(Q92) What is the value of the equilibrium constant (Keq) when it occurs at 727°C? Sn4+ (aq) + Zn (s) -- ---> Sn²+ (aq) + Zn²+ (aq) The reduction potentials for the two half-reactions involved are: Sn4+ + 2 e---> Sn²+ (E°RED) = 0.15 V Zn²+ + 2 e---> Zn (s) (E°RED) = -0.76 V O 1.32 x 1021 O 2.43 x 10-1 O 1.40 x 106 4.14 x 1012 O 1.49 x 10⁹

(Q92) What is the value of the equilibrium constant (Keq) when it occurs at 727°C? Sn4+ (aq) + Zn (s) -- ---> Sn²+ (aq) + Zn²+ (aq) The reduction potentials for the two half-reactions involved are: Sn4+ + 2 e---> Sn²+ (E°RED) = 0.15 V Zn²+ + 2 e---> Zn (s) (E°RED) = -0.76 V O 1.32 x 1021 O 2.43 x 10-1 O 1.40 x 106 4.14 x 1012 O 1.49 x 10⁹

Chemistry for Engineering Students

4th Edition

ISBN:9781337398909

Author:Lawrence S. Brown, Tom Holme

Publisher:Lawrence S. Brown, Tom Holme

Chapter13: Electrochemistry

Section: Chapter Questions

Problem 13.40PAE: Calculate the equilibrium constant for the following reactions using data from the standard...

See similar textbooks

Similar questions

Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
The saturated calomel electrode. abbreviated SCE. is often used as a reference electrode in making electrochemica1 measurements. The SCE is composed of mercury in contact with a saturated solution of calomel (Hg2Cl2). The electrolyte solution is saturated KCI. is +0.242 V relative to the standard hydrogen electrode. Calculate the potential for each of the following galvanic cells containing a saturated calomel electrode and the given half-cell components at standard conditions. In each case. indicate whether the SCE is the cathode or the anode. Standard reduction potentials are found in Table 17.1. a. Cu2++2eCu b. Fe3++e-Fe2+ c. AgCl+e-Ag+Cl- d. Al3++3eAl e. Ni2++2eNi
What cathode potential (versus SCE) would be required to lower the total Hg(II) concentration of the following solutions to 1.00 10-6 M (assume reaction product in each case is elemental Hg): (a) an aqueous solution of Hg2+? (b) a solution with an equilibrium SCN- concentration of 0.100 M? Hg2+ + 2SCN- Hg(SCN)2(aq) = Kf = 1.8 107 c) a solution with an equilibrium Br- concentration of 0.100 M? HgBr42++ 2e- Hg(l) + 4Br- E0= 0.223 V
In biological systems, acetate ion is converted to ethyl alcohol in a two-step process: CH3COO(aq)+3H+(aq)+2eCH3CHO(aq)+H2OE=0.581V CH3CHO(aq)+2H+(aq)+2eC2H5OH(aq)E=0.197V (E°' is the standard reduction voltage at 25°C and pH of 7.00.) (a) Calculate G°' for each step and for the overall conversion. (b) Calculate E°' for the overall conversion.
The cell Ag|AgCl(sat’d)||H+(a = x)|glass electrode has a potential of —0.2094 V when the solution in the right-hand compartment is a buffer of pH 4.006. The following potentials are obtained when the buffer is replaced with unknowns: (a) —0.2806 V and (b) —0.2132 V. Calculate the pH and the hydrogen ion activity of each unknown. (c) Assuming anuncertainty of 0.001 Vin the junction potential, what is the range of hydrogen ion activities withinwhich the true value might be expected to lie?
Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.
What is wrong with the following statement: The best concentration cell will consist of the substance having the most positive standard reduction potential. What drives a concentration cell to produce a large voltage?
Calculate the equilibrium constant for the following reactions using data from the standard reduction potential tables. (a) Cl2(g)+2Br-(aq)Br2(g)+2Cl-(aq) (b) Ni(s)+2Ag+(aq)2Ag(s)+Ni2+(aq) (c) I2(s)+Sn2+(aq)2I(aq)+Sn4+(aq)
(a) Is it easier to reduce water in acid or base? To evaluate this, consider the half-reaction 2H2O() + 2 e 2 OH(aq) + H2(g) E = 0.83 V (b) What is the reduction potential for water for solutions at pH = 7 (neutral) and pH = 1 (acid)? Comment on the value of E at pH = 1.