Liquid octane (CH₂(CH₂) CH₂) reacts with gaseous oxygen gas (0₂) to produce gaseous carbon dioxide (CO₂) and gaseous water (H₂O). If 4.86 g of water is produced from the reaction of 5.71 g of octane and 27.0 g of oxygen gas, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.

Liquid octane (CH₂(CH₂) CH₂) reacts with gaseous oxygen gas (0₂) to produce gaseous carbon dioxide (CO₂) and gaseous water (H₂O). If 4.86 g of water is produced from the reaction of 5.71 g of octane and 27.0 g of oxygen gas, calculate the percent yield of water. Be sure your answer has the correct number of significant digits in it.

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter3: Stoichiometry

Section: Chapter Questions

Problem 114E: a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and...

See similar textbooks

Similar questions

The element magnesium reacts with the element oxygen to form a white solid compound, magnesium oxide. When a sample of magnesium that weighs 24.30 g reacts with oxygen, it is found that the magnesium oxide produced weighs exactly 40.30 g. (a) Calculate the mass of oxygen in the magnesium oxide. (b) Calculate the mass of magnesium oxide that could be produced from 40.0 g magnesium.
a. Write die balanced equation for the combustion of isooctane (C8H18) to produce water vapor and carbon dioxide gas. b. Assuming gasoline is 100.% isooctane, with a density of 0.692 g/mL, what is the theoretical yield of carbon dioxide produced by the combustion of 1.2 1010 gal of gasoline (the approximate annual consumption of gasoline in the United States)?
Sulfur dioxide gas reacts with sodium hydroxide to form sodium sulfite and water. The unbalanced chemical equation for this reaction is given below: SO2(g)+NaOH(s)Na2SO3(s)+H2O(l) Assuming you react 38.3 g sulfur dioxide with 32.8 g sodium hydroxide and assuming that the reaction goes to completion, calculate the mass of each product formed.
In a blast furnace at high temperature, iron(III) oxide in ore reacts with carbon monoxide to produce metallic iron and carbon dioxide. The liquid iron produced is cooled and weighed. The reaction is run repeatedly with the same initial mass of iron(III) oxide, 19.0 g, but differing initial masses of carbon monoxide. The masses of iron obtained arc shown in this graph. (a) Write the balanced chemical equation for this reaction. (b) Calculate the mass of CO required to react completely with 19.0 g iron(III) oxide. (c) Calculate the mass of carbon dioxide produced when the reaction converts 10.0 g iron(III) oxide completely to products. (d) From the graph, determine which reactant is limiting when less than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (e) From the graph, determine which reactant is limiting when more than 10.0 g carbon monoxide is available to react with 19.0 g iron(III) oxide. (f) Calculate the percent yield if 24.0 g iron(III) oxide reacted with 20.0 g carbon monoxide to produce 15.9 g metallic iron. (g) Calculate the minimum mass of additional limiting reactant required to react with all of the excess of nonlimiting reactant from part (f).
Consider the following reaction: 4NH3(g)4NO(g)+6H2O(g) If a container were to have 10 molecules of O2 and 10 molecules of NH3 initially, how many total molecules (reactants plus products) would be present in the container after this reaction goes to completion?
If baking soda (sodium hydrogen carbonate) is heated strongly, the following reaction occurs: :math>2NaHCO3(s)Na2CO3(s)+H2O(g)+CO2(g) lculate the mass of sodium carbonate that will remain if a 1.52-g sample of sodium hydrogen carbonate is heated.
3.82 The particulate scale drawing shown depicts the products of a reaction between N2 and O2 molecules. (a) Draw a similar representation for the reactants that must have been present before the reaction took place. (b) Write a balanced chemical equation for the reaction, using the smallest possible whole number coefficients.
Consider the following unbalanced chemical equation for the combustion of pentane (C5H12): :math>C5H12(l)+O2(g)CO2(g)+H2O(l) a 20.4-gram sample of pentane is burned in excess oxygen, what mass of water can be produced, assuming 100% yield?
For each of the following unbalanced chemical equations, suppose 25.0 g of each reactant is taken. Show by calculation which reactant is limiting. Calculate the theoretical yield in grams of the product in boldface. msp;C2H5OH(l)+O2(g)CO2(g)+H2O(l) msp;N2(g)+O2(g)NO(g) msp;NaClO2(aq)+Cl2(g)NaCl(aq) msp;H2(g)+N2(g)NH3(g)
Liquid hexane CH3CH24CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O. If 4.48g of water is produced from the reaction of 4.31gof hexane and 21.4g of oxygen gas, calculate the percent yield of water.Be sure your answer has the correct number of significant digits in it
Gaseous ethane (CH3CH3) reacts with gaseous oxygen gas (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O). If 1.61g of carbon dioxide is produced from the reaction of 2.7g of ethane and 3.1g of oxygen gas, calculate the percent yield of carbon dioxide.Be sure your answer has the correct number of significant digits in it.
Liquid octane CH3CH26CH3 reacts with gaseous oxygen gas O2 to produce gaseous carbon dioxide CO2 and gaseous water H2O . If 9.88g of water is produced from the reaction of 8.00g of octane and 48.2g of oxygen gas, calculate the percent yield of water.Be sure your answer has the correct number of significant digits in it.