Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). If 27.7 g of carbon dioxide is produced from the reaction of 27.7 g of ethane and 59.8 g of oxygen gas, calculate the percent yield of carbon dioxide. Round your answer to 3 significant figures.

Gaseous ethane (CH,CH,) reacts with gaseous oxygen gas (0,) to produce gaseous carbon dioxide (CO,) and gaseous water (H,0). If 27.7 g of carbon dioxide is produced from the reaction of 27.7 g of ethane and 59.8 g of oxygen gas, calculate the percent yield of carbon dioxide. Round your answer to 3 significant figures.

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 46A

See similar textbooks

Similar questions

For each of the following unbalanced chemical equations, suppose 25.0 g of each reactant is taken. Show by calculation which reactant is limiting. Calculate the theoretical yield in grams of the product in boldface. msp;C2H5OH(l)+O2(g)CO2(g)+H2O(l) msp;N2(g)+O2(g)NO(g) msp;NaClO2(aq)+Cl2(g)NaCl(aq) msp;H2(g)+N2(g)NH3(g)
For each of the following unbalanced chemical equations, suppose exactly 5.0 g of each reactant is taken. Determine which reactant is limiting, and calculate what mass of each product is expected, assuming that the limiting reactant is completely consumed. msp;Na(s)+Br2(l)NaBr(s) msp;Zn(s)+CuSO4(aq)ZnSO4(aq)+Cu(s) msp;NH4Cl(aq)+NaOH(aq)NH3(g)+H2O(l)+NaCl(aq) msp;Fe2O3(s)+CO(g)Fe(s)+CO2(g)
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Methanol has tremendous potential to be used as an alternate fuel. Carbon monoxide gas reacted with hydrogen gas can be used to produce methanol.A student reacted 49.7 g of H2(g) with excess CO(g) to produce methanol.If his percent yield was 47.7%, calculate the mass (in g) of CH3OH(l) that he collected in the experiment.Hint: Write a balanced chemical reaction equation.Do not show your work in the space provided.Record only your final answer with the correct number of significant digits and the proper units.
Liquid octane CH3CH26CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of water formed from the reaction of 18.3g of octane and 117.g of oxygen gas?Be sure your answer has the correct number of significant digits in it.
Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 28.1g of carbon dioxide is produced from the reaction of 21.0g of ethane and 51.0g of oxygen gas, calculate the percent yield of carbon dioxide. Be sure your answer has the correct number of significant digits in it.
Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. What is the theoretical yield of water formed from the reaction of 2.10g of ethane and 15.1g of oxygen gas? Be sure your answer has the correct number of significant digits in it. I keep getting this problem wrong because of the sig. digits, dont round till the end because if it is off by 0.1, it will be incorrect.
Iron(III) oxide is reacted with ammonia to produce solid iron, gaseous nitrogen, and water. 1 Fe2O3 (s) + 2 NH3 (g) --> 2 Fe (s) + 1 N2 (g) + 3 H2O (l) What would the yield (in grams) of solid iron be if one began with 9.8 g of iron(III) oxide and mixed it with 2.50 grams of ammonia? _ grams of Fe `round your answer to correct sig figs` The following molar masses may or may not be needed, but are provided to save you time: iron(III) oxide = 159.7 g/mol ammonia = 17.0 g/mol iron = 55.8 g/mol
Liquid octane CH3CH26CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of carbon dioxide formed from the reaction of 19.4g of octane and 37.4g of oxygen gas?Be sure your answer has the correct number of significant digits in it.
Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of carbon dioxide formed from the reaction of 5.11g of ethane and 24.9g of oxygen gas? Be sure your answer has the correct number of significant digits in it.
Liquid octane CH3CH26CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of carbon dioxide formed from the reaction of 10.3g of octane and 55.4g of oxygen gas? Be sure your answer has the correct number of significant digits in it.
Gaseous methane CH4 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . What is the theoretical yield of water formed from the reaction of 8.98g of methane and 46.9g of oxygen gas? Be sure th answer has FOUR significant digits in it.