6Give the common name for the compound CH3CH₂CH₂-O-CH₂CH3Multiple Choiceethane propane etheriethylpropyl etherpropyl ethyl etherdethyl etherdipropyl ether

To write the common name of the given compound, first, we need to identify the individual functional…

Answered: Give the common name for the compound…

Give the common name for the compound CH3CH₂CH₂-O-CH₂CH₂ Multiple Choice Oethane propane ether Oethylpropyl ether propyl ethyl ether dethyl ether dipropyl ether

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter12: Saturated Hydrocarbons

Section: Chapter Questions

Problem 12.147EP

See similar textbooks

Related questions

Q: An equilibrium mixture contains 0.350 mol of each of the products (carbon dioxide and hydrogen gas)…

Q: Determine the chemical formulas and the state of matter in which they'd be produced from the…

Q: Erwin Schrödinger Orbitals which result from solving the Schrödinger wave equation can be…

Q: 11. For the reaction sequence below, identify the expected major product(s). 1. МСРВА Г 2. H+ H2O Н…

Q: Gas Stoichiometry Scenario #3 What mass (in grams) of sodium chloride (NaCl) will be produced when…

A: The given unbalanced reaction is as follows: Na+Cl2 → NaCl The balanced equation is as follows:…

Q: What is the total number of moles of O₂ produced when 8 moles of H₂O decompose in this reaction? 2…

A: The given reaction is an example of decomposition reaction. In this reaction water molecule…

Q: Give only typing answer with explanation and conclusion draw the lewis structure with charge and the…

A: Bromine belongs to group 17 and has 7 valence electrons while Se blongs to group 16 having 6…

Q: A student mixes 67.0 mL of a 2.01 M sodium hydroxide solution with 22.8 mL of 6.45 M hydrochloric g…

Q: Using the molecular orbital model, write electron Configurations for the following diatomic species…

A: The molecular orbital theory represents the energy state and spatial distribution of the electrons…

Q: Compare the degree of crystallinity for the following sets of polymers and explain your answer. (i)…

A: Degree of crystallinity refers to the proportion of crystalline regions in a polymer material.…

Q: HOW DO WE GET THERE? Determine the molality of C3H8O3. MC3H8O3 = mol/kg

A: As we know, Depression in freezing point, ∆Tf is equal to ∆Tf = Tf° - Tf = i * Kf * m Where Tf°…

Q: The molar conductance (Amolar) for the following complex was found to be (261 S.cm².mol¹), How many…

A: The molar conductance ( Λmolar ) for the following complex was found to be (261 Scm2 mol-1 ). How…

Q: ● Questions 1. Most plastics are made using chemicals extracted from oil. Currently, only a small…

A: 1. Improved plastics recycling offers several benefits to the environment: a) Reduction in resource…

Q: Which is the weaker acid? Chloroethanoic acid (chloroacetic acid) Bromoethanoic acid (bromoacetic…

A: Increase in electronegativity of halogen increases the acidity

Q: give the IUPAC names of the alcohol which on undergoing dehydration yield each of the following…

A: A question based on reactions of alcohol. 3 different alkene product are given whose reactant…

Q: Which cyclohexyl bromides will not undergo facile, low activation energy E2 elimination upon…

A: E2 elimination is elimination reaction where the rate of the reaction depends on both the reactant…

Q: How does the coordination geometry of a metal center in a bioinorganic system affect its reactivity…

A: The coordination geometry of a metal center in a bioinorganic system plays a crucial role in…

Q: 7. A chemist analyzes a white, solid compound and finds that it does not dissolve in water. When the…

A: Based on the information provided, if the compound does not dissolve in water and does not conduct…

Q: How does the structural arrangement of metal centers influence the catalytic activity and…

A: The structural arrangement of metal centers plays a crucial role in determining the catalytic…

Q: Consider the unbalanced chemical reaction equation : Na2SO4 (aq) + BaCl2 (aq) ---> BaSO4 (s) +…

A: Given,The balcnced reaction:Na2SO4(aq) + BaCl2(aq)→BaSO4(s) + NaCl(aq)Molarity of BaCl2 =0.250…

Q: Calculate the freezing point of a solution containing 6.0% KCl by mass (in water).

A: Freezing point depression is the decrease of the freezing point of a solvent due to the addition of…

Q: Hd 5. The following questions refer to the titration curve of a solution of an unknown weak acid. Ve…

A: The question is based on the titrations. we are titrating a weak acid with a strong base. we need…

Q: Assign R and S configurations to the chirality centres of the compounds below: O₂N OH ||||| 15 C/ CI…

Q: Use the Nernst equation to calculate the cell potential, Ecell, for a galvanic cell consisting of…

A: Given, [Pb+2]= 0.0021 M and [Fe+2] = 0.11 M The half-cell reactions in the cell will be : At Anode…

Q: (i) Calculate the stoichiometric imbalance factor in a polymerization reaction between adipic acid…

A: The stoichiometric imbalance factor (SIF) can be calculated using the following formula: SIF =…

Q: 2. A sample of lithium goes through a temperature change of +56.36 K while absorbing 17776 joules of…

A: Amount of heat,Q required to increase the temperature of a substance of mass ,m and specific heat…

Q: Give the symbol for an element that is 1) a halogen. 2) an alkali metal. 3) a noble gas. 4) an…

A: -> In periodic table halogens are kept in VIIA group ( group no. 17) -> In periodic table…

Q: 3. Write the predominant structure of glycylglycine at (a) pH = 1.5 (the approximate pH of stomach…

A: The question is based on the concept of amino acids. we need to draw the structure of given…

Q: Suppose the galvanic cell sketched below is powered by the following reaction: Mn(s) + CuCl₂(aq)…

A: We have find out the solution.

Q: What region of the spectrum is represented here? if the concentration of the substance measured…

A: A question based on UV-visible spectrum. A spectrum is given based on which the follow-up question…

Q: X-ray radiation falls in the wavelength region of 1.00×10-11 to 1.00×10-8 meters. What is the…

A: Frequency = speed of light/wavelength Speed of light = 3 x 108 m/s

Q: 8. What scale is used to describe the strength of acids and bases? pri 9. Where are acids, bases,…

A: Acid : The substance which produces hydrogen ions (H+) in water after dissociation are called as…

Q: 6. Consider the following equilibria: 1: Ca²+ (aq) + 2OH- (aq) 2¹2 H₂O(1) H3O*(aq) + OH-(aq)___…

A: The expression that is given for aqueous or gaseous reactants or products in an equilibrium reaction…

Q: OH HBr room temp. Br Br B Ol Br "Bri

A: The substitution and elimination reactions depend on the nature of the bulk of the incoming…

Q: What is the electron configuration for Tellurium (Te)? A) 1s²2s²2p 3s²3p 4s²3d¹04p4 B) 1s²2s22p…

A: Given, The atom : Tellurium ( Te)

Q: The following skeletal oxidation-reduction reaction occurs under acidic conditions. Write the…

Q: chemistry

A: Diffusion constant is given by, D = x2 /2T , where x is the distance and T is the average time the…

Q: The vapour pressure of water at 25 °C is 20 mm Hg. What is the vapour pressure of a solution…

A: Since sucrose is a non-electrolyte, Van't Hoff factor, i = 1 Formula for relative lowering in vapor…

Q: Please predict the products for each of the following reactions. Clearly show the regiochemistry…

A: When methyl cyclohexene or 1-methylcyclohex-1-ene reacts with peracetic acid, it undergoes an…

Q: Question: Consider a hypothetical chemical reaction that involves the conversion of reactants A and…

A: An exothermic reaction releases heat energy to the surroundings, while an endothermic reaction…

Q: Two milliliters of 0.025molars potassium iodate solution was used to standardized the sodium…

A: To determine the corrected established relationship, we need to calculate the concentration of the…

Q: Determine the polarity of the following compounds.

A: Polar compound: A polar compound is usually formed when one end of the molecule possess positive…

Q: Please predict the products for each of the following reactions. Clearly show the regiochemistry…

A: Alkene reacts with BH3 and this reaction is known as hydroboration reaction. In this reaction one H…

Q: What is the order of increasing reactivity in nucleophilic addition of methanol (least to most…

A: Nucleophilic addition to carbonyl compounds depend on two factors: 1. Electronic factors: Higher…

Q: Which of the following compounds has the lowest dipole moment? Carbon tetrachloride Fluoroethane…

A: Two questions based on introduction to organic chemistry. One question is about dipole moment and…

Q: Please show the entire mechanism for this problem

A: LDA is Lithium Di-isopropylamide. It is a bulky base that deprotonates alpha hydrogen at a…

Q: Which is the strongest acid?

Q: 4.1 What stereochemistry would you expect of the alkene obtained by E2 elimination of…

A: E2 elimination is elimination reaction where the rate of the reaction depends on both the reactant…

Q: What is the osmotic pressure at 25 °C when 50 mL of a solution containing 4.25 g of electrolyte…

A: Given,Mass of CaCl2 = 4.25 gMolar mass of CaCl2 = 111 g/molVolume of solution = 50 mLTemperature =…

Q: Organic Chemistry HW: 2,6-dimethyloct-2-ene cannot be handwritten print the structural formula of…

A: 2,6-dimethyloct-2-ene We need to draw the structural formula of above molecule (expanded or…

Concept explainers

Sulfur Functional Groups

Many organic molecules contain sulfur functional groups and have their own importance in chemistry as well as biology. Some of the organic molecules which contain sulfur functional groups and the corresponding sulfur functionality is given below:

Question

6
Give the common name for the compound CH3CH₂CH₂-O-CH₂CH3
Multiple Choice
ethane propane etheri
ethylpropyl ether
propyl ethyl ether
dethyl ether
dipropyl ether

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Introduction

VIEW

Step 2: Explanation

VIEW

Solution

VIEW

Step by step

Solved in 3 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Give the IUPAC name and a common name for the following ether CH3-CH2-O-CH2-CH2-CH3 CH3-O-CH3
Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3
Draw the structure of a molecule that fi ts each description: a. a 2 ° alcohol of molecular formula C 6H 12O b. a cyclic ether with molecular formula C 5H 10O c. a 1 ° alkyl halide with molecular formula C 5H 11Cl
Give iupac name for this diol CH3CH(OH)(CH2)4CH(OH)C(CH3)3
Write the common name for the ether. CH3CHOCHCH3 I I CH3 CH3 methyl groups are attached to carbon 2 and 3
Give the IUPAC name of each of the following compounds. (a) CH3CH2CH2-----OH (b) CH3---CH2---C----H || O (c) CH3CH2CH2CH2---C--CH3 || O (d) CH3---CH2----CH2----C---OH || O
Give a systematic (IUPAC) name for each diol.(a) CH3CH(OH)(CH2)4CH(OH)C(CH3)3 (b) HO¬(CH2)8¬OH
Draw a condensed structure and a skeletal structure for each of the following:a. sec-butyl tert-butyl ether e. 5-(1-methylethyl)nonane i. 3-ethoxy-2-methylhexaneb. isoheptyl alcohol f. triethylamine j. 5-(1,2-dimethylpropyl)nonanec. sec-butylamine g. 4-(1,1-dimethylethyl)heptane k. 3,4-dimethyloctaned. isopentyl bromide h. 5,5-dibromo-2-methyloctane l. 5-isopentyldecane
In which solvent is cyclohexane most soluble? Water Diethyl ether Hexanol ethanol
1. What orbitals (around Carbon) are used to form each bond in the following molecules: A. CH3CH3 B. CH2CH2 2. Draw the structure corresponding to each IUPAC name: 3-ethyl-1,1-dimethylcyclohexane, 6-isopropyl-2,3-dimethylnonane
iupac name? Cyclohexane 2,2-dimethylbutane 1,2-dimethylcyclobutane 2-methyl-2-pentene Methylcyclopentane
A primary alcohol has a hydroxyl group bonded to a(n) a. aromatic carbon. b. trisubstituted carbon. c. disubstituted carbon. d. singly substituted or unsubstituted carbon.