Part A KCl and Na2S Express your answer as a chemical equation. Identify all of the phases in your answer. Enter noreaction if no reaction occurs. ΑΣφ. ionic equation:

Q: Why do do volatile substances,like alcohol and acetone, produce a cooling effect on a surface from…

A: In the process of evaporation, the liquid changes into the gaseous (vapor) state. The physical state…

Q: ZnO(s) Zn(1) + O2 (g) Express your answer as a chemical equation. Identify all of the phases in your…

A: Given :-  ZnO(s) + ∆ → Zn(l) + O2(g)  To balance :-  Given equation

Q: What substance(s) is(are) considered to be spectators? i. H* 2- ii. iii. Na* iv. HCO, 2- V. vi. H20…

A:

Q: What is the critical point for CO2?

A: At the critical point the gas and the liquid phases become identical and the visible boundary…

Q: 2. Which one of the following is not a physical property of water? A) It boils at 100°C at 1 atm…

A: Please find the attached images for answer

Q: Explain each of these properties of water, and describe how each is conferred by the dipolar nature…

A:

Q: Why P2 is obtained by subtracting the vapor pressure of water from the barometric pressure?

A:

Q: Pb(NO3)2(aq) + 2KC1(ag) Express your answer as a balanced chemical equation. Identify all of the…

A: In general chemical reaction are written in equation form In a chemical equation left side…

Q: Vhat would the strongesSt a. CHCI3 b. KF in water c. CF4 d. CH3NH2 hoices of answers:(type disp for…

A: The strongest intermolecular attractive forces: a. CHCl3 - dd

Q: АСTIVITY 2 - а3 Interpreting a Phase Diagram Refer to the following phase diagram of a certain…

A: We are authorized to answer the first three subparts of a question at a time. Since you have not…

Q: Liquid methane appears to be the only other substance found in quantity in a liquid state in the…

A: Given information,     If our ocean were of liquid methane rather than liquid water

Q: a) For Mn3+, write an equation that shows how the cation acts as an acid. Express your answer as a…

A: According to Arrhenius acid theory ‘acid is that chemical compound which increases the concentration…

Q: different apparatus or instruments used to determine melting point.

A:

Q: Describe the molecular basis of the property of water responsible for the presence of ice on the…

A: The melting point of water is 0oC. So whenever the temperature of the surroundings drops below 0oC,…

Q: C5H6O(l)+O2(g)→CO2(g)+H2O(g)C5H6O(l)+O2(g)→CO2(g)+H2O(g) Express your answer as a balanced chemical…

A: Chemical equation is the representation of a chemical reaction, in which the reactants and products…

Q: Chemistry What is the state of compounds (1) to (6) when these are exposed at 0 °C under 1 atm.…

A: There are three states of matter we observe in our daily life. These states of matter are gas,…

Q: Temperature (°C) -77.7 Selected Points Triple point Critical point Normal boiling point Normal…

A:

Q: HCI(ag) + Mg(s)¬MgCl2(aq) + H2(9) Express your answer as a chemical equation. Identify all of the…

A:

Q: 5- To know the number of neighboring water molecules linked by H-bond to a molecule, and to describe…

A:

Q: 1. What is the function of carbon filter in water treatment?

A: According to guidelines we are supposed to solve only the first question. Please post other…

Q: Question attached

A: Acid react with a base to form salt and water.

Q: 5. In the Dumas method for determining the molar mass of an unknown volatile liquid, a sample of a…

A: We have find out the molar mass of the unknown and   temperature be when the pressure is 1.20 atm…

Q: What is the effect of 1-atm Pressure on the Boiling Points of Neon, Argon, Oxygen, and Water

A:

Q: HCl(aq)+Ba(OH)2(aq)→  Express your answer as a chemical equation. Identify all of the phases in your…

A:

Q: What will happen the sulfate ions supplied to the winogradsky column’s mud as (NH4)2SO4?

A: Given : The winogradsky column’s mud as (NH4)2SO4     To find:  What will happen the sulfate ions…

Q: How many kilojoules are needed to vaporize 10.0 g of H2O(1)?

A: Number of moles of water is determined as follows, No.of mol= Mass/Molar mass = 10.0 g/18.02 g.mol =…

Q: The hydrogen and oxygen bonds of water are easily broken by iconic solids. Justify your answer.

A: The interaction of water is very different with polar particles than with nonpolar substances.…

Q: What is the best way to extract water from air?

A:

Q: How many grams of Pb(NO3)2 (331.2 g/mol )are needed to prepare 200 ppm (w/v) of Pb*2 (207.2 g/mol)…

A: NOTE: please note none of the given option is correct.  I have  solved it correctly and written the…

Q: 7 questions for Properties of Liquids and IMF

A: There are various types of intermolecular forces such as hydrogen bonding, vanderwaal interaction,…

Q: models are functional tools that scientists use to explain complex behaviors. What is a benefit of…

A: The spacefill model is used in chemistry to represent the 3-D structure of molecules using spheres…

Q: K2O(s)+H2O(l)→KOH(aq)K2O(s)+H2O(l)→KOH(aq) Express your answer as a balanced chemical equation.…

A: The given unbalanced chemical equation is represented as follows:

Q: Which of the following effects is produced by the high surface tension of water?   Group of answer…

A: You have two beakers. One contains pure water, the other contains pure methanol (wood alcohol). The…

Q: 2. Suggest how a thixotropic solution that is 96% water might be used in fighting fires. Would it…

A:

Q: A sample of lead glass is prepared by melting together 20.0g silica , SiO2 and 80.0g of lead (II)…

A:

Q: Describe the molecular basis of the property of water re-sponsible for the presence of ice on the…

A: The melting point of water is 0oC . So whenever the temperature of the surroundings drops below 0oC,…

Q: Explain the concept of Boyle's law in spray paint.

A: Boyle's Law:-According to Boyle's law at a fixed temperature, the volume of gas is inversely…

Q: HClO4(aq)+NaOH(aq)→ Express your answer as a chemical equation. Identify all of the phases in your…

A: The acid react with base to form salt and water , called as neutralization reaction.

Q: Write a balanced equation for the complete combustion of solid palmitic acid. Use H2 O(1) in the…

A: A balanced chemical is equation has equal numbers of atoms for each element involved in the reaction…

Q: Why do do volatile substances,like alcohol and acetone, produce a cooling effect on a surface from…

A: Volatile substances are those substances that can change their state from liquid to vapor phase…

Q: Organic molecules change phases above 300°C. O True O False

A: Organic molecule chnges phases

Q: LOWEST

A: Boiling point is the temperature at which the solid decomposes completely.Boiling point is different…

Q: Write the ions present in solution of Sn(NO2)4. Express your answers as chemical formulas separated…

A: Write the ions present in solution of Sn(NO2)4. Write the ions present in solution of NaHCO3. Write…

Q: water molecules don't participate in hydrogen bonding.

A: For any molecule to form H bonds, it should be having a H atom directly attached to high…

Q: 92.56 grams of mercury have contaminated a drinking water source with a volume of 7.5 x 105 m^3.…

A: Given Information: Weight of Mercury= 92.56 g Volume of water source= 7.5 x105 m3= 787.5 m3 = 787.5…

Q: Vapor Pressure (kPa) 120 100 80 60 40 20 0 0 10 20 30 50 60 Temperature (C) 40 70 80 90 100 The…

A: At the boiling point of water , the atmospheric pressure and vapour pressure of the water at given…

Q: Nz1g) + % Hy(9) NH, lg) 2 N219) 19,4 65.0

A: