If a solution containing 107.7 g of mercury(II) chlorate is allowed to react completely with a solution containing 17.796 g ofsodium sulfide, how many grams of solid precipitate will be formed?53.5118mass:gHow many grams of the reactant in excess will remain after the reaction?22.05mass:gAssuming complete precipitation, how many moles of each ion remain in solution? If an ion is no longer in solution, enter azero (0) for the number of moles.0.06Hg²+:mol0.12CIO3:molNa+:molIncorrect

Answered: Image /qna-images/answer/4509bbef-90e0-4333-8f83-52d6dcddcaa1.jpg

Answered: If a solution containing 107.7 g of…

If a solution containing 107.7 g of mercury(II) chlorate is allowed to react completely with a solution containing 17.796 g of sodium sulfide, how many grams of solid precipitate will be formed?

Introductory Chemistry: A Foundation

9th Edition

ISBN:9781337399425

Author:Steven S. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Donald J. DeCoste

Chapter9: Chemical Quantities

Section: Chapter Questions

Problem 12CR: What is meant by a limiting reactant in a particular reaction? In what way is the reaction...

See similar textbooks

Similar questions

When potassium chlorate is subjected to high temperatures, it decomposes into potassium chloride and oxygen. (a) Write a balanced equation for the decomposition. (b) In this decomposition, the actual yield is 83.2%. If 198.5 g of oxygen are produced, how much potassium chlorate decomposed?
What is meant by a limiting reactant in a particular reaction? In what way is the reaction “limited”? What does it mean to say that one or more of the reactants are present in excess? What happens to a reaction when the limiting reactant is used up?
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
The pictures below show a molecular-scale view of a chemical reaction between H2 and CO to produce methanol, CH3OH The box on the left represents the reactants at the instant of mixing, and the box on the right shows what is left once the reaction has gone to completion. D Was there a limiting reactant in this reaction? If so, what was it? Write a balanced chemical equation for this reaction. As usual, your equation should use the smallest possible whole number coefficients for all substances.
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
A mordant is a substance that combines with a dye to produce a stable fixed color in a dyed fabric. Calcium acetate is used as a mordant. It is prepared by the reaction of acetic acid with calcium hydroxide. 2CH3CO2H+Ca(OH)2Ca( CH3 CO2)2+2H2O What mass of Ca(OH)2 is required to react with the acetic acid in 25.0 mL of a solution having a density of 1.065 g/mL and containing 58.0% acetic acid by mass?
Consider the equation: 2A+B5C. If 10.0 g of A reacts with 5.00 g of B. how is the limiting reactant determined? Choose the best answer and explain. l type='a'> Choose the reactant with the smallest coefficient in the balanced chemical equation. So in this case, the limiting reactant is B. Choose the reactant with the smallest mass given. So in this case, the limiting reactant is The mass of each reactant must be converted to moles and then compared to the ratios in the balanced chemical equation. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must he converted to moles first. The reactant with the fewest moles present is the limiting reactant. So in this case, the limiting reactant cannot be determined without the molar masses of A and B. The mass of each reactant must be divided by their coefficients in the balanced chemical equation, and the smallest number present is the limiting reactant. So in this case, there is no limiting reactant because A and B arc used up perfectly.
Copper(II) sulfate has been used extensively as a fungicide (kills fungus) and herbicide (kills plants). Copper(II) sulfate can be prepared in the laboratory by reaction of copper(II) oxide with sulfuric acid. The unbalanced equation is :math>CuO(s)+H2SO4(aq)CuSO4(aq)+H2O(l) 2.49 g of copper(II) oxide is treated with 5.05 g of pure sulfuric acid, which reactant would limit the quantity of copper(II) sulfate that could be produced?
4.70 The particulate scale drawing shown depicts the products of a reaction between H2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients. (c) identify the limiting reactant, and explain how the pictures allow you to do so.
Solid calcium carbide (CaC2)reacts with liquid water to produce acetylene gas (C2H2)and aqueous calcium hydroxide. l type='a'> Write the balanced equation for the reaction that is (occurring. including all phases. If a 100.0-g sample of calcium carbide (CaC2)is initially reacted with 50.0 g of water, which reactant is limiting? Prove that mass is conserved for the reactant amounts used in pan b.
4.71 The particulate scale drawing shown depict the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients. (c) Identify the limiting reactant, and explain how the pictures allow you to do so.
When solutions of silver nitrate and sodium carbonate are mixed, solid silver carbonate is formed and sodium nitrate remains in solution. If a solution containing 12.43 g sodium carbonate is mixed with a solution containing 8.37 g silver nitrate, calculate the mass of each of the four substances present after the reaction is complete.