Use the data given below to find the enthalpy of reaction for the following reaction: CaCO3(s) → CaO(s) + CO2 (g) AH; (kJ/mol) СаСОз (s) -1207 CaO(s) -635.5 CO2 (g) -393.5 -2236 kJ -178 kJ O +178 kJ -1449 kJ O -2058 kJ

Use the data given below to find the enthalpy of reaction for the following reaction: CaCO3(s) → CaO(s) + CO2 (g) AH; (kJ/mol) СаСОз (s) -1207 CaO(s) -635.5 CO2 (g) -393.5 -2236 kJ -178 kJ O +178 kJ -1449 kJ O -2058 kJ

World of Chemistry, 3rd edition

3rd Edition

ISBN:9781133109655

Author:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan L. Zumdahl, Donald J. DeCoste

Chapter10: Energy

Section: Chapter Questions

Problem 3STP

See similar textbooks

Related questions

Q: 25. Calculate the standard enthalpy change, AH", for the following reaction: 2CH,OH+ 30 2 CO+4H,0…

A: Calculate standard enthalpy change for the following reaction--

Q: 5 grams of an unknown compound was dissolved in 75 ml of water with an initial temperature of 22.5ᵒC…

A: Given: Weight of water = 75 ml = 75 grams Initial temperature (T1) = 22.5°C Final temperature (T2) =…

Q: Calculate the change of enthalpy for the reaction CH4 (g) + NH3 (g) --> HCN (g) +3H2 (g) from the…

A: Answer:- this question is answered by using the simple concept of Hess law of constant summation of…

Q: CO2(g) + 4H2(g) CH4(g) + 2H20(g) Given the following standard enthalpies of formation. CO2(g), AH°,…

A: What is the standard enthalpy of the given reaction---

Q: Determine the enthalpy change for the reaction below, given the following reactions and subsequent…

A: Interpretation - To determine the enthalpy change for the reaction which is given as - 2 C…

Q: From the following enthalpy changes, calculate the value of AH° for the reaction N21e) + O21g) > 2…

A: If any coefficient is multiplied to the reaction, then that coefficient should also be multiplied…

Q: From the change in internal energy, AE, given for 185 °C, calculate the change in enthalpy, AH, at…

A: Relation between ΔH and ΔE, ΔH = ΔE + ΔnRT

Q: Given the following reactions: N2(g) + 202(g) –→ 2NO2(g) AH = 66.4 kJ NO(g) + ½ O2(g) → NO2(g) AH =…

A: The enthalpy change is a state function and the Hess law states that the change of enthalpy in a…

Q: Calculate the standard enthalpy change for the following reaction at 25 °C.…

A: If the reaction between the species acid and base than the salt and water will be generated.

Q: Calculate the standard molar enthalpy of formation of NaHCO3(s) from the enthalpy of the baking soda…

Q: Calculate the change of enthalpy for the reaction CH4 (g) + NH3 (g) --> HCN (g) +3H2 (g) from the…

A: Calculate the change of enthalpy for the reaction CH4 (g) + NH3 (g) → HCN (g) +3H2 (g) from the…

Q: Calculate the enthalpy of reaction for the following reaction: NaOH(s) + HCI(g) ----> NaCI(s) +…

A: Given Enthalpy of Formation of NaCl(s) = - 411 KJ/ mole Enthalpy of formation of H2O(g) =…

Q: The standard enthalpy change for the following reaction is -851 kJ at 298 K. 2 Na(s) + O2(g) +…

Q: The standard enthalpy of reaction, AH' pxn, for the reaction, CaO(s) + SO3(3) – CaSO4(s) is -401.5…

Q: Given the thermochemical equations X, +3 Y, → 2XY AH = -330 kJ X, +2Z, → 2XZ, AH = -120 kJ 2Y, +Z, →…

A: Given thermochemical reactions are : X2+3Y2→2XY3 ∆H1=-330 kJ…

Q: heat of reaction for the following reaction: (NH4)2Cr2O7(s) → Cr2O3(s) + N2(g) +4H2O(g)

A: Heat of the reaction is "at the constant temperature amount of heat absorbed/released in a chemical…

Q: Using the enthalpy of formation data from the appendix in the book, determine the enthalpy for the…

A: Given : Fe2O3(s)+CO(g)→Fe(l)+CO2(g)C2H6+O2→CO(g)+H2O(g) Enthalpy of formation of Fe(l)=36.6 KJ/mole…

Q: The enthalpy of reaction for the combustion of C to CO2 can occur in two steps. (1) C(s) + O2(g) –…

Q: PCI5(s) can be prepared by the reaction PCI3(1) + Cl2(g) - PCI5(s). Calculate the enthalpy change…

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H,(g) C,H1o(g) AH°…

A: According to Hess law, the enthalpy change of a reaction is equal to the sum of the enthalpy change…

Q: For the chemical reaction Ca (s) + ½ O2 (g) → CaO (s) AH° = -635 kJ/mol. %3D What is the enthalpy…

A: ⊙ Enthalpy is an additive in nature.Ca(s)+12O2(g)→CaO(s), △H°=-635 kJ/mol—Iwe need to find enthalpy…

Q: Calculate the reaction enthalpy, ΔH, for the following reaction: CH4(g)+2O2(g)→CO2(g)+2H2O(l)

Q: Need help with #4

A: The balanced reaction taking place is given as, => CuSO4 + 2 KOH → K2SO4 + Cu(OH)2 Given:…

Q: A calorimeter contains 27.0 mL of water at 11.5 °C. When 1.30 g of X (a substance with a molar mass…

A: X(s) + H2O(l) --> X(aqm = 1.30 gM = 82

Q: 2. The industrial method currently used to produce butanol is the hydration of butene. C,Ha(g) +…

A: Given 4C(s) + 4 H2(g) → C4H8(g) ∆H = -7.1 KJ/mol…

Q: The standard enthalpy change for the following reaction is 925 kJ at 298 K. Mg(OH)2(s) → Mg(s) +…

A: We know that Enthalpy is a state function one that depends on only the Initial state of the system…

Q: Hydrobromic acid (HBr) is a commonly used acid for adding bromine to organic compounds. As bromine…

Q: monium dichromate is sometimes known as Vesuvian Fire, because of its use in demonstrations of…

Q: SnCl2 (k) → Sn (k) + Cl2 (g) +325.1 kJ 2 SnCl2 (k) + 2 Cl2 (g) → 2 SnCl4 (s) -372.4 kJ Using the…

A: The reaction enthalpy, ∆H, is the energy that is involved in carrying out a reaction. Energy may be…

Q: For the chemical reaction H, (g) + F, (g) → 2 HF (g) AH° = -79.2 kJ/mol. What is the enthalpy (in…

Q: From the change in internal energy, AE, given for 40 °C, calculate the change in enthalpy, AH, at…

A: Given reaction: N2O2(g) → N2(g) + O2(g) Given ∆E = -151.3 kJ at 40 ∘C We have to calculate the value…

Q: 2. Calculate the enthalpy for the following reaction: > 2NO2 (g) AH = ? kJ Nao) + 20zg) Using the…

Q: The standard enthalpy change for the following reaction is -576 kJ at 298 K. 2 Na(s) + I2(s) –→ 2…

A: Given,

Q: Calculate the change of enthalpy for the reaction CH4 (g) + NH3 (g) --> HCN (g) +3H2 (g) from the…

A: Calculate:- CH4 (g) + NH3 (g) --> HCN (g) +3H2 (g) Given:- Reaction 1: N2 (g) + 3H2 (g) -->…

Q: Determine ΔH in kJ/mol for the following reaction: 2NO(g) + O2(g) --> 2NO2(g) The standard…

A: Given that: 2NO(g) + O2(g) <......> 2NO2(g) dH°NO = 90.4 KJ/mol dH°NO2 = 33.9 KJ/mol

Q: Use the standard enthalpies of formation table to determine the change in enthalpy for the given…

Q: The standard enthalpy of reaction, AH rxn: for the reaction, CaO(s) + SO3(g) –→ CaSO4(s) is -401.5…

A: Ans. ∆H°=Erxn°+∆nRT or Erxn° = ∆H°-∆nRT…

Q: For the chemical reaction Ca (s) + ½ O₂ (g) → CaO (s) ∆H° = -635 kJ/mol. What is the enthalpy for…

A: To calculate enthalpy for reaction:

Q: Given H2(g) + (1/2)02(g)H20(1), AH° = -286 kJ/mol, determine the standard enthalpy change for the…

A: Given data H2(g)+12O2(g)→H2O(l) , ∆H°=-286 KJ/mol To be determine 2 H2O(l)→2 H2(g)+O2(g) , ∆H°=?

Q: Given the standard enthalpy changes for the following two reactions: (1) 4C(s) + 5H₂(g)-C₂H₂(g) (2)…

A: What is the stadard enthalpy change for the reaction (3)?

Q: Determine the enthalpy of the reaction: 3Fe,O3 (s) + CO (g)→ CO2 (g) + 2Fe;O4 (s), given the…

Q: From the change in internal energy, AE, given for 40 °C, calculate the change in enthalpy, AH, at…

A: Internal energy = -151.3 KJ T = 40°C = 40 + 273 = 313 K

Q: From the following enthalpy of reaction data and data in Appendix C, calculate AH; for CaC2 (s):…

A: The enthalpy change of a chemical reaction at the standard state is described by using each of the…

Q: For the reaction CO(g) + Cl2(g) COCl2(g) G° = -62.9 kJ and S° = -137.3 J/K at 331 K and 1 atm.…

A: The given reaction is: CO(g)+Cl2(g)⇋COCl2(g) Gibbs' Free energy of the reaction, G° = -62.9 kJ at…

Q: What is the standard enthalpy change for the reaction? 2NH3(g)→N2H4(1) + H2(g) AH°1 = -543 kJ-mol-1…

Q: The standard enthalpy change for the following reaction is -135 kJ at 298 K. 1/2 N2(g) + 1/2 H2(g)…

A: Basic Rule If any number is multiplied in the reaction Then that number is also multiplied in the…

Q: Using the enthalpy of formation data from the appendix in the book, determine the enthalpy for the…

Q: Given the standard enthalpy changes for the following two reactions: (1) N2(g) + 202(g)N½O4(g) AH° =…

A: You have given a reaction that follows the Hess Law of enthalpy formation.

Q: The enthalpy of reaction for the combustion of C to CO2 is -393.5 kJ/mol C, and the enthalpy for the…

A: The reactions given are, 1) C (s) + O2 (g) ------> CO2 (g) ΔH = -393.5…

Q: Given the following combustion reaction and its molar enthalpy of reaction: 2NO(g) + O2(g) 2NO2(g)…

A: Given reaction: 2NO(g) + O2(g) → NO2(g) ΔHo = -112 KJ

Concept explainers

Thermochemistry

Thermochemistry can be considered as a branch of thermodynamics that deals with the connections between warmth, work, and various types of energy, formed because of different synthetic and actual cycles. Thermochemistry describes the energy changes that occur as a result of reactions or chemical changes in a substance.

Exergonic Reaction

The term exergonic is derived from the Greek word in which ‘ergon’ means work and exergonic means ‘work outside’. Exergonic reactions releases work energy. Exergonic reactions are different from exothermic reactions, the one that releases only heat energy during the course of the reaction. So, exothermic reaction is one type of exergonic reaction. Exergonic reaction releases work energy in different forms like heat, light or sound. For example, a glow stick releases light making that an exergonic reaction and not an exothermic reaction since no heat is released. Even endothermic reactions at very high temperature are exergonic.

Question

Use the data given below to find the enthalpy of reaction for the following reaction:
CaCO3(s) → CaO(s) + CO2 (g)
AH (kJ/mol)
СаСОз (s)
-1207
CaO(s)
-635.5
CO2 (g)
-393.5
-2236 kJ
-178 kJ
+178 kJ
O -1449 kJ
-2058 kJ

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Analysis

VIEW

Calculation

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps with 2 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
A 50-mL solution of a dilute AgNO3 solution is added to 100 mL of a base solution in a coffee-cup calorimeter. As Ag2O(s) precipitates, the temperature of the solution increases from 23.78 C to 25.19 C. Assuming that the mixture has the same specific heat as water and a mass of 150 g, calculate the heat q. Is the precipitation reaction exothermic or endothermic?
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
When 1.000 g of ethylene glycol, C2H6O2, is burned at 25C and 1.00 atmosphere pressure, H2O(l) and CO2(g) are formed with the evolution of 19.18 kJ of heat. a Calculate the molar enthalpy of formation of ethylene glycol. (It will be necessary to use data from Appendix C.) b Gf of ethylene glycol is 322.5 kJ/mol. What is G for the combustion of 1 mol ethylene glycol? c What is S for the combustion of 1 mol ethylene glycol?
White phosphorus, P4, ignites in air to produce P4O10. When 3.56 g P4 is burned, 85.8 kJ of thermal energy is evolved at constant pressure. Calculate the combustion enthalpy of P4.
In a constant-volume calorimeter, 35.0g of H2cools from 75.3C to25.0C. Calculate w, q, U, and H for the process.
Consider the reaction 2HCl(aq)+Ba(OH)2(aq)BaCl2(aq)+2H2O(l)H=118KJ Calculate the heat when 100.0 rnL of 0.500 M HCl is mixed with 300.0 mL of 0.100 M Ba(OH)2 Assuming that the temperature of both solutions was initially 25.0C and that the final mixture has a mass of 400.0 g and a specific heat capacity of 4.18 J/C g, calculate the final temperature of the mixture.
Another reaction that is used to propel rockets is N2O4(l)+2N2H4(l)3N2(g)+4H2O(g) This reaction has the advantage that neither product is toxic, so no dangerous pollution is released. When the reaction consumes 10.0 g liquid N2O4, it releases 124 kJ of heat. (a) Is the sign of the enthalpy change positive or negative? (b) What is the value of H for the chemical equation if it is understood to be written in molar quantities?
The reaction enthalpy for oxidation of styrene, C8H8, has been measured by calorimetry. C8H8() + 10 O2(g) 8 CO2(g) + 4 H2O() rH = 4395.0 kJ/mol Use this value, along with the data from Table 4.2, to calculate the standard formation enthalpy of styrene, in kJ/mol. Table 4.2 Selected Standard Formation Enthalpies, fH, at 25C
One step in the manufacturing of sulfuric acid is the conversion of SO2(g) to SO3(g). The thermochemical equation for this process is SO2(g)+12O2(g)SO3(g)H=98.9kJ The second step combines the SO3 with H2O to make H2SO4. (a) Calculate the enthalpy change that accompanies the reaction to make 1.00 kg SO3(g). (b) Is heat absorbed or released in this process?
sample of natural gas is analyzed and found to be88.4% methane (CH4) and 11.6% ethane (C2H6) bymass. The standard enthalpy of combustion of methaneto gaseous carbon dioxide (CO2) and liquid water (H2O) is -891 kJ/mol. Write the equation for the combustionof gaseous ethane to carbon dioxide and water.Calculate the standard enthalpy of combustion of ethaneusing standard enthalpies of formation from Table R-11on page 975. Using that result and the standard enthalpyof combustion of methane in Table 15.3, calculate theenergy released by the combustion of 1 kg of natural gas.
Combustion reactions involve reacting a substance with oxygen. When compounds containing carbon and hydrogen are combusted, carbon dioxide and water are the products. Using the enthalpies of combustion for C4H4 ( 2341 kJ/mol), C4H8 (2755 kJ/mol), and H2 (286 kJ/mol), calculate H for the reaction C4H4(g)+2H2(g)C4H8(g)