Answered: Given the equation: 4NH3(g) + O2(g) →…

Given the equation: 4NH3(g) + O2(g) → 4NO(g) + 6H2O(g). What is the standard molar entropy change and the standard enthalpy change?

Chemistry: Principles and Reactions

8th Edition

ISBN:9781305079373

Author:William L. Masterton, Cecile N. Hurley

Publisher:William L. Masterton, Cecile N. Hurley

Chapter16: Spontaneity Of Reaction

Section: Chapter Questions

Problem 78QAP

See similar textbooks

Related questions

Q: ANSWER THE FOLLOWING QUESTIONS: 1. The relationship between entropy and temperature is introduced…

A: Since you have posted multiple questions ,as per guidelines we are subjected to solve one per…

Q: 1. The magnitude of any enthalpy change depends on the conditions of temperature, pressure and state…

A: Since you have posted a question with multiple sub-parts, we will solve first three subparts for…

Q: At temperature T0, substance X in its A form (A can be liquid, solid or vapor) has same chemical…

Q: Determine whether each of the following statements about the thermodynamic functions are True or…

A: The spontaneity of a chemical reaction not only depends on the enthalpy change but also depends on…

Q: Determine whether each of the following statements about the thermodynamic functions are True or…

A: Thermodynamic function called Gibbs free energy is used to determine absolutely spontaneity of a…

Q: Combustion of glucose (C,H,0.) is the main source of energy for animal cells: C,H1206(s) + 60,(8) –…

Q: 1. The magnitude of any enthalpy change depends on the conditions of temperature, pressure and state…

A: Entropy of a system is the measure of randomness. Higher disorder the system, higher is the entropy.

Q: Which of the following statements regarding the Law of Thermodynamics is false? The entropy of the…

A: Thermodynamics studies the relation between heat, work, temperature, and energy. The laws of…

Q: Determine the entropy difference between solid and liquid states for a substance melting at 100 °C…

Q: Does the entropy of a star increase or decrease as it radiates? Does the entropy of the space into…

Q: Calculate the change in entropy that occurs in the system when 54.0 g of acetone (C3H6O) vaporizes…

Q: Determine whether each of the following statements about the thermodynamic functions are True or…

A: The relationship between Gibbs free energy and Entropy and enthalpy is given by G = H - TS where G…

Q: What is the entropy when a system goes from 4 microstates to 5 microstates?

Q: For which of the following reactions will the entropy of the system decrease? CaCO3(s) → CaO(s) +…

Q: Define Standard States and Standard Entropy Changes?

A: Generally in chemistry standard state can be defined as the reference pint used to calculate its…

Q: How does the third law of thermodynamics allow absolute entropies of substances to be determined? A)…

A: The Third law of thermodynamics states that " a substance which is perfectly crystalline at…

Q: The following constant pressure process occurs spontaneously when the system, initially at a…

Q: In freezing a mole of liquid water at the freezing point; the enthalpy of fusion is 6.0lkJ/mol…

A: The enthalpy of fusion is 6.01 KJ/mol To determine : entropy of system , surrounding and universe

Q: Determine the entropy change for the combustion of gaseous propane, C3H8, under standard state…

A: Thermodynamics is the branch of chemistry which deals with the study of heat and other forms of…

Q: Why does the entropy of a gas increase when it expands into a vacuum?

A: Entropy of a system is the measure of the randomness or dis-ordered ness of the system. The entropy…

Q: What is the entropy change when 315 J of energy is reversibly transferred to a sample of water at…

A: Entropy change of a system for reversible process is given by where ΔS = entropy change Q = heat…

Q: Indicate whether each statement is true or false. The entropy change of the system is equal and…

Q: Determine the entropy change for the combustion of gaseous propane, C3Hg, under the standard…

Q: During a certain reversible process, the surroundings undergo an entropy change, ∆Ssurr = -78…

A: As per the thermodynamic concept, the entropy of universe is the sum of entropy of system and…

Q: Identify the change in phyical state that is a decrease in entropy. water boiling ice melting…

A: Entropy is the measurement of randomness of any substance, if randomness decreases entropy…

Q: How many microstates are present in a system with an entropy of zero?

A: The entropy (S) and microstates(W) are related by formula : S = kB ln(W) Here , kB = Boltzmann…

Q: For the oxidation of iron to form iron(III) oxide: 4Fe(s) + 3O2(g) ⟷⟷ 2Fe2O3(s)…

A: ΔSo = –549.73 J∙K–1 T = 298K ΔH = –824.2 kJ∙mol–1 = -824200 Jmol-1

Q: If energy can flow in and out of the system to maintain a constant temperature during the process,…

A: Given, If energy can flow in and out of the system to maintain a constant temperature during the…

Q: What is the entropy when a system goes from 4 microstates to 5 microstates? 3.08 x 10-24 O -3.08 x…

Q: Are the earth and sun in thermal equilibrium? Are there entropy changes associated with the…

A: 1. The earth and the Sun are not in the thermal equilibrium. As sun is much hotter or is having…

Q: It is the study of the heat or energy involved in physical and chemical changes. Thermodynamics…

Q: In which of the following processes does the entropy of the system decrease? Select one: H2(g) +…

A: > In a chemical reaction if gaseous moles increases than entropy increase. > for gases if…

Q: A goldfish swims in a large bowl of water at 20 °c . Over a period of time, the fish transfers 120 J…

A: The change in entropy of the water can be determined as follows, dS = dQ/T

Q: How do enthalpy and entropy relate to each other? If enthalpy is negative, does that mean that…

A: To measure spontaneity, both the terms, enthalpy and entropy, cannot be used individually that is…

Q: Consider the following reaction occurring at 25C Nitrogen monoxide gas reacts with hydrogen gas to…

A: "Since you have posted a question with multiple sub-parts, we will solve the first three subparts…

Q: In which case will a chemical reaction ALWAYS proceed spontaneously at all temperatures (DH and DS…

A: Feasibility of a reaction depends on the change in Gibbs free energy ∆G. The value of change in…

Q: Indicate whether each statement is true or false. If a system undergoes a reversible process, the…

A: Given: Reversible process is a process which can be reversed back to its initial state after…

Q: For each of the following reactions, indicate whether you would expect the entropy of the system to…

A: Entropy is the randomness in the system. Gases have more entropy than liquids. Similarly, liquids…

Q: How are the states of matter arranged in increasing entropy of the system? Solid < Gas <…

A: Entropy is the degree of randomness or disorder and gases have more disorder because particles can…

Q: Does the entropy of the system increase, decrease, or stay the same when the volume of a gas…

A: Entropy is the thermal energy of a system per unit of temperature. This energy is not available for…

Q: Considering perfect gases, which state function is zero when two substances are mixed?…

Q: Without doing any calculations or using Sf data, arrange each group in order of increasing entropy.…

A: Always a gaseous (vapor) substance of same material have highest entropy compare to its liquid and…

Q: In order to be a spontaneous reaction, what has to be true about Gibbs Free Energy?

A: Gibbs free energy of any reaction is defined as the maximum amount of reversible work that may be…

Q: Which of the following results in a decrease in the entropy of the system? Group of answer choices…

A: Since we know that Entropy depends upon on the number of moles of gas molecules on products side and…

Q: 1. The magnitude of any enthalpy change depends on the conditions of temperature, pressure and state…

A: Solutions-

Q: Calculate the standard molar entropy change for the conversion of nitrogen monoxide to nitrogen…

A: 2 NO + O2 ==> 2NO2

Q: Suppose some cells are assembling a certain protein made of 79 amino acids. Calculate the minimum…

A: The given reaction is,

Question

Physical Chemistry: Show complete solution.

Given the equation: 4NH₃(g) + O₂(g) → 4NO(g) + 6H₂O(g). What is the standard molar entropy change and the standard enthalpy change?

Branch of chemistry that studies how atoms, molecules, and materials interact with each other. Physical chemistry focuses on the behavior of matter, such as solids, liquids, and gases, as they interact with other matter. The study of physical chemistry is crucial to thermodynamics, quantum mechanics, and photochemistry.

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

Step 2

Step 3

Step 4

Step 5

Step by step

Solved in 5 steps with 5 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Define the term entropy, and give an example of a sample of matter that has zero entropy. What are the units of entropy? How do they differ from the units of enthalpy?
Use data from Appendix D to calculate the standardentropy change at 25°C for the reaction CH3COOH(g)+NH3(g)CH3NH2(g)+CO2(g)+H2(g) Suppose that 1.00 mol each of solid acetamide, CH3CONH2(s), and water, H2O(l), react to give thesame products. Will the standard entropy change belarger or smaller than that calculated for the reactionin part (a)?
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the explosive decomposition of TNT? Use your knowledge of TNT and the chemical equation, particularly the phases, to answer this question. (Thermodynamic data for TNT are not in Appendix G.) 2C7H5N3O6(s) 3N2(g) + 5H2O() + 7C(s) + 7CO(g)
What is the sign of the standard Gibbs free-energy change at low temperatures and at high temperatures for the combustion of acetaldehyde? CH3CHO(l)+52O2(g)2CO2+2H2O(l)
Explain why absolute entropies can be measured.
Determine the standard Gibbs free energy change, rG, for the reactions of liquid methanol, of CO(g), and ofethyne, C2H2(g), with oxygen gas to form gaseous carbondioxide and (if hydrogen is present) liquid water at298 K. Use your calculations to decide which of thesesubstances are kinetically stable and which are thermodynamically stable: CH3OH(), CO(g), C2H9(g), CO2(g),H2O().
For one day, keep a log of all the activities you undertake that consume Gibbs free energy. Distinguish betweenGibbs free energy provided by nutrient metabolism andthat provided by other energy resources.
Determine the entropy change for the combustion of liquid ethanol, C2H5OH, under the standard conditions to give gaseous carbon dioxide and liquid water.
Under what conditions is the entropy of a substance equal to zero?
The standard molar entropy of methanol vapor, CH3OH(g), is 239.8 J K1 mol-1. (a) Calculate the entropy change for the vaporization of 1 mol methanol (use data from Table 16.1 or Appendix J). (b) Calculate the enthalpy of vaporization of methanol, assuming that rS doesnt depend on temperature and taking the boiling point of methanol to be 64.6C.
The synthesis of glucose directly from CO2 and H2O and the synthesis of proteins directly from amino acids are both non-spontaneous processes under standard conditions. Yet it is necessary for these to occur for life to exist. In light of the second law of thermodynamics, how can life exist?