Answered: Given the reaction: 2AI + 3Cl2 +2AICI3…

Given the reaction: 2AI + 3Cl2 +2AICI3 How many moles of aluminum chloride is formed if 4.5 moles of chlorine gas reacts? Write only the numerical answer to two significant figures

World of Chemistry

7th Edition

ISBN:9780618562763

Author:Steven S. Zumdahl

Publisher:Steven S. Zumdahl

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 52A

See similar textbooks

Related questions

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: Aqueous sulfuric acid reacts with solid sodium hydroxide to produce aqueous sodium sulfate and…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous…

Q: (CH3(CH2),CH,) reacts with gaseous oxygen gas (02) to produce gaseous carbon dioxide (CO2) and…

Q: Given the following equation, what is the correct form of the conversion factor needed to convert…

A: According to the reaction given below: 4Fe(s)+3O2(g)---------------->2Fe2O3(s) The equation…

Q: Consider the reaction between sodium metal and chlorine gas to form sodium chloride (table…

A: Question is to be solved on stoichiometry of equation. given gram atomic mass of Na =23 g Gram…

Q: Zinc, Zn and iodine, I2, react to form zinc(ll) iodide, ZnI2 (the reactants and the product are all…

A: Given , mass of Zn = 50.0 g Mass of I2 = 50.0 g

Q: Aqueous sulfuric acid (H2SO4) reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: The number of moles for a given chemical species refers to the ratio of mass of the species to that…

Q: and Liquid hexane (CH₂(CH₂) CH3) reacts with gaseous oxygen gas (O₂) to produce gaseous carbon…

Q: Many metals react with halogens to give metal halides. For example, iron reacts with chlorine to…

A: To solve all the given questions we will use the stoichiometric ratio of the given balanced chemical…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Aluminium reacts with oxygen to form aluminium oxide in a synthesis reaction described by the…

A: The reaction taking place is given as, => Al + O2 -----> Al2O3

Q: The combustion of gasoline produces carbon dioxide and water. Assume gasoline to be pure octane…

A: Combustion reaction of octane 2C8H18 + 25O2 → 16CO2 + 18H2O From this Balanced chemical equation we…

Q: For the chemical reaction: 2 Mg (s) + O2 (g) 2 Mg0 (s), if you start the reaction with 2 moles of Mg…

A: Given reaction is : 2Mg (s) + O2 (g) ----------> 2MgO (s) Moles of Mg = 2 mole Moles of O2 = 3…

Q: Gaseous ethane CH3CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and…

Q: Many computer chips are manufactured from silicon, which occurs in nature as SiO2SiO2. When SiO2SiO2…

A: The reaction is, SiO2(s)+2C(s)→Si(l)+2CO(g) Given, The amount of silicon dioxide =156.7kg. The…

Q: How many kilograms of magnesium chloride are produced from the reaction 91.3 moles of copper(1)…

A: Quantitative analysis of species in any chemical reaction is formed by its balanced equation

Q: Aqueous sulfuric acid (H, SO,) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: 1. How much carbon dioxide (in litres) comes from the reaction of 30.0 g of sodium carbonate…

A: The balanced chemical reaction is given below.

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: 14. In an explosive chemical reaction, potassium metal reacts with water to form potassium hydroxide…

A: Limiting reagent: The reactant which completely consumes in the reaction first and limits the…

Q: 2. Dichloromethane (CH2CI2) is a solvent to remove caffeine from coffee beans. It is produced by the…

A: Given Reaction CH4 + 2Cl2 → CH2Cl2 + 2HCl Mass of CH4 = 20 gram Mass of Cl2 = 50 gram…

Q: When Mercury (I) oxide, a red crystakkine solid, is heated, it decomposes to form liquid mercury and…

A: The balanced chemical equation can be written as follows-

Q: Aluminum reacts with chlorine gas to form aluminum chloride via the following reaction:…

A: The number of moles (nAl) in 33.0 g of aluminum is calculated using equation (1) where m and M is…

Q: Balance the following chemical equation, then answer the following question. C8H18(g) + O2(g) →…

Q: Acetylene (C,H,) gas is often used in welding torches because of the very high heat produced when it…

A: The number of moles for a given chemical species refers to the ratio of mass of the species to that…

Q: Aqueous sulfuric acid (H2SO4) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: The reaction of sulfuric acid with sodium hydroxide to produce sodium sulfate and water is as…

Q: Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: Aqueous hydrochloric acid HCl reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

Q: Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Chemical reactions are those reactions which undergo any chemical change. Chemical reaction is…

Q: For the chemical reaction: 2 Mg (s) + O2 (g) → 2 Mg0 (s), if you start the reaction with 2 moles of…

A: Magnesium reacts with oxygen to form magnesium oxide. The equation for the balanced chemical…

Q: Iron metal reacts with chlorine gas according to the following equation: 2Fe(s) + 3Cl2 (g) ĺ 2FeCl3…

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Given, Aqueous hydrochloric acid (HCl) reacts with solid Sodium hydroxide (NaOH) to produce aqueous…

Q: Baking soda and vinegar react according to the following chemical equation:…

A: Moles of baking soda is calculated for the given reaction as follows,

Q: 18. Ammonium bicarbonate, which was classically obtained from deer antlers, is still used for baking…

A: This question can be solved by basic mole concept

Q: Aqueous hydrochloric acid (HCI) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: Number of moles can be determined as follows: No.of moles of H2SO4=massmolar mass=42.2 g98.079…

Q: Aqueous sulfuric acid (H₂SO4) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Given Mass of H2SO4 = 3.9 g Mass of NaOH = 1.8 g Theoretical yield of Na2SO4= ?

Q: Part A How many moles of C are needed to react with 0.460 mole SO2? Express your answer using three…

A: Number of atoms, ions and molecules present on a given amount can be determined by “Mole Concept”.…

Q: Aqueous sulfuric acid H2SO4 reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: The balanced chemical reaction for the reaction of sulfuric acid and sodium hydroxide can be…

Q: Gaseous butane CH3CH22CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon…

A: The percent yield is the way used to represent the reactant’s amount that is transformed into…

Q: Aqueous hydrochloric acid (HCl) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Q: O CHEMICAL REACTIONS Percent yield of chemical reactions Aqueous hydrobromic acid (HBr) reacts with…

Q: S + 6 HNO3 --> H2SO4 + 6 NO2 + 2 H2O In the above equation how many moles of water…

A: Given, the balanced equation: S+6HNO3 → H2SO4 + 6 NO2 + 2 H2O We have to find the number of…

Q: Aqueous hydrochloric acid (HCl) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: The balanced reaction of HCl with NaOH can be given as

Q: Aqueous hydrobromic acid HBr reacts with solid sodium hydroxide NaOH to produce aqueous sodium…

A: The reaction can be expressed as, HBr + NaOH -----> NaBr + H2O…

Q: Given the reaction of 4 g of CaCN2 and 4 g of H20 forming CaCO3 and NH3, determine the mass (in g)…

Q: Aqueous sulfuric acid (H2SO4) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

A: Given, H2SO4(aq) + NaOH(s) → Na2SO4(aq) + H2O(l) Balancing the above equation, we get H2SO4(aq) +…

Q: Aqueous hydrobromic acid (HBr) reacts with solid sodium hydroxide (NaOH) to produce aqueous sodium…

Question

Given the reaction: 2AI + 3Cl2 +2AICI3
How many moles of aluminum chloride is formed if 4.5 moles of chlorine gas reacts? Write only the numerical answer to two significant
figures

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Quality Assurance and Calibration Methods

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

For each of the following balanced reactions, calculate how many moles of each product would be produced by complete conversion of 0.50 mole of the reactant indicated in boldface. Indicate clearly the mole ratio used for the conversion. msp;2H2O(l)2H2O(l)+O2(g) msp;2KClO3(s)2KCl(s)+3O2(g) msp;2Al(s)+6HCl(aq)2AlCl3(aq)+3H2(g) msp;C3H8(g)+5O2(g)3CO2(g)+4H2O(g)
One way to remove nitrogen oxide (NO) from smoke-stack emissions is to react it with ammonia. 4NH3(g)+6NO(g)5N2(g)+6H2O(l) Calculate (a) the mass of water produced from 0.839 mol of ammonia. (b) the mass of NO required to react with 3.402 mol of ammonia. (c) the mass of ammonia required to produce 12.0 g of nitrogen gas. (d) the mass of ammonia required to react with 115 g of NO.
When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
Small quantities of ammonia gas can be generated in the laboratory by heating an ammonium salt with a strong base. For example, ammonium chloride reacts with sodium hydroxide according to the following balanced equation: :math>NH4Cl(s)+NaOH(s)NH3(g)+NaCl(s)+N2O(g) at mass of ammonia gas is produced if 1.39 g of ammonium chloride reacts completely?
3.81 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
4.72 The picture shown depicts the species present at the start of a combustion reaction between methane, CH4 and oxygen, O2 (a) What is the limiting reactant? (b) Draw the resulting state after this set of reactants has reacted as far as possible.
or each of the following reactions, give the balanced chemical equation for the reaction and state the meaning of the equation in terms of individual molecules and in terms of moles of molecules. msp;MnO2(s)+Al(s)Mn(s)+Al2O3(s) msp;B2O3(s)+CaF2(s)BF3(g)+CaO(s) msp;NO2(g)+H2O(l)HNO3(aq)+NO(g) msp;C6H2(g)+H2C6(g)H12(g)
Carbon disulfide burns in air, producing carbon dioxide and sulfur dioxide. CS2(l)+3O2(g)CO2(g)+2SO2(g);H=1077kJ What is H for the following equation? 12CO2(g)+SO2(g)12CS2(l)+32O2(g)
Chlorine and fluorine react to form gaseous chlorine trifluoride. Initially, 1.75 mol of chlorine and 3.68 mol of fluorine are combined. (Assume 100% yield for the reaction.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) What is the theoretical yield of chlorine trifluoride in moles? (d) How many moles of excess reactant remain after reaction is complete.
When solid phosphorus (P4) reacts with oxygen gas, diphosphorus pentoxide is formed. Initially 2.87 mol of phosphorus and 3.86 mol of oxygen are combined. (Assume 100% yield.) (a) Write a balanced equation for the reaction. (b) What is the limiting reactant? (c) How many moles of excess reactant remain after the reaction is complete?
For the chemical reaction UF6+2H2OUO2F2+4HF write the conversion factor that would be needed to do each of the following one-step conversions. a. Moles of UF6 to moles of HF b. Moles of UO2F2 to moles of H2O c. Moles of HF to moles of UO2F2 d. Moles of H2O to moles of UF6
The following diagram represents the high-temperature reaction between CH4 and O2. Use this diagram to answer the following questions. a. What are the chemical formulas of the products? b. How many moles of each product can be obtained if 6.0 moles of CH4 react?