O 1.63 x 10-19Given the following values of equilibrium constants:Cu(OH)2(s) → Cu2*(aq) + 20H (aq) - Ksp = 1.63 x 10-19Cu(NH3)42*(aq) Cu2*(aq) + 4NH3(aq) K= 1.0 x 10-13What is the value of the equilibrium constant for the following reaction?Cu(OH)2(s) + 4NH3(aq) Cu(NH3)42*(aq) + 20H"(aq)O 1.6 x 10-321.6 xX 10-66.13 X 1018O 1.0 x 1013

Answered: Image /qna-images/answer/985815bc-b597-417e-be82-4c3933c4ab13.jpg

Given the following values of equilibrium constants: Cu(OH)2(s) → Cu2*(aq) + 20H¯(aq) - Ksp 1.63 x 10-19 Cu(NH3)4²*(aq) What is the value of the equilibrium constant for the following reaction? Cu(OH)2(s) + 4NH3(aq) Cu(NH3)42*(aq) + 20H¯(aq) %3D + Cu2*(aq) + 4NH3(aq) K= 1.0 x 10-13 O 1.63 x 10-19

Given the following values of equilibrium constants: Cu(OH)2(s) → Cu2(aq) + 20H¯(aq) - Ksp 1.63 x 10-19 Cu(NH3)4²(aq) What is the value of the equilibrium constant for the following reaction? Cu(OH)2(s) + 4NH3(aq) Cu(NH3)42(aq) + 20H¯(aq) %3D + Cu2(aq) + 4NH3(aq) K= 1.0 x 10-13 O 1.63 x 10-19

Chemistry: The Molecular Science

5th Edition

ISBN:9781285199047

Author:John W. Moore, Conrad L. Stanitski

Publisher:John W. Moore, Conrad L. Stanitski

Chapter12: Chemical Equilibrium

Section: Chapter Questions

Problem 110QRT: The diagram represents an equilibrium mixture for the reaction N2(g) + O2(g) ⇌ 2 NO(g) Estimate the...

See similar textbooks

Similar questions

Because calcium carbonate is a sink for CO32- in a lake, the student in Exercise 12.39 decides to go a step further and examine the equilibrium between carbonate ion and CaCOj. The reaction is Ca2+(aq) + COj2_(aq) ** CaCO,(s) The equilibrium constant for this reaction is 2.1 X 10*. If the initial calcium ion concentration is 0.02 AI and the carbonate concentration is 0.03 AI, what are the equilibrium concentrations of the ions? A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H2COj(aq) H+(aq) + HCO}‘(aq) K = 4.4 X 10"7 She starts with 0.1000 AI carbonic acid. What are the concentrations of all species at equilibrium?
Nitrogen, hydrogen, and ammonia are in equilibrium in a 1000-L reactor at 550 K. The concentration of N2 is 0.00485 M, H2 is 0.022 M, and NH3 is 0.0016 M. The volume of the container is halved, to 500 L. (a) Calculate the equilibrium constant. (b) Define y as the change in the concentration of nitrogen in the 500-L container. Is y positive or negative? (c) Write the iCe table and express the equilibrium constant in a polynomial in terms of y.
Because carbonic acid undergoes a second ionization, the student in Exercise 12.39 is concerned that the hydrogen ion concentration she calculated is not correct. She looks up the equilibrium constant for the reaction HCO,-(aq) «=* H+(aq) + COf'(aq) Upon finding that the equilibrium constant for this reaction is 4.8 X 10“H, she decides that her answer in Exercise 12.39 is correct. Explain her reasoning. A student is simulating the carbonic acid—hydrogen carbonate equilibrium in a lake: H,CO,(aq) 5=6 H+(aq) + HCO,'(aq) K = 4.4 X 10'7She starts with 0.1000 A1 carbonic acid. W hat are the concentrations of all species at equilibrium?
Hydrogen and carbon dioxide react at a high temperature to give water and carbon monoxide. H2(g) + CO2(g) H2O(g) + CO(g) (a) Laboratory measurements at 986 C show that there are 0.11 mol each of CO and H2O vapor and 0.087 mol each of H2 and CO2 at equilibrium in a 50.0-L container. Calculate the equilibrium constant for the reaction at 986 C. (b) Suppose 0.010 mol each of H2 and CO2 are placed in a 200.0-L container. When equilibrium is achieved at 986 C, what amounts of CO(g) and H2O(g), in moles, would be present? [Use the value of Kc from part (a).]
Again the experiment in Exercise 12.33 was redesigned. This time, 0.15 mol each of N, and O2 was injected into a 5.0-L container at 2500 K, at which the equilibrium constant is 3.6 X 10-?. What was the composition of the reaction mixture at equilibrium? l'he following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
At 2300 K the equilibrium constant for the formation of NO(g) is 1.7 103. N2(g) + O2(g) 2 NO(g) (a) Analysis shows that the concentrations of N2 and O2 are both 0.25 M, and that of NO is 0.0042 M under certain conditions. Is the system at equilibrium? (b) If the system is not at equilibrium, in which direction does the reaction proceed? (c) When the system is at equilibrium, what are the equilibrium concentrations?
The experiment in Exercise 12.33 was redesigned so that the reaction started with 0.15 mol each of N2 and O2 being injected into a 1.0-L container at 2500 K. The equilibrium constant at 2500 K is 3.6 X 10“’. What was the composition of the reaction mixture after equilibrium was attained? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) *2 2 NO K = 4.1 X IO-4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L-’ ofO2, what were the equilibrium concentrations of all species?
In the reaction in Exercise 12.33, another trial was carried out. The reaction began with an initial concentration of N2 equal to the initial concentration of NO. Each had a concentration of 0.100 mol L-1. WTat were the equilibrium concentrations of all species? The following reaction establishes equilibrium at 2000 K: N2(g) + O2(g) ^2 NO K = 4.1 X 10~4 If the reaction began with 0.100 mol L-1 of N2 and 0.100 mol L'1 ofO2, what were the equilibrium concentrations of all species?
Suppose a reaction has the equilibrium constant K = 1.3 108. What does the magnitude of this constant tell you about the relative concentrations of products and reactants that will be present once equilibrium is reached? Is this reaction likely to be a good source of the products?
A common type of reaction we will study is that having a very small K value (K 1). Solving for equilibrium concentrations in an equilibrium problem usually requires many mathematical operations to be perfomed. However, the math involved when solving equilibrium problems for reactions having small K values (K 1) is simplified. What assumption is made when solving the equilibrium concentrations for reactions with small K values? Whenever assumptions are made, they must be checked for validity. In general, the 5% rule is used to check the validity of assuming x (or 2 x, 3x, and so on) is very small compared to some number. When x (or 2 x. 3x. and so on) is less than 5% of the number the assumption was made against, then the assumption is said to be valid. If the 5% rule fails, what do you do to solve for the equilibrium concentrations?
Suppose a reaction has the equilibrium constant K = 1.7 108 at a particular temperature. Will there be a large or small amount of unreacted starting material present when this reaction reaches equilibrium? Is this reaction likely to be a good source of products at this temperature?
The following equilibrium was studied by analyzing the equilibrium mixture for the amount of H2S produced. Sb2S3(s)+3H2(g)2Sb(s)+3H2S(g) A vessel whose volume was 2.50 L was filled with 0.0100 mol of antimony(III) sulfide, Sb2S3, and 0.0100 mol H2. After the mixture came to equilibrium in the closed vessel at 440C, the gaseous mixture was removed, and the hydrogen sulfide was dissolved in water. Sufficient lead(II) ion was added to react completely with the H2S to precipitate lead(II) sulfide, PbS. If 1.029 g PbS was obtained, what is the value of Kc at 440C?