Answered: Iculate the standard (Gibbs)…

Iculate the standard (Gibbs) free-energy change for the following reaction at 25 -. (Standard values are listed at the beginning of this exam.) MgCl2 (s) - Mg+ (aq) + 2 Cl (aq)

Chemistry & Chemical Reactivity

9th Edition

ISBN:9781133949640

Author:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Publisher:John C. Kotz, Paul M. Treichel, John Townsend, David Treichel

Chapter18: Principles Of Chemical Reactivity: Entropy And Free Energy

Section: Chapter Questions

Problem 3PS: Use S values to calculate the standard entropy change, rS0, for each of the following processes and...

See similar textbooks

Related questions

Q: Determine if the redox reaction of iron and water to form ferric chloride is spontaneous at 29°C.…

A: Given,

Q: The Gibbs free energy is given below. Use it to determine the equilibrium constant of the reaction…

Q: Choose the INCORRECT statement. o The work available in a cell= nFEcell. o Reversing a cell reaction…

A: Welcome to bartleby! Introduction : We have to tell which statement is incorrect.

Q: For the following reaction, calculate ΔHf°, ΔS298° from standard values, and then ΔGf° from those…

A: The enthalpy of formation of carbon dioxide at 298.15K is ΔHf = -393.5 kJ/mol CO2. ∆S° = 2.96 J/K…

Q: Consider the following reaction at 298K. 2 Cu* (aq) + Co () 2 Cu* (aq) + Co²* (aq) Which of the…

A: We can determine the standard cell potential of a redox reaction , by knowing the standard reduction…

Q: Compute the standard entropy change for the following reaction: Ag(s) + 1/2CI2(g) → AgCI(s) i J/K

A: The value of standard entropy of Ag(s), Cl2(g), and AgCl(s) is 42.5 J/K, 223.0 J/K, and 96.2 J/K,…

Q: Consider the reaction of chlorine with manganese dioxide: 3 Cl₂(s) + 2 MnO2(s) + 8 OH(aq) →6 Cl(aq)…

A: Consider the reaction of chlorine with manganese dioxide: 3Cl2(g)+2MnO2(s)+8OH−(aq) ⇌…

Q: Determine standard free energy change for the reaction: NO2- (aq) + H2O (l) ------ HNO2…

A: The reaction taking place is given as, => NO2- (aq) + H2O (l) --------> HNO2 (aq) + OH- (aq)…

Q: 3H2(g)+Fe2O3(s)⟶2Fe(s)+3H2O(g)

A: Given data from std table at 25 °C of H2=0 kJ/mol of Fe2O3=-741 kJ/mol of Fe=0 kJ/mol of…

Q: 3. Consider the reaction at 25°C 2NO3 (aq) + 8H*(aq) + 3Cu(s) → 3Cu²*(aq) + 2NO(g) + 4H20(I) (a) is…

A: “Since you have posted a question with multiple sub-parts, we will solve the first three subparts…

Q: Why are spontaneous and non-spontaneous reactions often coupled?

A: Spontaneous reaction: the reaction which take place on its own without any initiation are…

Q: For a spontaneous reaction, the AG'rn must have a sign that is v and the magnitude of K must be…

A: Given : Spontaneous Reaction To find: Sign of ∆G° and magnitude of k Solution: There are generally…

Q: For a particular reaction at 166.5 °C, AG = -376.61 kJ, and AS = 144.83 J/K. Calculate AG for this…

Q: (a) For the reaction Cu(c) + Hg22+(aq) = Cu2+(aq) + 2Hg(I) compute the standard state enthalpy…

A: Given reaction is : Cu (s) + Hg22+ (aq) -----------> Cu2+ (aq) + 2Hg (l) a). Determine the…

Q: Calculate the standard free energy change, AG°, for the following reactions at the temperature giv…

A: 17) The reaction given is => Ca (s) + 2 H2SO4 (l) -------> CaSO4 (s) + SO2 (g) + 2 H2O (l)…

Q: - Classify the reaction according to one of the following reaction types. CuO(s) + Ca(s) → Cu(s) +…

A: a) The reaction taking place along with the entropy change and enthalpy change is given as,

Q: Consider the corrosion of copper at 25 C using the overall reaction Cu(s) + 0.5 O2(g) + 2 H3O+(aq) →…

Q: What is a spontaneous reaction?

A: Spontaneous Reaction: A spontaneous reaction is described in a very simplistic way as the reaction…

Q: Is the following reaction spontaneous at room temperature and pressure? 2Ag20(s) → 4Ag(s) + O2(g)…

A: Given the reaction is:- 2Ag2o(s)=4Ag(s)+o2(g)

Q: Is the following reaction spontaneous at room temperature and pressure? 2A820(s) → 4Ag(s) + O2(g) O…

A: If change of entropy is positive at room temperature and pressure of a reaction than this reaction…

Q: Which case would result in a spontaneous reaction only at low temperatures? AH > 0 and AS O AH 0…

A: Enthaply less than zero and entropy less than zero favours spontaneous reaction at low temperatures.

Q: Directions: Given the AH° and AS°, Calculate the AG° values for the following reactions and indicate…

Q: Which of the following is consistent with a spontaneous process in the forward direction?…

Q: Calculate the standard change in Gibbs free energy for the reaction at 25 °C. Refer here for the…

A: In a chemical reaction ΔG° =∑ΔG°Products - ∑ ΔG°reactants. For given reaction…

Q: 3 12(s) + 2 MnO2(s) + 8 OH(aq) →6 (aq) + 2 MnO4 (aq) + 4H₂O(1) The equilibrium constant for the…

A: Given-> Equilibrium constant (Keq) = 1.66 × 1024

Q: For the reaction: 2 Al(s) + 3 Pb2 (aq) 2 Al3*(aq) + 3 Pb(s) answer both questions. Pb2*(aq) + 2 e-…

A: in electrochemical cell reaction, if standard cell potential is positive then reaction is said to…

Q: Calculate the ∆Suniv and classify whether or not the reaction is spontaneous at 25°C Decomposition…

A: Thermodynamics is the branch of chemistry that mainly deals with the heat transfer between systems…

Q: Gibbs energy change, A:G®, is related to cell potential, E, by the equation Calculate the standard…

A: For the given cell, change in enthalpy and entropy at 25oC is as follows: ∆rHo = -729 kJ mol-1∆rSo =…

Q: Substance AS° (J mol-1 K-) Mg 33 205 MgO 27

Q: Consider the corrosion of copper at 30°C using the overall reaction: Cu(s) + 0.5 O2(g) + 2 H3O+(aq)…

Q: Consider the following reaction at 298 K. Co2+ (aq) + 2Ag(s) → Co(s) + 2Ag+ (aq) Which of the…

A: Given reactions: Co2+(aq) + 2Ag(s) → Co(s) + 2Ag+(aq) Hg2+(aq) + Cd(s) → Hg(l) + Cd2+(aq) We have to…

Q: Consider the reaction H₂(g) + C₂H4(g)→→→→→C₂H6(g) Using the standard thermodynamic data in the…

A: Solutions Using the thermodynamic data are given table

Q: Use the data given in the table to calculate the value of AGin at 25° C Compound AG (kJ/mol) rxn for…

A: Hello. Since your question has multiple parts, we will solve the first question for you. If you want…

Q: Calculate the standard free-energy change at 25 ∘C for the following reaction:…

Q: What is the value of AGrxn for the reaction: 2C » 3A+4B ? Given that C » 3/2 A+2B AG° 230.5 kJ/mol…

A: 1. Given: Reaction, C → 32A + 2B ∆Grxn° = 230.5 kJ/mol 2. Given: ∆Hrxn° = -37.1…

Q: For a redox reaction, when ?∘????Ecell∘ > 0, then _____________ Group of answer choices Δ?∘ΔG∘ > 0…

A: The answer is given as follows

Q: Photosynthesis in plants converts carbon dioxide and water into glucose (C,H1206) and oxygen…

Q: Calculate the standard free-energy change and the equilibrium constant Kp for the following reaction…

Q: Use the values given in Appendix L in your textbook to calculate K. for the reaction between…

Q: For a redox reaction, when Ecell∘ > 0, then _____________ A) the reactants are less abundant than…

A: The standard potential of a cell for a redox reaction is greater than zero. Then the following…

Q: Which of the following is always true for any spontaneous reaction? A. AH> 0 B. AH0 D. AG <0

A: Since, Spontaneous reaction means reaction favoured without any external disturbance. Thus,

Q: Consider the reaction: ICI(g) + Cl2(g) → ICl;(s). The AG° of the reaction is -17.09 kJ/mol.…

A: The relation between ∆G° and Keq is given by ∆G° = - RT ln Keq (or) ∆G° = - 2.303 RT log Keq (ln =…

Q: Determine if the redox reaction of iron and water to form ferric chloride is spontaneous at 29°C.…

Q: Calculate E for the following unbalanced reactions. Indicate if the reactions are spontaneous as…

A: a) The reaction given is Al3+ (aq) + Mg (s) → Al (s) + Mg2+ (aq) In the above reaction, Al3+ is…

Q: (a) State the temperature range over which the followng reactions is spontaneous AS (J/K) ΔΗ (Κυ)…

A: We have given that (a) State the temperature range over which the following reactions is…

Q: Predict the following reaction, whether its spontaneous or nonspontaneous. a. 2NAOH) + CO2s) b. 2Fe…

Q: In which of the following reactions is AS° expected to be negative? O L(s) I(g) O 2NH;(g) N(g) +…

A: Entropy is defined as the degree of randomness. positive entropy means increase in randomness…

Q: Given the reaction: Hg2+ + Cd ⇔ Cd2+ + Hg What is the Eo of the cell? (2 decimal places with…

Q: 25. A reaction that is not spontaneous at low temperature can become spontaneous at high temperature…

Q: 7. Determine the standard free energy change, AGF°, for the formation of S² (aq) given that the AGF°…

Question

Aculate the standard (Gibbs) free-energy change for the following reaction at 25
. (Standard values are listed at the beginning of this exam.)
MgCl2 (s) - Mg"(aq) + 2 Cl (aq)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

The molecular scale pictures below show snapshots of a strong acid at three different instants after it is added to water. Place the three pictures in the correct order so that they show the progress of the spontaneous process that takes place as the acid dissolves in the water. Explain your answer in terms of entropy
Use the data in Appendix G to calculate the standard entropy change for H2(g) + CuO(s) H2O() + Cu(s)
Use S values to calculate the standard entropy change, rS0, for each of the following processes and comment on the sign of the change. (a) KOH(s) KOH(aq) (b) Na(g) Na(s) (c) Br2() Br2(g) (d) HCl(g) HCl(aq)
Consider the decomposition of red mercury(II) oxide under standard state conditions.. 2HgO(s,red)2Hg(l)+O2(g) (a) Is the decomposition spontaneous under standard state conditions? (b) Above what temperature does the reaction become spontaneous?
Indicate whether the following processes are spontaneous or nonspontaneous. (a) Liquid water freezing at a temperature below its freezing point (b) Liquid water freezing at a temperature above its freezing point (c) The combustion of gasoline (d) A ball thrown into the air (e) A raindrop falling to the ground (f) Iron rusting in a moist atmosphere
Chemists and engineers who design nuclear power plants have to worry about high-temperature reactions because it is possible for water to decompose. (a) Under what conditions does this reaction occur spontaneously? 2H2O(g) 2H2(g) + O2(g) (b) Under conditions where the decomposition of water is spontaneous, do nuclear engineers have to worry about an oxygen/hydrogen explosion? Justify your answer.
Identify the following processes as either spontaneous or not spontaneous. (a) Liquid water turns to ice when placed in a freezer at 5 C. (b) Nitrogen gas is compressed to one half its original volume. (c) Sodium reacts with water forming H2(g) and NaOH(aq). (d) Slightly soluble CaSO4 [Ksp = 4.5 105) dissolves in water to form a saturated solution.
Without doing a calculation, predict whether the entropy change will be positive or negative when each of the following reactions occurs in the direction it is written. (a) CH3OH(l)+3/2O2(g)CO2(g)+2H2O(g) (b) Br2(l)+H2(g)2HBr(g) (c) Na(s)+l/2F2(g)NaF(s) (d)CO(g)+2H2(g)CH3OH(l) (e) 2NH3(g)N2(g)+3H2(g)
What is the third law of thermodynamics? What are standard entropy values, S, and how are these S values (listed in Appendix 4) used to calculate S for a reaction? How would you use Hesss law to calculate S for a reaction? What does the superscript indicate? Predicting the sign of S for a reaction is an important skill to master. For a gas-phase reaction, what do you concentrate on to predict the sign of S? For a phase change, what do you concentrate on to predict the sign of S? That is, how are Ssolid, Sliquid, and Sgas related to one another? When a solute dissolves in water, what is usually the sign of S for this process?
Describe what you would look for in a reaction involving gases in order to predict the sign of S. Explain.
Silver carbonate, Ag2CO3, is a light yellow compound that decomposes when heated to give silver oxide and carbon dioxide: Ag2CO3(s)Ag2O(s)+CO2(g) A researcher measured the partial pressure of carbon dioxide over a sample of silver carbonate at 220C and found that it was 1.37 atm. Calculate the partial pressure of carbon dioxide at 25C. The standard enthalpies of formation of silver carbonate and silver oxide at 25C are 505.9 kJ/mol and 31.05 kJ/mol, respectively. Make any reasonable assumptions in your calculations. State the assumptions that you make, and note why you think they are reasonable.