P13.5: The biosynthetic pathway for the antibiotic compound rabelomycin begins with the condensation of malonyl CoA and acetyl CoA. Predict the product of this reaction, and propose a likely mechanism. (Org. Lett. 2010 12, 2814.) ? ? ΘΟ malonyl CoA SCOA + COAS CH3 acetyl CoA CO2 HSCOA
Q: None
A: Generally P exhibits valence 3, sulfur and oxygen exhibit valence 2. Among the given structures…
Q: In thermodynamic of the dissolution of Borax lab, the student's graph is below. Calculate AS? (R=…
A: A linear regression of lnKsp vs 1/T graph gives a straight line. Through this, we can get…
Q: None
A: Step 1: The conversion of carboxylic acid into an ester by reacting it with an alcohol in the…
Q: Give common and systematic name for the following compound
A: Step 1:Systematic IUPAC name of molecule is N-ethyl-N-methylpropan-2-amine1. Identify the longest…
Q: Draw a structural formula for the major organic product(s) of the reaction shown below. NH2 1. CH3l…
A: Step 1: Step 2: Step 3: Step 4:
Q: b. Provide reactants/reagents for the following reactions in the corresponding boxes.
A:
Q: Please help me solve them, thumbs up will be given. thank u
A: Q4. Cross Claisen condensation reaction Q5. The mechanism followed is Claisen and Aldol condensation…
Q: A sample of Xe gas has a volume of 498 mL, has a pressure of 434 mm Hg, and is at a temperature of…
A: The objective of the question is to calculate the amount of Xe gas in moles using the given volume,…
Q: Identify the structural isomer of the following molecule: OH
A: The molecule you presented is ethanol, with the chemical formula C2H5OH. It features a two-carbon…
Q: Show work, thank you!
A: The molecular weight of the chromium (Cr) is 51.996 g/molGiven mass of Cr is 36.5 gNo of moles Cr =…
Q: A sample of krypton gas at a pressure of 1.12 atm and a temperature of 28.5 °C, occupies a volume of…
A: The objective of the question is to find the pressure of the krypton gas after it is allowed to…
Q: 1. CN Br 2. LiAlH4 3. H₂O NH2 2a Primary amines can be prepared from nitriles by reduction with…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: balance the equation in the pgoto
A: H2SO4 + 2KOH → K2SO4 + 2H2OThe equation above for the reaction between sulfuric acid (H2SO4) and…
Q: A sample of Xe gas has a volume of 758 mL, has a pressure of 464 mm Hg, and is at a temperature of…
A: The objective of this question is to calculate the amount of Xe gas in moles using the given volume,…
Q: 5. Synthesis: Synthesize the following compound from cyclohexane, any carbon pieces that are three…
A: There are a couple of ways to synthesize a molecule containing a cyclohexane ring, smaller carbon…
Q: Fill in the missing product (R) а меона меон b* H*, H₂O CO₂Me CO₂Me a Na toluene bH, H₂O
A: Step 1: Step 2: Step 3: Step 4:
Q: 3. The chemical equation for the decomposition of potassium chlorate is 2 KClO3(s) → 2 KCI(s) +…
A: Step 1:Step 2:Step 3:
Q: Balance the following equation CaCl2 + KOH = Ca(OH)2 + KCI
A: The objective of this question is to balance the given chemical equation. Balancing a chemical…
Q: What is the binding energy in kJ/mol nucleons for copper-63? kJ/mol nucleons 63 1 1 Cu 29 H + 34 n…
A: Question 1: cu= 29 ( 1h ) +34 ( 1N) = 29(1.00783) +34 (1.00867) =63.52185 g mol-1 Δ m=63.52185 -…
Q: dont provide handwriting solutio......
A: The objective of the question is to draw the structure of two repeating monomer units of poly(methyl…
Q: Show a detailed arrow pushing mechanism for the reaction of the Aryl Diazonium Salt with an electron…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Question 16
A: Step 1:Limiting reagent is the reactant that exhaust first in the chemical reaction and decides the…
Q: Part 3 (3 pts each) 1) Write the balanced molecular, total ionic, and net ionic equation for the…
A: The objective of the question is to write the balanced molecular, total ionic, and net ionic…
Q: Draw structural formulas for the two compounds you could use to prepare the amine shown by reductive…
A: To form the given structure via reductive amination, we prepare it using a ketone and a secondary…
Q: Chemistry
A: Step 1: The stability of the planar ring molecules depends on the Huckel rule:The given compounds…
Q: Please answer the following chem question
A: Step 1:Step 2:Step 3:
Q: solve this with step by step calculations
A: Approach to solving the question:For any solution to be a buffer solution, it should fall into one…
Q: Quickly need help figuring out how to complete the following chemical equations.
A: Step 1: Step 2: Step 3: Step 4:
Q: Complete the flow chart below to describe the separation of an acid and base mixture by providing…
A: Step 1: Step 2: Step 3: Step 4:
Q: Draw the structure(s) of the major organic product(s) of the following reaction. 1. Dioxane / reflux…
A:
Q: Finish the reaction by drawing the initial Diels-Alder product. H3C CH3 H₂C CH3 H CH
A: Diels- alder reaction is 4π+2 cycloaddition reaction cyclization is possible in tharmal condition.…
Q: Draw a triacylglycerol with 12 carbon chains that are monounsaturated (you can choose the site of…
A: Step 1: Any unsaturated fatty acid's carbon-carbon double bonds can be converted to carbon-carbon…
Q: Draw the structure of the major organic product(s) of the reaction. о NaOH H₂O • You do not have to…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: Α ABCD A Question 10 Please predict the product for each of the following reactions. Make sure to…
A:
Q: Choose the TRUE statement about the effect of the presence of a catalyst on reaction rate. In the…
A: The objective of the question is to identify the correct statement about the effect of a catalyst on…
Q: A mixture of 2 mL of 3 M NaOH solution, 2.5 mL 95% ethanol, 0.212 g benzaldehyde, and 0.058 g…
A: The reaction is the Aldol condensation, 2C6H5CHO+CH3COCH3→C6H5CH=CHC(O)CH=C6H5+2H2Owhere…
Q: explain please
A: Step 1:Step 2: Step 3: Step 4:
Q: Question 14
A: The balanced equation for the reaction of zinc with hydrochloric acid is:Zn(s) + 2HCl(aq) →…
Q: Use Le Chatelier’s Principle to predict the color change, if any, when you add more HClsolution to…
A: The objective of the question is to predict the color change, if any, when more HCl solution is…
Q: Which statement is false about the resonance structure? Water molecule has one Lewis structure…
A: False statement: Resonance structures of the same molecule have different total of electrons. True…
Q: HO Aldol reactions (condensation of two aldehydes or ketones to yield a ẞ-hydroxy carbonyl) can go…
A: The mechanism of the following transformation will be -
Q: At 1120 K, ∆G° = 42.3 kJ/mol for the reaction 3 A (g) + B (g) →2 C (g). If the partial pressures of…
A: Step 1: The reaction: 3A(g)+B(g)→2C(g) The standard free energy change (ΔGo) and the free energy…
Q: be solved without first doing this. Practice Exercise 16.1 A solution contains 0.360 mole of ammonia…
A: The objective of the question is to determine the concentrations of hydroxide ions, ammonium ions,…
Q: 3+ 2+ For the reaction 2Ga (aq) + 3Zn(s) → 2Ga(s) + 3Zn (aq)E° = 0.21V Determine the 3+ value of E °…
A: To determine the reduction potential (E°red) for the Ga3+/Ga half-cell from the given overall…
Q: Sagar
A: Utilising the Nernst equation, one can determine the cell potential E for the galvanic cell, which…
Q: The following titration curve was obtained for a weak acid/strong base titration. At what point(s)…
A: The objective of the question is to determine at what point(s) in the titration curve the pH of the…
Q: Draw the structure(s) of the major organic product(s), including counterions, of the following…
A:
Q: A 3.55 gram sample of an unknown gas is found to occupy a volume of 1.72 L at a pressure of 805 mm…
A: Approach to solving the question: Detailed explanation: Examples: Key references:
Q: dont provide handwritinhg solutiin...............
A: Step 1: An organic substance called methyl cyano acrylate has three different functional groups: an…
Q: 9. Determine the product of the following Diels-Alder reaction. CO₂Et 206°C
A: The single bonds are free to rotate. The rotations are made accordingly to facilitate the [4+2] type…
Step by step
Solved in 2 steps with 1 images
- please explain why this happends, im having trouble in this section. Part A Chymotrypsin, an enzyme that hydrolyzes peptide bonds in proteins, functions in the small intestine at an optimum pH of 7.7 to 8.0. How is the rate of the chymotrypsin-catalyzed reaction affected by each of the following conditions?When some sugars dissolve in water they spontaneously undergo changes in optical rotation called mutarrotation. The Mutarrotation of D-glucopyranose is catalyzed by acid and bases. 2-Hydroxypyridine is a more effective catalyst than phenol and pyridine for this reaction because: a.Both oxygen and N in 2-hydroxypyridine act as bases increasing the rapid interconversion of sugar b. The OH of 2-hydroxypyridine serves as the base while the current N as the acid. c. 2-hydroxypyridine acts both as a base to remove the proton from the hydroxyl group in the hemiacetal and as an acid to provide a proton to the oxygen in the hemiacetal. d.Phenol and pyridine are very expensive.An aldopentose "O", is oxidized with HNO3 to a diacid "P" which is optically active. The compound "O", is also degraded to an aldotetrose "Q" which undergoes another oxidation to an optically inactive diacid "R". Assuming that "O" has the configuration D-(4R); what are the structures of "O" to "R"?
- The rate constant for the uncatalyzed reaction of two molecules of glycine ethyl ester to form glycylglycine ethyl ester is 0.6 M- 1s - 1. In the presence of Co2 +, the rate constant is 1.5 * 106 M- 1s - 1. What rate enhancement does the catalyst provide?The hydrolysis of a biological thioester to the corresponding carboxyl-ate is often more complex than the overall result might suggest. The conversion of succinyl CoA to succinate in the citric acid cycle, for instance, occurs by initial formation of an acyl phosphate, followed by reaction with guanosine diphosphate (GDP, a relative of adenosine diphosphate [ADP]) to give succinate and guanosine triphosphate (GTP, a relative of ATP). Suggest mechanisms for both steps.Isoleucine, another of the twenty amino acids found in proteins, is metabolized by a pathway that includes the following step. Propose a mechanism.
- Imidazoleglycerol‑phosphate dehydratase is an enzyme in the histine biosynthesis pathway. It catalyzes the E1 dehydration of D‑erthyro‑imidazole‑glycerol phosphate to imidazole acetol‑phosphate. This is a rare example of a biological E1 reaction, as most biological elimination reactions occur through E1cB instead. In this reaction, D‑erthyro‑imidazole‑glycerol phosphate is first protonated to form a good leaving group. Then, the leaving group is ejected to form the resonance‑stabilized carbocation shown. Draw curved arrows forming the most stable resonance structure to explain why this reaction goes through an E1 mechanism. Draw curved arrows to form the most stable resonance structure.Identify the organic functional group(s) of the reactant, the reaction type, and predict the functional group(s) of the product(s) then draw the major product(s) The reactant is:a. deoxytetroseb. alcohol pentosec. ketohexosed. aldotriosee. aldopentoseThe reaction type is:a. acetal formationb. oxidation (benedict's)c. hemiacetal formationd. acetal hydrolysise. reduction (hydrogenation)f. mutarotationThe product should be:a. alpha 1-4 disaccharideb. deoxyhexosec. carboxylic acid pentosed. alcohol pentosee. alpha pyranosef. no reactionThe enzyme that catalyzes the Ca ¬ Cb bond cleavage reaction that converts serine to glycine removes thesubstituent (R) bonded to the a-carbon in the first step of the reaction. Starting with PLP bound to serine inan imine linkage, propose a mechanism for this reaction. (Hint: The first step involves removal of the protonfrom serine’s OH group.)
- An oligosaccharide isolated from an organism is found tocontain two glucose residues and one galactose residue.Exhaustive methylation followed by hydrolysis producedtwo glucoses with methoxy groups at positions 2, 3,and 6 and galactose with methoxy groups at positions2, 3, 4, and 6. What is the structure of the originaloligosaccharide?A hydrocarbon of unknown structure has the formula C8H10. On catalytic hydrogenation over the Lindlar catalyst, 1 equivalent of Η2 is absorbed. On hydrogenation overa palladium catalyst, 3 equivalents of Η2 are absorbed. (a) How many degrees of unsaturation are present in the unknown structure? (b) How many triple bonds are Present? (c) How many double bonds are present? (d) How many rings are present? (e) Draw a structure that fits the data.Chlorhexidine gluconate is available in different products in concentrations of 4% w/vand 0.12% w/v. H ow many milliliters of the more dilute product may be prepared fromeach fluidounce of the more concentrated product?