) + I2 (g) 2 HI (g) What is the…

A: Using the relationship between Kp and Kc we get the answer

Q: Convert the values of Kc to values of KP or the values of KP to values of Kc.(a) Cl2(g) + Br2(g) ⇌…

A: Welcome to bartleby !

Q: Calculate Kp for the following reactions at the indicated temperature. (a) 2 H2S(g)2 H2(g) +…

A: The given equilibrium reaction is 2 H2S(g)2 H2(g) + S2(g) Kc = 3.17×10-9 at 792 K The…

Q: Give the expression for the Ksp for the following СаСОз(5) Ca+2 CO3-2 + Ksp =

A: Given :- CaCO3(s) <----> Ca+2 + CO32- To write :- Ksp expression for above reaction

Q: What is ∆G for a reaction where ∆G° = -4.5 kJ/mol and Q = 1.6 at 295 K? (R = 8.314 J/mol ･ K)

A: Given: Standard Gibbs free energy change, ∆G° = -4.5 kJ/mol Reaction quotient, Q = 1.6 Temperature,…

Q: Calculate ΔG∘rxnΔGrxn∘ at 298 KK for the following reaction:

A: Standard Gibbs free energy ( ∆G∘rxn ) and Equlibrium constant ( KP) relation is ∆Grxn∘ =- 2.303…

Q: At 1500°C the equilibrium constant for the reaction CO(g)…

A: To determine the standard gibbs free energy, we need an equation that would relate chemical…

Q: In the decomposition of carbon dioxide at 2000 degrees celsius, 2 CO2 (g) 2 CO (g) + O2 (g) Kp =…

A: Given, The chemical reaction - 2CO2(g) -----> 2CO(g) + O2(g) We know that, Kp = KcRT∆n ∆n =…

Q: Consider the following reactions and their associated equilibrium constants: K1 A+ 2B S C C= D+E K2…

A: Given A + 2B ⇌C ( K1) C ⇌D + E (K2) A + 2B ⇌ D +E Kc = ?

Q: Convert the values of Kc to values of KP or the values of KP to values of Kc.(a) N2(g) + 3H2(g) ⇌…

A: The answer for part (a) is given below. Kindly repost the other subparts as separate one. a) Given:…

Q: Calculate A,G° at 25 °C for the formation of 1.00 mol of C2H5 OH(g) from C2H4(g) and H20(g). Use…

Q: 8. Consider the following equilibrium: 2Cu(s) + O2(g) 2CUO(s) Kc = ? How would you calculate Kc…

Q: for the equilibrium 2SO3(g) 2SO2(g) + O2(g), Kc is 4.08×10-3 at 1000 K. Calculate the value for Kp.

A: Since the relationship between Kp and Kc is given by => Kp = Kc X (RT)Δn where R = gas constant…

Q: Consider the reaction below: 2 SO3(g) =2 SO2(g) + O2(g) The Kp is 1.81 x 10-5 at 350.0°C. Calculate…

Q: Calculate Kc at 303 K for SO21g2 + Cl21g2 ∆ SO2Cl21g2if Kp = 34.5 at this temperature

A: The relation between Kp and Kc is given by, Kp=Kc(RT)∆n where T is the temperature and ∆n is the…

Question

for the equilibrium PH3BCI3(s)=PH3(g)+BCI3(g) Kp=0.052 at 60degreesCelsius

calaculate Kc

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Structure and Dynamics of Macromolecules

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Fill in the blanks: (a) H° and G° become equal at K. (b) G° and G are equal when Q =. (c) S° for steam is than S° for water.
Which system in each pair best represents equilibrium species under standard conditions of temperature and pressure? You may have to apply some basic knowledge of chemistry. a Rb b Na crystal c HCl (aq) d C(diamond) or C(graphite)
Plants synthesize carbohydrates from CO2 and H2O by the process of photosynthesis. For example, 6CO2(g)+6H2O(l)C6H12O6(aq)+6O2(g) G=2.87103 kJ at pH 7.0 and 25°C. What is K for the reaction at 25°C?
Describe a nonchemical system that is not in equilibrium, and explain why equilibrium has not been achieved.
for the eqilibrium below2SO3(g) -> 2SO2(g) + O2(g) Kc= 4.08 X 10-3 at 1000kcalculate Kp
Calculate the equilibrium constant at 37oC for the reactionGlucose + 6O2 + 36ADP + 36Phospate → 6CO2+ 42H2O +36ATP ... ... ...Gibbs free energychange of Go= − 423 kcal/mole of Glucose
At 1500°C the equilibrium constant for the reaction CO(g) + 2H2(g)CH3OH(g) has the value Kp= 1.4 ´10–7. Calculate DG°(in kJ/mol) for this reaction at 1500°C.
Consider the following equilibrium: CO(g) + 3 H2(g)⇄CH4(g) + H2O(g). If Kp = 5.25 x 10-5 at 1468.0 K, calculate Kc.
Calculate the equilibrium constant at 37oC for the reactionGlucose + 6O2 + 36ADP + 36Phospate → 6CO2+ 42H2O +36ATP ... ... ...Entropy change of Go= − 423 kcal/mole of Glucose
Determine values of Kc from the values of Kp given a. 2NO(g) + O2(g) ⇌ 2NO2(g) Kp = 1.48 x 104 at 184K b. Sb2S3(s) + 3H2 ⇌ 2Sb(s) + 3H2S(g) Kp = 0.429 at 713K
For the following reaction, H2(g) + I2(g) ⇌ 2 HI(g), Kp = 44 at 25.0 o C. Calculate the value of Kc
For the reaction X(g)+3Y(g)⇌3Z(g) Kp = 1.95\times 10−2 at a temperature of 81 ∘C . Calculate the value of Kc .